How many grams of H 2 are needed if we want to make 95.44 grams of NH 3 by the reaction N2 + 3H2 2 NH 3

4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?

4.49 Small quantities of hydrogen gas can be prepared by the following reaction: Zn(s)+H2SO4(aq)ZnSO4(aq)+H2(g) How many grams of H2 can be prepared from 25.0 mL of 6.00 M H2SO4 and excess zinc?

3.93 Adipic acid is used in the production of nylon, so it is manufactured in large quantities. The most common method for the preparation of adipic acid is the reaction of cyclohexane with oxygen. Balance the skeleton equation shown be1ow.

4.85 In the cold vulcanization of rubber, disulfur dichloride (S2Cl2) is used as a source of sulfur atoms, and those sulfur atoms form “bridges,” or cross-links, between polymer chains. S2Cl2 can be produced by reacting molten sulfur (S8(l)) with chlorine (Cl2(g)). What is the maximum mass of S2Cl2 that can be produced by reacting 32.0 g of sulfur with 71.0 g of chlorine?

3.92 Many chemical reactions take place in the catalytic con- verter of a car. In one of these reactions, nitric oxide (NO) reacts with ammonia (NH3) to give nitrogen (N2) and water. Write a balanced equation for this reaction.

One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?

The equation for the reaction of phosphorus and chlorine is P4(s) + 6 Cl2(g) 4 PCl3(). If you use 8000 molecules of P4, in this reaction how many molecules of C12 are required to consume the P4 completely?

The principal component of mothballs is naphthalene, a compound with a molecular mass of about 130 amu, containing only carbon and hydrogen. A 3.000-mg sample of naphthalene burns to give 10.3 mg of CO2. Determine its empirical and molecular formulas.

Determine the volume of sulfuric acid solution needed to prepare 37.4 g of aluminum sulfate, Al2(SO4)3, by the reaction 2Al(s)+3H2SO4(aq)Al2(SO4)3(aq)+3H2(g) The sulfuric acid solution, whose density is 1.104 g/mL, contains 15.0% H2SO4 by mass.