The following chemical reaction is used to synthesize a flavouring agent that has an aroma similar to bananas. H₂SO4(aq) CH3COOH(1) + CH₂(CH₂)₂OH(1) I || Identify the type of reaction that is represented by this synthesis. Select one: hydrogenation esterification addition substitution elimination Identify the functional group and the IUPAC name for each of the three compounds in the reaction below: H₂SO4(aq) I Compound Functional Group II CH₂COOH(1) + CH₂(CH₂)₂OH(1) 1 || III CH3COO(CH₂)₂CH₂(1) + H₂O(1) III IV ( O IUPAC Name CH3COO(CH₂)3CH₂(1) + H₂O(1) III IV 4

Draw a structural formula for the alkene you would use to prepare the alcohol shown by hydroboration/oxidation.

Write the systematic (IUPAC) name for each of the following organic molecules: structure CH.CH₂ name CH₂-C-C-CH CH₂OH OH CH-C-CH CH П П CH3 CHS ☐ CH3-CH-CH-CH-CH-CH-OH

Use the Text Submission box to answer the following question. What are the major organic products are formed when the following compounds react with methylmagnesium bromide (CH3MgBr), followed by the addition of dilute acid? propanal 2-pentanone

Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: о CH2-0-C-(CH2)7-CH=CH-CH2-CH=CH-(CH2)4-CH3 CH о O-C-(CH2)7-CH=CH-CH2-CH=CH-CH2-CH=CH-CH2-CH3 CH2-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource.

Name the alcohol that is formed when the following alkene undergoes hydration by water in the presence of a small amount of sulfuric acid:

Can you draw the bond-line structure for the following formula please 1. ester with a carbonyl group (C=O) and an oxygen in the alkoxy group (R-O). 2. aldehyde with a carbonyl group (C=O) at the end of the carbon chain.

HW 4 #22

Draw a structural formula for the alkene you would use to prepare the alcohol shown by hydroboration/oxidation. CH3 CH3CCH,CH,CH,OH CH3