Answer Q23, 22, 21 What is the pti of 01 mol dm 'sulphuricCH,COOH > CH,CH,011 > CH,COCH, can beaccounted for principally by20acid(A)2.0 (B) 01 (C) 10(A)(B)(C)(D)15A decrease in van-der Waal's forces(D) 0.7Strong covalent bondsDipole-dipole interactionsA decrease in hydrogen bondingGiven the following ionic radii innanometers (nm): Cl-0.180: Br-0 195, 1-0.215:Ag'=0.065; Na'-0.102. Which pair of ions willform an ionic compound with the highest covalentLiquid water "molecules ionisesfollows H,0(a) Hag) + OHag)expression for ionic product of water isas21The(A)kw(B)kw = [H ][OH ]%3D(C)kw = [H,0][OH|character?(D)kw = [H*][OH |(A)(C)Ag' and CI (B)Ag' and IWhich is the most polar molecule of theNa" and CIThe conjugate acid of ethylamine from theequation:CH,CH,NH, + HClan) CH,CH,NI + C(D) Na' and Br2216following:CH.Br(A)(C) CH CICHICHWlhich of the followmg represent the dot- (BCH,CH,NHand cross diagram of the ilowng hydrogen (OCH,CH,NIH(B)(D)(A)CH,CH, NH,17carbonate ion, HCO;(D)CH,CH,NH CI23The titration curve ef aqueous 1HeversISaqueous ammonia is shown belowHO: C: i C:H C.HO C:18Irom the pair of liquid behs thonse the15volume uf tcul adiledpair that would likeiy forman ideal selon(A)(B)(C)(D)1920CHI6 and CHCI,CHCI and CoHi4There is only a small change in pll with theaddition of the strong acid in the zone XY becauseCiH16 and CaHisCHSCI and CH,OHRaoult's law applied to ideal solutions An(A.) XY is the buffer zone(B.) It is the titration of a strong acid and a weakideal solution would have one of the followingcharacteristics:base(C.) The indicator used is not appropriate(A).standard conditions.Mixes completely with any liquid under(D.) The end point had been attained(B)volume or heat change on mixing the componentsQuestion 24-26. Given the following diagram ofa cellComponents have similar bonds, noThe tntal vanour preceure nf the mixnraWIII De nigner than predicted by Raouit s taw(D)be lower than that predicted by Raoult's lawTotal vapour pressure of the mixture will

We know that water ionizes in an aqueous solution to give H+ and OH- Now we have to use the…

Answered: (D) Liquid water molecules tonises…

(D) Liquid water molecules tonises follows H,0(24) Ha) + OHag) expression for ionic product of water is 21 as The (A) kw = (B) kw = [H ][OH"| (C) kw = [H,0][OHI (D) kw = [H'][OH I the

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

3. Transition metals of the periodic table are known to adopt either a tetrahedral or square planar configuration when it has a coordination number of 4. Consider the inorganic complex ZrI4. a) Draw the structure, determine all symmetry elements and operations, and assign point group classification of Zr14 if it is tetrahedral, and square planar. (10 pts) b) If Zrl is tetrahedral, how many IR absorption peaks is expected given its point group classification? (2 pts) c) If Zrl4 is square planar, how many IR absorption peaks is expected given its point group (2 pts) classification? d) The IR spectrum of gaseous Zrl4 shows absorption peaks at 55 cm-1 and 245 cm-1. This data is consistent with what shape of ZrI4. (2 pts)
Please Indicate the coordination number for the iron surfur protein in the picture. A) 5 B) 6 C) 3 D) 4 E) 2
5
n which of the following compounds the magnetic moment is zero? (28Ni, 26Fe, 24Cr) A. Na3 [FeF6] B. [Cr (H2O) 6] SO4 C. K4 [Fe (CN) 6] D. [Ni (NH3) 6] Cl2
In a certain Patterson map for an orthorhombic crystal, space group P222, with coordinates of equivalent positions at x,y,z; x,y,-z, -x,-y,1/2+z, -x,y,1/2-z, there were high peaks at u,v,w of 0,0,0.74; 0.6,0,0; 0,0.36,0.25, assuming one heavy atom per asymmetric unit, find the coordinates of this heavy atom.
Identify the hybridizatlon of the Indicated atoms In the structure shown below, NO II III O 1) sp. (1) sp () sp 020 sp, (m sp (I) sp 030 sp an sp an sp றsp- 05p° (lysp'
Suh and Savizky studied the thermodynamics of human a - lactalbumin (HLA) unfolding in the absence (apo) or presence of various metal ions (Suh, J. J. and Savizky, R. M., Int. J. Biophys., 2011, 1(1), 1-6). You may assume that the protein starts out in the folded state and becomes denatured when it unfolds. According to the data below, which metal ion results in the greatest enthalpic stabilization of the folded state? AS (kJ/mol*K) 0.61 ± 0.07 0.55 ± 0.02 AH (kJ/mol) Experiment Аро-HLA MĘC1; + apo-HLA ZnCl, + apo-HLA CdCl, + apo-HLA CoCh + apo-HLA MnCl, + apo-HLA SICI, + apo-HLA CaCl + apo-HLA - apo-HLA KC1+ apo-HLA AG (KJ/mol) 184.92 ± 20.78 -5.29 ± 0.81 4.10 ± 0.17 3.62 0.13 174.05 ± 5.72 121.84 ± 6.02 0.38 ± 0.02 181.79 ± 11.56 6.06 = 0.46 0.57 ±0.04 184.69 ± 10.47 10.68 ± 0.44 0.56 ± 0.03 238.65 ± 15.22 14.10 ± 0.88 0.72 ± 0.05 15.08 ± 0.91 19.91 ± 1.33 223.41 ± 10.61 0.67 +0.03 232.16 ± 14.87 0.68 0.04 NaCl+a 162.17 ± 6.27 -4.19 + 0.18 0.54 + 0.02 154.02 ± 8.73 -3.58 ± 0.24 0.51…
chemical
Please don't provide handwritten solution ....
PHS BC1 ) PHy (g)+bLs (9) %3D Why is [PHBC13] not in tne Kc equation?
3. Transition metals of the periodic table are known to adopt either a tetrahedral or square planar configuration when it has a coordination number of 4. Consider the inorganic complex ZrI4. a) Draw the structure, determine all symmetry elements and operations, and assign point group classification of Zr14 if it is tetrahedral, and square planar. (10 pts) b) If Zrl is tetrahedral, how many IR absorption peaks is expected given its point group classification? (2 pts) c) If Zrl4 is square planar, how many IR absorption peaks is expected given its point group (2 pts) classification? d) The IR spectrum of gaseous Zrl4 shows absorption peaks at 55 cm-1 and 245 cm-1. This data is consistent with what shape of ZrI4. (2 pts)
What is the formula for ilum vaderide ImV2 ImV Im(1)V O Im2V