Considering stoichiometric ratios of the following equations: KIO3 + 5 KI 3 H2SO4 -> 3 12 + 3 K2SO 4 + 3 H2O 2 Na2S2O3 + 12 --> 2 Nal+ Na2S406 If 2 moles of KIO 3, 10 moles of KI, and 6 moles H2SO 4 reacted fully, how many moles of Na2S2O3 would be consumed?

Considering stoichiometric ratios of the following equations: KIO3 + 5 KI 3 H2SO4 -> 3 12 + 3 K2SO 4 + 3 H2O 2 Na2S2O3 + 12 --> 2 Nal+ Na2S406 If 2 moles of KIO 3, 10 moles of KI, and 6 moles H2SO 4 reacted fully, how many moles of Na2S2O3 would be consumed?

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.88E

See similar textbooks

Related questions

Q: Describe fully how you would prepare a 300 ml of a 0.250 N H2SO4 solution?

A: The steps to prepare 0.250 N 300 ml H2SO4 solution is described below-

Q: At 39.9 ◦C, a mixture of ethanol (x1 = 0.9060, p1 = 130.4 Torr) and isooctane ( p2 = 43.9 Torr)…

A: In this question, we delve into the world of solution chemistry and the application of Raoult's law…

Q: 3. How might you synthesize the following compound with the reagent provided and any simple…

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: Propose a reasonable synthesis for the molecule below. O O HO O

Q: 1) [H+], HS 2) Raney Ni SH ?

A: Given is organic reaction.In which reactant is ketone.The reagent for step 1 is ethane-1,2-dithiol…

Q: Draw a mechanism for the following reaction:

A: A chloronium intermediate is a three-membered ring with chloronium as the heteroatom having a…

Q: Draw one of the major products from this reaction. Use wedge and dash bonds to indicate relative…

A: The metal zinc (Zn) is inserted in the carbon-iodine (C-I) bond of diiodomethane (CH2I2) to form the…

Q: The isotope 239U undergoes the following series of decay processes: beta decay; alpha decay; alpha…

A: α –decay:- "Whenever the element emits an α-particle, the mass number decreases by 4 units…

Q: raw the product of the reaction shown below. Ignore inorganic byproducts. ZI ‚N. + B. H Bra of

A: This is an example of Suzuki reaction

Q: A 15% w/v (NH4)2SO4 standard is needed. How much solute would be needed to make 50 ml?

A: Percent mass by volume is defined as the mass of solute(in gram) divided by the volume of solution(…

Q: At a particular temperature, the solubility of In₂(SO₄)₃ in water is 0.0058 M. You have found Ksp to…

A: Answer:Ionic compounds that have low solubility in water are called as sparingly soluble compounds…

Q: J The following information is given for benzene at 1 atm: Th=80.10°C Tm = 5.50°C Specific heat gas…

A: Given mass of benzene liquid, m = 49.10 g The energy required in each process which will take place…

Q: ii) 1. For each of the following El-elimination reactions, draw the step-by-step mechanism (first…

A: E1 mechanism takes place through a carbocation intermediate.

Q: Which aromatic compound in figure 17 will be least reactive in an electrophyllic aromatic…

Q: Predict the product(s) for the following reaction. O ll IV HO. III none of these I OH 1. NaOCH₂CH₂…

A: Reaction of Base in organic chemistry: In organic reaction, base usually react to abstract proton…

Q: Exercise 16.11: What is the ppm and ppb of sodium if I dissolve 0.2 grams of NaCl in a 800 ml of…

A: Ppm = parts per millionPpb = parts per billionPpm = {mass of solute (g)/mass of solution(g)} ×…

Q: 6. Draw the major organic product(s) OR reagents for each of the following reactions. a. C. سمع +…

A: The first reaction is example of nucleophilic substitution reaction of primary amine.The second…

Q: The toughest part about titration is adding just enough of the titrant (NaOH, in this case). If you…

Q: An analytical chemist is titrating 99.3 mL of a 0.3300M solution of propylamine (C,H, NH₂) with a…

Q: Provide the structure of the enolate when acetophenone is treated with a strong base. مویلی می علی…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: TRANSMITTANCEI LOD D 4000 Please design a synthesis to make the following compound from ethane. 3000…

A: The question is based on the concept of organic spectroscopy. We need to analyse the spectral data…

Q: When the Cu2+ concentration is 1.28 M, the observed cell potential at 298K for an electrochemical…

Q: in a liquid-liquid extraction, why is ethyl acetate a good initial solvent to dissolve a mixture of…

