Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:Since, molar mass of ethyl alcohol is 46.068g/mol, therefore, number of moles of ethyl…
Q: Asnwer are already written in pink, I would just like an explanation of how the answers where…
A: Part 2:Explanation: Reaction 1:1. Step 1: 3 NaNH2, NH3 - This step involves the use of sodium…
Q: At 100° C, the Keq for the Haber process is 4.51 x 10-5: N2 + 3 H2 ------> 2 NH3 Consider the…
A: The Haber process is a chemical reaction in which nitrogen (N2) and hydrogen (H2) combine to form…
Q: HELP! Lab Thermodynamics of Solubility: Use the formulas that are provided on the graph. 1.Using…
A: 1. Using equation 1, calculate the K for each temperature:K = (s)(s) = s²Trial 1:K = (7.9)(7.9) =…
Q: could you anwer this?
A: (a) Lewis structure:As per the given number of valence electrons, sulfur has 6 valence electrons…
Q: Give me detailed Solution with explanation needed. don't use Ai for answering this
A: Step 1:When atoms with different electronegativity forms a covalent bond then shared electrons…
Q: A 13C NMR spectrum is shown for a molecule with the molecular formula of C4H8O2. Draw the structure…
A:
Q: Chain-growth polymerization is a polymerization process that where unsaturated oligomers molecules…
A: Answer: FALSE Chain-growth polymerization is a polymerization technique where unsaturated MONOMER…
Q: Show a synthesis of the following mostly (Z)-alkene molecule starting from benzene (C6H6), any other…
A: Here's a detailed explanation of each step in the synthesis:**Step 1: Grignard Reaction**The first…
Q: Please answer in tipping format
A: Step 1: Step 2: Step 3: Step 4:
Q: Numbering the main chain of branched alkanes For each organic compound in the table below, enter the…
A: The locant number can be found from IUPAC nomenclature. For that purpose, first identify the longest…
Q: Naming the parent hydrocarbon of branched alkanes For each organic compound in the table below, name…
A: Step 1: Step 2: Step 3: Step 4:
Q: A substance has a half-life of 2.141 minutes. If the initial amount of the substance was 307.2…
A: The first step is to determine the number of half-lives that have passed. This can be done by…
Q: Please help me solve the following question, explain it and pls pls make sure its correct, its…
A: The key information given in the problem is:Four research teams measured the rotation period of a…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Step 2: Lithium aluminum hydride(LiAlH4) is a powerful reducing agent used in chemistry. It…
Q: Naming the parent hydrocarbon of branched alkanes For each organic compound in the table below, name…
A: The main carbon chain which has the longest carbon chain or has the principal carbon chain is the…
Q: 44) What is the coefficient of phosphorus after balancing the following equation?__ P(s) + __ O2 (g)…
A: The unbalanced chemical equation is P(s) + O2 (g) º P2O5 (s). In this equation, we need to find the…
Q: The reaction of Nb (CH2CMe3)3Cl2 with two equivalents of LiCH2CMe3 leads to the formation of…
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Approach to solving the question: Detailed explanation: Biological oxygen demand (BOD) is a measure…
Q: The non-polar molecule among the following is CI CI C H H Type here to search Εί prime video CI…
A: In chemistry, polarity refers to the distribution of electric charge around atoms, ions, or…
Q: Help me solve the following question, explain and make sure everything is correct thanks 100!!
A:
Q: Please correct answer and don't use hend raiting
A: Approach to solving the question: When crafting a response to a message like the one provided, it's…
Q: Please correct answer and don't use hend raiting
A: Step 1: Boiling point elevation is given by:ΔT = ((RT2)/ΔHVap) XsolHere, ΔT = Boling point…
Q: Chemistry
A: To calculate ΔH, ΔS, ΔG, and ΔA for the process described, we will use the given data and standard…
Q: None
A: Thank you,
Q: Give detailed mechanism Solution with explanation needed..don't give Handwritten answer...
A:
Q: None
A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…
Q: Identifying the main chain of branched alkanes Tag each carbon atom in the main chain of the…
A: Marked by green line is the main chain.2-methylpentane :- Hydrogen replaced by Methyl group in…
Q: Please don't provide handwritten solution ...
