Identify the following carbohydrate: CH(O)-CH(OH)-CH(OH)-CH(OH)-CH(OH)-CH2(OH) a disaccharide (glyceraldehyde linked to dihydroxyacetone) a polysaccharide (the aldose polymer called amylopectin) a monosaccharide (the ketose sugar fructose) a monosaccharide (the aldose sugar glucose) E. a disaccharide (glucose linked to fructose)

Give the molecular and structural formulae for: –2 examples of structural isomers of monosaccharides –3 examples of stereoisomeric monosaccharides. (Do not include glucose, fructose, galactose)

Although the first two carbons of fructose and glucose are identical in structure to DHAP and GADP (from glycolysis), DHAP and GADP equilibriate on their in solution to favor the ketone over the aldehyde, while fructose and glucose do not.  Why? a)The larger size of the molecule sterically hinders the isomerization b)The larger sugars have more OH groups which hydrogen bond and disrupt isomerization c)The larger sugars cyclize, and there is no carbonyl to isomerize in the cyclic form d)The larger sugars cyclize, and in the cyclic form the hydrogen bonding is very strong e)The larger sugars are less soluble in water than the smaller sugars

Consider this monosaccharide. H H OH H .OH HO H HO H CH₂OH Part: 0/3 Part 1 of 3 Label the chirality center(s) for the monosaccharide by highlighting the carbon(s) in the structure below. H H -OH H -OH HO -H HO -H CH₂OH હે