A: Liquid-liquid extraction:Liquid-liquid extraction is the process in which compounds are separated…

Q: What is the predicted major product of the reaction shown? 01 Oll O III ON Br none of these 1.…

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: The structure of lactic acid is depicted below: The S-enantiomer has a specific rotation of +2.6…

A: Enantiomers are non-superimposable mirror images of each other. If one of the enantiomers has the S…

Q: Starting from an alkyl halide having six (6) or fewer C atoms, propose a synthesis of…

A: Given is organic synthesis reaction.The given compound is cyclohexanecarboxylic acid.We can prepare…

Q: 3. Types of Reactions 1. Balance the following equations and indicate the type of reaction taking…

Q: Draw the skeletal structures of all isomers of C6H12 that have the (Z)-configuration.

Q: Exercise 16.12: Starting with a stock solution of 12M HCI, describe how you would make the following…

A: We will use the dilution formula to find out how much volume we have to take from the given 12M HCl…

Q: Write the systematic name of each organic molecule: structure OH CH3-CH-CH2 - CH₂ - CH3…

A: Basic rules for IUPAC nomenclature:1) Select longest chain or block of carbon atoms as parent. 2)…

Q: Calculate the concentration of CuS in a solution in which H3O+ is held constant at (Ksp (CuS) = 8.0…

A: Given:Ksp (CuS)=8.010-37K1(H2S)=9.610-8 K2(H2S)=1.310-14For problem (a) [H3O+]= 0.10 M andfor…

Q: Which species can act as a Brønsted-Lowry base? O H₂CO3 O NH4* O HBr O NO3- CaBr2

A: A Bronsted lowry acid donates protons, while a Bronsted Lowry base accepts protons.

Q: Find the energy released (in GJ/mol) during the following fusion reaction. Masses shown are in amu.…

Q: .) A sample of nitrogen gas initially occupies a volume of 27.5 L at a temperature of 22.5 \deg C…

A: Ideal gas law is also called the general gas equation.It is the equation that represents the…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: equilibrium reaction is Sn+2(aq) + 2 Fe+3(aq) <--> Sn+4(aq) + 2 Fe+2(aq) (1)…

Q: The molar solubility of X₂Z, in pure water is (9.3x10^-5). Calculate ksp. Please report the answer…

A: The solubility reaction of X2Z is => X2Z (s) <----> 2 X+ (aq) + Z2- (aq) Assuming the…

Q: Gaseous methane (CH) will react with gaseous oxygen (0₂) to produce gaseous carbon dioxide (co₂) and…

Q: In a calorimeter, 300 mL of 0.22 mol/L of calcium chloride is mixed with 200 mL of 0.33 mol/L of…

A: Information of question

Q: E F LL O(-) O(-) -Br Br Product + Br(-)

A: An alkoxide ion (ethoxide ion is given) along with bromopropane are given as the reactants and an…

Q: Write the systematic name of each organic molecule: НО structure НО. ОН ОН ОН name Ш О 0

Q: Question 7 EDTA titration is used to determine anions that precipitate with metal ions by way of:…

A: The objective of the question is to identify the correct option.

Q: In a calorimeter, 300 mL of 0.22 mol/L of calcium chloride is mixed with 200 mL of 0.33 mol/L of…

A: Volume of calcium chloride = 300 mL=0.300 LConcentration of calcium chloride = 0.22 mol/LVolume of…

Q: Rank these acids according to their expected Lowest values. (pK₁ ) FCH₂COOH CICH,COOH F, CCOOH…

A: Acidity is defined as the ability of a molecule to release protons. If a compound easily donates…

Q: Question 21: How many different alkenes can be formed from the haloalkane in Figure 21 during a E2…

A: Alkyl halide gives an elimination reaction by reacting with a strong base. E2 reaction involves a…

Q: Is n = 3, l = 2, ml = 1, ms = 1⁄2 an acceptable set of quantum numbers for the electron in a…

A: The question is asking us to verify if the given set of quantum numbers (n = 3, l = 2, ml = 1, ms =…

Q: If 67.5 mol of an ideal gas is at 4.99 atm and 303 K, what is the volume of the gas? volume: L

A: Ideal gas equation PV = nRT where P = pressure V = volume n = no. of moles R = gas constant = 0.0821…

Q: 7. Determine the products or reagents need to complete the following reactions. (CH3),NH, HyO* ģ d.…

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: 8. The AG" for the succinate dehydrogenase reaction is +1.43 kcal/mol, but the actual AG value in…

A: Reaction quotient: It is the ratio of concentration of product to the reactant raised to the power…

Q: Determine the oxidation number of all carbon, oxygen and/or nitrogen in the following molecule (show…

A: Oxidation number is the hypothetical charge developed on an atom when it is separated from other…

Q: Using the Ky value of 1.2 x 10 calculate the concentration of Ni (aq) and Ni(NH₂ that are present al…

A: The objective of the question is to calculate the concentrations of and at equilibrium.