A: To determine the hybridization of an atom, we need to consider the number of regions of electron…
Q: Chemistry
A: Step 1:Step 2:Step 3:
Q: Draw the reaction mechanism for the synthesis of complex N: show electron transfer arrows
A: The starting material, Cp2TiCl2, is a titanium complex containing two Cp ligands and two chlorine…
Q: At 100° C, the Keq for the Haber process is 4,51 x 10-5: N2 + 3 H2 ó 2 NH3…
A: Step 1: Step 2: Step 3: Step 4:
Q: che.3
A: A chiral center (also called a stereocenter or asymmetric carbon) is a carbon atom that is bonded to…
Q: (i) Suggest structures for the reagents and products in the boxes labelled A to H in the reaction…
A: Step 1:Step 2: Step 3: Step 4:
Q: Which of the following molecules can be classified as a lipid?…
A: Lipids are a diverse group of biomolecules that share the common property of being hydrophobic,…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Step 2:Step 3: Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: To give IUPAC name for any compound, firstly we have to select longest chain, that is…
Q: None
A: Step 1:Step 2:Step 3:
Q: 3. Draw 1,3-cyclohexanedione and CIRCLE any a-acidic hydrogens (Box A). Place the number of a-acidic…
A: According to this question, let's first draw the structure of 1, 3 - cyclohexanedione and identify…
Q: 5.. Write the two cyclized products that are obtained upon base catalyzed cyclizaion of A EtO ཨི།…
A: Step 1: There two types of carbanions cn be forms A and B from 2 types of protons in path a and…
Q: Help me solve this
A: STEP - 1:Given that,Diameter of air bubble is, d1=2cmDepth of submarine h=40mdensity of water…
Q: Please don't provide handwritten solution.... Show how the aldol condensation could be used to…
A: In an aldol condensation, the first step is to identify the alpha carbon and the carbonyl group in…
Q: Nitrogen dioxide is one of the many oxides of nitrogen (often collectively called "NOx") that are of…
A: The chemical reaction of nitrogen dioxide (NO2) forming dinitrogen tetroxide (N2O4) can be…
Q: Umesh
A: Step 1: As the substance or compound is not mentioned for first 2 questions, it is considered as…
Q: Identify the functional groups in the following molecules. (Use names from the table below. List…
A: To identify the functional groups in the given molecules, we will examine each molecule and list the…
Q: 3. Provide the major organic product of the following reaction. Use line angle structures to show…
A: Step 1:Hydrazene 2 is a nucleophile. The ketone oxygen takes up proton from the acid and polarizes…
Q: None
A: Part A :Step 1:Monoprotic acid means the acid has one replaceable hydrogen atom. Let formula of the…
Q: Plz draw out the full mechanisms for problem 3!
A: Step 1: Step 2: Step 3:Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Explanation : We know, unit conversion :1 km = 1000 m and 1 m = 100 cm Therefore, 1 km = 1000 x 100…
Q: Give detailed Solution with explanation needed with structures. Don't give Handwritten answer
A: Step 1:Despite having chiral center when a compound has an element of symmetry then it gets turned…
- What molar concentration of hydrazine, N2H4 (Kb = 1.7 x 10-6) yields a solution with a pH of 10.46?
Unlock instant AI solutions
Tap the button
to generate a solution
Click the button to generate
a solution
- What was the original 1. concentration (M) of an aqueous acetic acid (CH3COOH) solution whose pH is 2.68 (25.0 oC)? The Ka = 1.80 x 10–5When ammonium sulfate dissolves, both the anion and cation have acid-base reaction: (NH4)2SO4(s) 2NH4* + SO42- NH4* + NH3(aq) + H* SO2- + H2O → HSO4 + OH Ksp = 276 Ka = 5.70 x10-10 Кь 3 9.80 х 10-13 (a) (b) (c) Write a charge balance for this system. Write a mass balance for this system. Find the concentration of NH3(aq) if the pH is fixed at 9.25.Calculate the pH of a 0.052 M (C2H5)2NH solution (Kb = 1.3 × 10-³). pH =
- Q3. This question is about the pH of several solutions. Give all values of pH to 2 decimal places. (a) (i) Write an expression for pH. (b) (ii) Calculate the pH of the solution formed when 10.0 cm³ of 0.154 mol dm-³ hydrochloric acid are added to 990 cm³ of water. The acid dissociation constant, Ka, for the weak acid HX has the value 4.83 x 10-5 mol dm-³ at 25 °C. A solution of HX has a pH of 2.48 Calculate the concentration of HX in the solution. Page 4 of 14A diprotic acid (H₂A) has Kal = 4.54 x 10-7 and K₁2 = 5.59 x 10-¹1. What is the pH of a 0.396 M H₂A solution? pH =Calculate the pH of a weak base solution ([B]o > 100 • Kp). Calculate the pH of a 0.104 M aqueous solution of triethanolamine (C,H1503N, K, = 5.8×10") and the equilibrium concentrations of the weak base and its conjugate acid. pH (C,H1503N]equilibeium (C,H15O3NH"]equilibrium Check & Submit Answer Show Approach Calculate the pH of a weak base solution (quadratic equation). Calculate the pH of a 0.0362 M aqueous solution of ethylamine (C,H;NH2. Kg – 4.3×10“) and the equilibrium concentrations of the weak base and its conjugate acid. pH (C,H;NH;lequilibrium M. (C,H,NH3" Jequilibrium M. Check & Submit Answer Show Approach
- Calculate the molar concentration of formic acid, HCOOH (Ka = 1.80 x 10-4) that was 3% ionized.Calculate the pH of a 6.9 x 10¬³-M solution of H2SO4 ( 1.2 x 10-2). -3 a2 pH =2:10 2- 3C₂²- + 1 2 3 4 N Complete the balanced chemical reaction for the following weak base with a strong acid. In this case, write the resulting acid and base as its own species in the reaction. NH3(aq) + HCl(aq) (s) Question 1 of 10 O Reset LO 5 OH H₂O 6 CI 7 6 个 x H₂O Tap here or pull up for additional resources Submit 8 9 11 (aq) O H H3O+