(d) Mg?+ (aq) + 2 e¯ → Mg(s)E° = - 2.37 VFe+ (ag) + 3 e → Fe(s)E°= -0.036 VO Fe(s) | Mg²+ (aq) || Fe*+ (ag) | Mg(s)O Mg(s) | Mg²+ (aq) || Fe³+O Mg(s) | Fe³+ (aq) || Mg²+ (ag) | Fe(s)O Fe(s) | Fe+(aq) || Mg²+ (aq) | Mg(8)(aq) | Fe(s) Give the standard line notation for each cell.(а) 2 IOз (аq) + 10 Cr (аq) + 10 H* (аq) — 10 Cr" (ag) + I2(ад) + 5 Нә0(1)O P(:) | Cr* (a), I> (aq) || Cr?* (аg), IO; (ад), н (аg) | Pt(s)O Pe(s) | Cr* (ag), IO; (ад), Н* (аq) | Cr* (aq), Iz (aq) І Pt(s)"(aд), I2 (aд) | Pt(8)O P(6) | 10; (aд), н* (аq), 1ә(аq) | Cr?* (ag), Cr** (ag) | Pt(6)Pe(s) | Cr* (aq), Сr* (aq) || IOз (aд), H* (ад), I2 (ад) | Pt(8)(b) Zn(s) +2 Ag* (aq) = Zn?+ (aq) + 2 Ag(s)O Ag(s)| Zn²+(aq) || Ag* (aq) | Zn(s)O Ag(s)| Ag*(aq) || Zn²+ (aq) | Zn(s)Zn(s) Ag* (ag) || Zn?+ (ag) | Ag(s)Zn(s) | Zn²+ (aq) || Ag* (aq) | Ag(s)(c) Н;О2(ад) + 2 H* (аq) + 2 е 2 Hә0(1)E°1.78 VО:(9) + 2 H (аq) + 2 е — Н,O%(аq)E° = 0.68 VO P(8) | H2О2(ад) | Pt(8)O Pt(s) | O2(9) | H,O2 (aq), H† (aq) || H,O2 (aq), H† (aq) | Pt(s)Pt(:) | H>О2(аq) | 02(9) || н* (аq) | Pt(8)O Pe(8) | H2О2(аg), H* (ад) || О2 (9) | Н-О2(ад), Н* (ад) | Pt(s)

Since you have posted a question with multiple sub-parts, we will solve the first three subparts for…

Give the standard line notation for each cell. (a) 2 103 (аq) + 10 Cr** (ag) + 10 H* (аq) — 10 Cr* (aq) + Iz(ag) + 5 H20(1) O Pt(s)| Cr³+ (aq), I2 (aq) || Cr²+ (ag), IO3¬(ag), H† (aq) | Pt(s) O Pt(s)| Cr²+ (aq), IO3¬(aq), H† (ag) || Cr³+ (ag), I2 (aq) | Pt(s) O Pt(s) | IO3¬(aq), H† (aq), I2 (aq) || Cr²+ (aq), Cr³+ (aq) | Pt(s) O Pt(s) | Cr²+(aq), Cr³+ (aq) || IO3¬(aq), H† (aq), I (aq) | Pt(s) (b) Zn(s)+2 Ag*(aq) = Zn²+ (aq) + 2 Ag(s) O Ag(s) | Zn²+ (aq) || Ag* (aq) | Zn(s) Ag(s) | Ag*(aq) || Zn²+ (aq) | Zn(s) Zn(s) | Ag*(aq) || Zn²+ (aq) | Ag(s) O Zn(s) | Zn²+ (ag) || Ag* (ag) | Ag(s) (c) H2O2(aq) +2 H* (aq) + 2 e¯ → 2 H2O(1) E° = 1.78 V О:(9) + 2 H* (аg) + 2 е > НәО:(аg) E° = 0.68 V O Pt(s)| H2O2(aq) | Pt(s) O Pt(s) | O2(9) | H2O2(aq), H† (aq) || H2O2 (aq), H* (aq) | Pt(s) O Pt(s) | H2O2(aq) | O2 (g) || H† (aq) | Pt(s) O Pt(s) | H2O2(aq), H† (aq) || O2(g) | H2O2(aq), H† (aq) | Pt(s)

Give the standard line notation for each cell. (a) 2 103 (аq) + 10 Cr** (ag) + 10 H* (аq) — 10 Cr* (aq) + Iz(ag) + 5 H20(1) O Pt(s)| Cr³+ (aq), I2 (aq) || Cr²+ (ag), IO3¬(ag), H† (aq) | Pt(s) O Pt(s)| Cr²+ (aq), IO3¬(aq), H† (ag) || Cr³+ (ag), I2 (aq) | Pt(s) O Pt(s) | IO3¬(aq), H† (aq), I2 (aq) || Cr²+ (aq), Cr³+ (aq) | Pt(s) O Pt(s) | Cr²+(aq), Cr³+ (aq) || IO3¬(aq), H† (aq), I (aq) | Pt(s) (b) Zn(s)+2 Ag(aq) = Zn²+ (aq) + 2 Ag(s) O Ag(s) | Zn²+ (aq) || Ag (aq) | Zn(s) Ag(s) | Ag(aq) || Zn²+ (aq) | Zn(s) Zn(s) | Ag(aq) || Zn²+ (aq) | Ag(s) O Zn(s) | Zn²+ (ag) || Ag* (ag) | Ag(s) (c) H2O2(aq) +2 H* (aq) + 2 e¯ → 2 H2O(1) E° = 1.78 V О:(9) + 2 H* (аg) + 2 е > НәО:(аg) E° = 0.68 V O Pt(s)| H2O2(aq) | Pt(s) O Pt(s) | O2(9) | H2O2(aq), H† (aq) || H2O2 (aq), H* (aq) | Pt(s) O Pt(s) | H2O2(aq) | O2 (g) || H† (aq) | Pt(s) O Pt(s) | H2O2(aq), H† (aq) || O2(g) | H2O2(aq), H† (aq) | Pt(s)

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 2RQ: Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a...

See similar textbooks

Similar questions

Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
If a 2.5 A current is run through a circuit for 35 minutes, how many coulombs of charge moved through the circuit?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?