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Please help!!!!

Considering stoichiometric
ratios of
the following equations: KIO3 + 5 KI
+ 3 H2SO4 --> 3 12 + 3 K2SO
4 + 3 H2O 2 Na2S2O3 + 12 --> 2
Nal + Na2S406 If 2 moles of KIO
3, 10 moles of KI, and 6 moles H2SO
4 reacted fully, how many moles of
Na2S2O3 would be consumed?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Brief Description

VIEW

Step 2: Determination of moles

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 5 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the following incomplete and unbalanced equations, indicate how many moles of the second reactant would be required to react completely with 0. 145 mole of the first reactant. msp;BaCl2(aq)+H2SO4(aq) msp;AgNO3(aq)+NaCl(aq) msp;Pb(NO3)2(aq)+Na2CO3(aq) msp;C3H8(g)+O2(g)
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
4-103 Caffeine, a central nervous system stimulant, has the molecular formula C8H10N402. (a) How many moles of caffeine are present in 6.19 1025 molecules of caffeine? (b) Imagine you dissolve caffeine in water to a volume of 100.0 mL, which is known to have a density of 1.23 g/mL. How many molecules of caffeine are present in this volume? (c) How many nitrogen atoms are present in 3.5 mg of caffeine? (d) Complete the skeletal structure of caffeine, where all the bonded atoms are shown but double bonds, triple bonds, and/or lone pairs are missing. (e) Identify the various types of geometries present in each central atom of caffeine using VSEPR theory. (f) Determine the various relative bond angles associated with each central atom of caffeine using VSEPR theory (g) What is the most polar bond in caffeine? (h) Would you predict caffeine to be polar or nonpolar? (j) Consider the combustion of caffeine, which results in formation of NO2(g) as well as other expected products. Write a balanced chemical equation for this reaction. (j) The heat of combustion for caffeine is 2211 kcall/mol. How much heat will be given off if 0.81 g of caffeine is burned completely? (k) Calculate the weight of H2O(g) that can be prepared from 8.00 g of caffeine mixed with 20.3 g of oxygen gas.
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
For this reaction, 2 NH3 + CO2 --> H2NCONH2 + H2O what mass of H2O can be produced from 0.341 moles of NH3?
S + 6 HNO3 --> H₂SO4 + 6 NO2 + 2 H₂O In the above equation how many moles of H₂SO4 can be made when 46 moles of HNO3 are consumed?
The fizz produced when an Alka-Seltzer tablet is dissolvedin water is due to the reaction between sodium bicarbonate1NaHCO32 and citric acid 1H3C6H5O72:3 NaHCO31aq2 + H3C6H5O71aq2¡3 CO21g2 + 3H2O1l2 + Na3C6H5O71aq2 In a certain experiment 1.00 g of sodium bicarbonate and1.00 g of citric acid are allowed to react. (a) Which is the limitingreactant? (b) How many grams of carbon dioxide form?(c) How many grams of the excess reactant remain after thelimiting reactant is completely consumed?
2KCI + 30, 2. 2KCIO, How many molss of oxygen are produced by the decomposition ot st moles of potassiuum chlorate? 3. Zn + 2HCI
Two reaction of interest are as followS: Cl + C,H →C,H,CI + HCI Cl, + C,H→C,HCI, When the reaction is finished, the quantity of each specie is listed below Cl : 160 moles C,H; : 400 moles C,H;Cl : 10 moles C,H;Cl, : 40 moles HCl: 10 moles (a) How many moles of Cl, are there in the feed? (b) How many moles of C,H, are there in the feed? (c) Which one is the limiting reactant? (d) Which one is the excess reactant? (e) What is the %conversion of C,H.? ( What is the selectivity of C. H-Cl relative to C,H,Cl,?
15. A 94.6 grams of silver 126.4 of in the cess? - 230Lused) %3D7.79excess Al requi unbalanced equation: AgNO:(aq) + KBr(aq)→ AgBr(s) + KNO:(aq) a. Which reactant is limiting? Which reactant is in excess? b. What is the theoretical amount of AgBr(s) produced given the limiting reactant. If a student reported 15.5grams of the AgBr(s) being produced, what is the percent yield? c.