What is the intermediate of the following reaction? Submit your answer as a SMILES string. Be sure to include appropriate stereochemistry in your answer 1. DMSO (xs) (COCI)2 (xs) ТВАF 1A 1B CH2CI2, -78°C 2. EtzN, (xs), -78°C THE 'OH, The starting material SMILES string is CCOC(=0)C[C@H]1C[C@@H](C)C[C@@H](O)[C@@H]1CCCO[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C(C)(C)C UESTION 3

Box 1 and 3 are correct. I just need help with box 2.

Choose reagents from the following list which will lead to an effective synthesis as shown below. List the letters for each reagent, in the correct order, with no spaces or commas between them (for example, BD represents a two-step synthesis that begins with reagent B and concludes with reagent D). A) Br2, CCl4 B) NaNH2 (1 equiv.) C) excess NaNH2, followed by H₂O D) CH 31 E) CH3CH₂I F) CH3CH₂CH₂Br G) H₂SO4 H) Na, NH3 (liq.) I) H₂, Pt J) H₂, Lindlar's catalyst K) HBr L) HBr, ROOR M) O3, followed by DMS N) O3, followed by H₂O Hint First extend the carbon chain to the correct length. Br

Please help, need correct solution with some explanation. Will definitely provide helpful ratings. Thank yu