Which of the following describes the purpose of GWAS analysis OGWAS analysis identify genes that are associated to a complex trait in humans that is affected by multiple genes OGWAS analysis identify genes that follow Mendelian traits WAS analysis identify traits that have a genetic component and affect many people OGWAS determines the genetic cause for complex traits OGWAS analysis identify genes that are associated to a complex trait in humans that is affected by a single gene

Q: What is Ubiquinone?

A: ATP is the energy currency of the cells produced by oxidative phosphorylation.

Q: What are the correct names for CH3CH₂CH₂CH₂CH₂CH=CHCH₂CH=CHCH₂(CH₂)6COOH: 6,9-Octadecdienoic acid;…

A: Fatty acids are long chain molecules of carbon backbone. Based on the structure, fatty acids are…

Q: Excess vitamin K in natural forms is not toxic, toxicity occurs with synthetic vitamin K called…

A: The vitamins are the essential nutrients which we get mostly from the food .

Q: are nitrogen bases with two rings.

A: Nitrogen bases are an integral part of a nucleotide from which the DNA is made. Apart from nitrogen…

Q: gar is pois

A: Sugar is a form of soluble carbohydrate that is sweet and is used in food items. Variety of sugar…

Q: Identify the amino acid (s) present in this structure.

A: The given molecule is a dipeptide i.e. it is composed of 2 amino acids bonded via a peptide bond.…

Q: Having been carried from adipose tissue in the bloodstream, fatty acids are taken into muscle by…

A: Answer : such as albumin and triacylglycerols. Reason : Fatty acids are either complexed with…

Q: The prescriber ordered oxacillin 500mg IM q6h.  The instructions on the 2g vial state to…

A: The nurses administer the drugs to the patient, and thus it is very much necessary for the nurses to…

Q: A. How many ATP's could theoretically be produced when a granule of glycogen is hydrolyzed to…

A: Glycogen is the storage form of glucose in the body localized in the liver. Glycogen is a highly…

Q: Draw the structure of cellulose and amylose and state their structural similarities and differences.

A: Amylose is generally water-soluble and also it is a long unbranched chain with 200-1000 alpha…

Q: Figure 2 shows the structure of Diidopropylphosphofluoridate. Explain how this compound inhibits…

A: Enzymes are those molecules that increase the pace of the reaction without undergoing any change to…

Q: Define the term Steroids and Waxes.

A: Hormones are chemical messengers, that are mainly released by several glands. The hormones travel in…

Q: Why was dinitrophenol once used as a diet drug?

A: There are several inhibitors that affect the oxidative phosphorylation in the cell. Uncouplers are…

Q: What is bromodeoxyuridine (BrdU) ?

A: Bromodeoxyuridine(BrdU): It is a synthetic nucleoside analog of thymidine that is incorporated into…

Q: The chemical formula for deoxyribose is C___ H___O____.

A: deoxyribose is a monosacchride molecule .

Q: _____________ are nonsuperimposable, non-mirror-image stereoisomers.

A: Stereoisomerism is considered as the spatial arrangement of the atoms which differs in isomers.

Q: A fatty acid that has the molecular formula CH3(CH2)4(CH=CHCH2)2(CH2)6COO" is an w-6 fatty acid. O…

A: Introduction: Fatty acids are carboxylic acids with hydrocarbon side chain. They are one of the…

Q: There are several sugars along with fructose and glucose that are isomeric, name them

A: The question asked for a list of sugars that are isomeric to fructose and glucose. Isomers are…

Q: What chemical reaction involving the cysteine molecule produces a                 disulfide bond?

A: Proteins are polymers made up of amino acids. Each amino acid is made up of a hydrogen atom, an…

Q: What exactly is the significance of the abbreviation DFR?

A: Introduction  Enzymes are proteins that catalyze or speed up chemical reactions in living organisms.…

Q: Name a naturally occurring carbohydrate and its source for each type of carbohydrate listed in…

A: Carbohydrate is a biomolecule that contains hydrogen, oxygen, carbon, and the hydrogen atom.…

Q: How many trimethylcyclopentanes are possible?

A: The chemical name of trimethycyclopentane is  CIS, CIS, TRANS-1,2,4-TRIMETHYLCYCLOPENTANE.

Q: 41 You need to give benzylpenicillin at a dose of 200 mg to a 6-month-old baby. The displacement…

A: Benzylpenicillin - known as penicillin G, is a narrow-spectrum antibiotic of the beta-lactam group,…

Q: When a purine or pyrimidine is linked through a b-Nglycosidic link to C-1 of a pentose, the molecule…

A: Nucleosides are the structural subunit of nucleic acids such as DNA and RNA. It consists of…

Q: Average net charge of +2 predominates: а. b. The predominant species is…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: Why is trypsin an unusual name for an enzyme? (What is the convention for enzyme names?)  .

A: The enzymes are the biocatalyst that perform specific biochemical reaction within the body and after…

Q: 17-21 Is the rea (PEP) a re

A: Glycolysis is the process of breaking down glucose into two pyruvate molecules results in the…

Q: Why Ranitidine is better than Cemitidine

A: Peptic ulcer disease There are several drugs used to treat peptic ulcer disease. Peptic ulcer is…

Q: A fully folded, functional single polypeptide is in ____________________ structure.

A: Proteins are composed of amino acids, which are bound together by peptide linkage. Amino acids…

Q: The product formed that indicates a positive test for Benedict's O furfural nucleoside O phosphate…

A: Since your images contain multiple questions therefore as our standard procedure we'll answer your…

Q: Sorbital sugar has two names

A: Sorbitol is a sugar alcohol or polyol that is a water-soluble compound. It is found naturally in…

Q: Draw a linear disaccharide of glucose. is an alternating alpha (1-4) and b (1-4) linkages energy…

A: Introduction:- The question is all about the structure of glucose that are isomers of each other as…

Q: Elevated concentration of blood ketones is referred to as _____________.

A: Ketone bodies are the water-soluble molecules containing the keone group that is produced by the…

Q: Find the connection among the words below and choose the letter of the word which is different. O A.…

A: DNA fragment separation is accomplished using the agarose gel electrophoresis technique. It…

Q: Match each term with the most appropriate description. Each answer may be used only once. DO DO…

A: Transition state : An transition state is present in every enzymatic reaction. The maximum energy is…

Q: The following compound is best identified as (blank). O *NH3-CH-C-NH-CH-COO- Ť" CH3 CH₂ OH O a…

A: Any living cell is made up of biomolecules. These biomolecules can be classified into the following…

Genetic Variation

Genetic variation refers to the variation in the genome sequences between individual organisms of a species. Individual differences or population differences can both be referred to as genetic variations. It is primarily caused by mutation, but other factors such as genetic drift and sexual reproduction also play a major role.

Quantitative Genetics

Quantitative genetics is the part of genetics that deals with the continuous trait, where the expression of various genes influences the phenotypes. Thus genes are expressed together to produce a trait with continuous variability. This is unlike the classical traits or qualitative traits, where each trait is controlled by the expression of a single or very few genes to produce a discontinuous variation.