Calculate the standard reaction potential and use the half-reaction method to determine the moles of electrons per reaction.  3Cl2(aq)  + 2Cr3+(aq) + 7H2O(l) --> 6Cl-(aq) + Cr2O72-(aq) + 14H+(aq)

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.

Calculate the equilibrium constant at 25 C for the reaction 2 Ag+(aq) + Hg() 2 Ag(s) + Hg2+(aq)

Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.

An electrode is prepared from liquid mercury in contact with a saturated solution of mercury(I) chloride, Hg2Cl, containing 1.00 M Cl . The cell potential of the voltaic cell constructed by connecting this electrode as the cathode to the standard hydrogen half-cell as the anode is 0.268 V. What is the solubility product of mercury(I) chloride?

Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)

An electrode is prepared by dipping a silver strip into a solution saturated with silver thiocyanate, AgSCN, and containing 0.10 M SCN . The cell potential of the voltaic cell constructed by connecting this electrode as the cathode to the standard hydrogen half-cell as the anode is 0.45 V. What is the solubility product of silver thiocyanate?

A 1.0-L sample of 1.0 M HCl solution has a 10.0 A current applied for 45 minutes. What is the pH of the solution after the electricity has been turned off?

An electrochemical cell is made by placing a zinc electrode in 1.00 L of 0.200 M ZnSO4 solution and a copper electrode in 1.00 L of 0.0100 M CuCl2 solution. a What is the initial voltage of this cell when it is properly constructed? b Calculate the final concentration of Cu2+ in this cell if it is allowed to produce an average current of 1.0 amp for 225 s.