Q11.51 O Homework Answered Which of the following regions " to "V" indicate the following transition? Als) All) +11 Temperature (℃) 1 Heat added Select an ane and For kant navigation, use the best H

A cubic piece of uranium metal (specific heat capacity = 0.117 J/C g) at 200.0C is dropped into 1.00 L deuterium oxide ("heavy water;" specific heat capacity = 4.21 I J/C g) at 25.5C. The final temperature of the uranium and deuterium oxide mixture is 28.5C. Given the densities of uranium (19.05 g/cm3) and deuterium oxide (1.11 g/mL). what is the edge length of the cube of uranium?

9.36 Define the term calibration.

9.86 You make some iced tea by dropping 134 g of ice into 500.0 mL of warm tea in an insulated pitcher. If the tea is initially at 20.0°C and the ice cubes are initially at 0.0°C, how many grams of ice will still be present when the contents of the pitcher reach a final temperature? The tea is mostly water, so assume that it has the same density (1.0 g/mL), molar mass, heat capacity (75.3 J K-1 mol-1), and heat of fusion (6.0 kJ/mol) as pure water. The heat capacity of ice is 37.7 J K-l mol-l.

Starting with equation 2.27 andthe original definitionof enthalpy, derive the fact that Cp-=Cv-+R

Given the following (hypothetical) thermochemical equations: A+B2C;H=447kJA+3D2E;H=484kJ2D+B2F;H=429kJ Calculate H, in kJ, for the equation 4E+5B4C+6F

A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?

Strontium metal is responsible for the red color in fireworks. Fireworks manufacturers use strontium carbonate, which can be produced by combining strontium metal, graphite (C), and oxygen gas. The formation of one mole of SrCO3 releases 1.220103 kJ of energy. (a) Write a balanced thermochemical equation for the reaction. (b) What is H when 10.00 L of oxygen at 25C and 1.00 atm are used by the reaction?

Ethanol, C2H5OH, is used as a fuel for motor vehicles, particularly in Brazil. (a) Write the balanced equation for the combustion of ethanol to CO2(g) and H2O(g), and, using the data in Appendix G, calculate the enthalpy of combustion of 1 mole of ethanol. (b) The density of ethanol is 0.7893 g/mL. Calculate the enthalpy of combustion of exactly 1 L of ethanol. (c) Assuming that an automobile’s mileage is directly proportional to the heat of combustion of the fuel, calculate how much farther an automobile could be expected to travel on 1 L of gasoline than on 1 L of ethanol. Assume that gasoline has the heat of combustion and the density of n—octane, C8H18(Hf=208.4kJ/mol;density=0.7025g/mL).

Hydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJