Find and determine the R or S configura- tion for all chiral carbons in Geldanamycin, an antibiotic. You must be clear on which carbon atoms you are assigning the con- figurations to; draw arrows to the chiral carbon if you have to. Hint: There are six chiral carbons in this molecule. Calculate the total number of stereoisomers for Gel- danamycin. The formula for doing so is 2", where n is the number of stereocenters. CH30. H3C CH3O OH NH CH3 CH 30 CH3 NH₂

Find and determine the R or S configura- tion for all chiral carbons in Geldanamycin, an antibiotic. You must be clear on which carbon atoms you are assigning the con- figurations to; draw arrows to the chiral carbon if you have to. Hint: There are six chiral carbons in this molecule. Calculate the total number of stereoisomers for Gel- danamycin. The formula for doing so is 2", where n is the number of stereocenters. CH30. H3C CH3O OH NH CH3 CH 30 CH3 NH₂

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter23: The Chemistry Of Life

Section: Chapter Questions

Problem 62A

See similar textbooks

Similar questions

2. Draw the diastereomers for each of the molecules below. Indicate which ones are enantiomeric pairs. Hint: Use 2" where n= the number of chiral carbons.
Cortisone is a compound that is used as an anti-inflammatory drug to treat 2) diseases like arthritis. Cortisone is a steroid which contains four rings (A, B, C and D), and has the following structure: он "OH Cortisone Provide the data to complete each of the following statements: The total number of chiral carbons (stereocentres) in Cortisone is The maximum number of stereoisomers possible is: The degree of unsaturation (IHD) of Cortisone is The total number of 2° hydrogens is The ring fusion between rings B and C is trans or cis? The absolute configuration of the carbon with * in the structure is The total number of n bonds is
A chiral molecule is one that is not superposable on its mirror image, thus a chiral carbon is a carbon atom with 4 different groups attached into it. In the ff: structures below, using asterisk (*) to mark the chiral carbon. (Hint: There can be more than 1 chiral center in a molecule) он HO. он (a) (c) но OH он Lactic acid Ascorbic acid (vitamin C) он он но. (b) (d) HO Glyceraldehyde Estradiol (an estrogen)
Mark all chiral carbons with a star in the following molecules.
(a) Consider structure Y. OH CH3 C-0-CH3 Structure Y i. Redraw structure Y, circle and name all the functional groups that exist in Y. ii. Label the chiral carbons in asterisks(*).
Deliberately draw a CORRECT and INCORRECT stereo-representation of the the chiral molecule, RCH(OH)CH3, showing the dash and wedge and straight bonds. Indicate which is correct, and which is incorrect.
Identify the labeled chiral carbons as R or S in the molecules shown below. HO O C... H' 1) OH C: H 2) CH3 CH3 Select an answer and submit. For keyboard navigation, use the up/down arrow keys to select an answer. OH
Consider the following structure and its labeled carbon atoms, which ones are chiral centers, mark all that apply N a
1. How many chiral carbon atoms are in the following compound? CHCIBRCH2CHBRCH3 a) 0 b) 1 c) 2 d) 3 4. Which of the following compounds will not show optical activity? a) CH2CICHBRCI b) CH;CH(OH)CH3 c) CH;CH2CHĆICH3 d) CH2(OH)CH(NH2)COOH 2. How many chiral carbon atoms are in the following compound? 5. Three of the following projection formulas are the same compound. The other is the enantiomer. Which is the enantiomer? CH2(OH)CH(OH)CH(OH)CH(OH)CH2OH CH,OH c=0 a) 1 b) 2 c) 3 d) 4 ОН Н H-C=0 a) НО -H 3. The maximum number of ČHHOH stereoisomers theoretically possible for the compound below is: b) H-C =0 -CH2OH CH2(OH)CH(OH)CH(OH)CH(OH)CHO c) CH2OH a) 8 b) 6 c) 16 d) 4 H. - OH d) H-C=0
1b. Draw ALL isomers (including all stereisomers) of trichlorocyclopentane. Indicate which ones are chiral.
2) What is the difference between stereoisomers and enantiomers?
4. Draw the R.R configuration of the following chiral molecule (use the skeleton provided and put groups were they need to go). CHÍCH CH(OH)CH(NH,CH