(b) Consider the reaction: FeO3 + 3 Zn → 3 ZnO + 2 Fe (i) Calculate the percentage yield of 11g of Fe from a theoretical yield of 19g. Answer: % (ii) Calculate the maximum possible yield of Fe from a reaction using 903g of Zn. Answer: (iii) Calculate the percentage yield if 120g of Fe was made from the conditions in (ii) Answer: (iv) Calculate the percentage yield if 59.2g of Fe was made from 288.5g of Zn Answer:

(b) Consider the reaction: FeO3 + 3 Zn → 3 ZnO + 2 Fe (i) Calculate the percentage yield of 11g of Fe from a theoretical yield of 19g. Answer: % (ii) Calculate the maximum possible yield of Fe from a reaction using 903g of Zn. Answer: (iii) Calculate the percentage yield if 120g of Fe was made from the conditions in (ii) Answer: (iv) Calculate the percentage yield if 59.2g of Fe was made from 288.5g of Zn Answer:

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section11.4: Percent Yield

Problem 29PP

See similar textbooks

Similar questions

When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
When white phosphorus burns in air, it produces phosphorus(V) oxide. P4(s)+5O2(g)P4O10(s);H=3010kJ What is H for the following equation? P4O10(s)P4(s)+5O2(g)
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?