Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and lique water (H₂O). What is the theoretical yield of sodium chloride formed from the reaction of 31.7 g of hydrochloric acid and 29.6 g of sodium hydroxide? Be sure your answer has the correct number of significant digits in it. g

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and lique water (H₂O). What is the theoretical yield of sodium chloride formed from the reaction of 31.7 g of hydrochloric acid and 29.6 g of sodium hydroxide? Be sure your answer has the correct number of significant digits in it. g

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
Carbon dioxide from the atmosphere weathers, or dissolves, limestone (CaCO3) by the reaction CaCO3(s)+CO2(g)+H2O(l)Ca2(aq)+2HCO3(aq) Obtain H for this reaction. See Table 6.2 for the data.
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
You have seven closed containers, each with equal masses of chlorine gas (Cl2) . You add 10.0 g of sodium to the first sample, 20.0 g of sodium to the second sample, and so on (adding 70.0 g of sodium to the seventh sample). Sodium and chlorine react to form sodium chloride according to the equation 2Na(s)+Cl22NaCl(s) After each reaction is complete, you collect and measure the amount of sodium chloride formed. A graph of your results is shown below. Answer the following questions: a. Explain the shape of the graph. b. Calculate the mass of NaCl formed when 20.0 g of sodium is used. c. Calculate the mass of Cl2 in each container. d. Calculate the mass of NaCl formed when 50.0 g of sodium is used. e. Identify the leftover reactant, and determine its mass for parts b and d above.
list at least three quantities that must be conserved in chemical reactions.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
3.75 The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A atoms are shown in blue and B atoms in white). The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reac- tion has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.