Al3+(aq) +3e = Al(s) -1.67V Fe2+(aq) + 2e = Fe(s) -0.44V Calculate the cell voltage for the cell below Al(s) | A³ (0.18M) || Fe2+ (0.85M) | Fe(s) Insert your response as a numerical value to 2 decimal places. Include a sign. Do NOT include a space between the sign and the value. DO NOT include units. e.g. -0.21

Al3+(aq) +3e = Al(s) -1.67V Fe2+(aq) + 2e = Fe(s) -0.44V Calculate the cell voltage for the cell below Al(s) | A³ (0.18M) || Fe2+ (0.85M) | Fe(s) Insert your response as a numerical value to 2 decimal places. Include a sign. Do NOT include a space between the sign and the value. DO NOT include units. e.g. -0.21

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.61QE: Calculate the potential for each of the voltaic cells in Exercise 18.43 when the concentrations of...

See similar textbooks

Similar questions

Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.
Consider a cell in which the reaction is 2Ag(s)+Cu2+(aq)2Ag+(aq)+Cu(s) (a) Calculate E° for this cell. (b) Chloride ions are added to the Ag|Ag+ half-cell to precipitate AgCl. The measured voltage is +0.060 V. Taking [Cu2+]=1.0M, calculate [Ag+]. (c) Taking [Cl-] in (b) to be 0.10 M, calculate Kspof AgCl.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.