Question 23: Calculate the Ecell in volts of a Zn-Ag* cell under the following nonstandard conditions as listed in the problem below: Zn(s) + 2Ag+ (aq) --> Zn2+ (aq) + 2Ag(s) Calculate the cell potential at 25 degrees C when the silver ion concentration is 0.020 M and the zinc ion concentration is 1.6 M. Express your result to 4 decimal places Ecell = Check V Reuse <> Embed For the same cell you examined in Question 23, answer Question 24 below: Question 24: Calculate the zinc ion concentration necessary when the silver ion concentration is 0.025 M for the Ecell (cell potential) to be 1.5000 V. The temperature is 25 degrees C. Express your result to 2 significant figures. M Check Reuse <> Embed H-P H-P

What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?

Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)

Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)

What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)

What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?

a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).

For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)

An electrochemical cell consists of a silver metal electrode immersed in a solution with [Ag+] = 1.0 M separated by a porous disk from a copper metal electrode. If the copper electrode is placed in a solution of 5.0 M NH3 that is also 0.010 M in Cu(NH3)42+, what is the cell potential at 25C? Cu2+(aq)+4NH3(aq)Cu(NH3)42+(aq)K=1.01013

A typical total phosphate concentration in a cell, [HPO42] + [H2PO4], is 2.0 102 M. What are the concentrations of HPO42 and HPO4 at pH 7.40?