According to Avogadro's law, how will the number of molecules in 2 liters of hydrogen gas compare with the number of molecules in 2 liters of oxygen gas at the same temperature and pressure? Answer in a complete sentence. H Normal = C BIUS 2 Tx ||| |||

Plot the data given in Table 5.3 for oxygen at 0C to obtain an accurate molar mass for O2. To do this, calculate a value of the molar mass at each of the given pressures from the ideal gas law (we will call this the apparent molar mass at this pressure). On a graph show the apparent molar mass versus the pressure and extrapolate to find the molar mass at zero pressure. Because the ideal gas law is most accurate at low pressures, this extrapolation will give an accurate value for the molar mass. What is the accurate molar mass?

5-107 If 60.0 g of NH3 occupies 35.1 L under a pressure of 77.2 in. Hg, what is the temperature of the gas, in °C?

Silane, SiH4, is the silicon analogue of methane, CH4. It is prepared industrially according to the following equations: Si(s)+3HC1(g)HSiCl3(l)+H2(g)4HSiCl3(l)SiH4(g)+3SiCl4(l) a. If 156 mL HSiCl3 (d = 1.34 g/mL) is isolated when 15.0 L HC1 at 10.0 atm and 35C is used, what is the percent yield of HSiCl3? b. When 156 mL HSiCl3 is heated, what volume of SiH4 at 10.0 atm and 35C will be obtained if the percent yield of the reaction is 93.1%?

perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.

Which of the following statements is(are) true? a. If the number of moles of a gas is doubled, the volume will double, assuming the pressure and temperature of the gas remain constant. b. If the temperature of a gas increases from 25C to 50C, the volume of the gas would double, assuming that the pressure and the number of moles of gas remain constant. c. The device that measures atmospheric pressure is called a barometer. d. If the volume of a gas decreases by one half, then the pressure would double, assuming that the number of moles and the temperature of the gas remain constant.

As 1 g of (lie radioactive element radium decays over 1 year. k produces 1.161018 alpha particles (helium nuclei). Each alpha particle becomes an atom of helium gas. What is the pressure ¡n pascal of the helium gas produced if it occupies a volume of 125 mL at a temperature of 25 C?

Many nitrate salts can be decomposed by heating. For example, blue, anhydrous copper(II) nitrate produces the gases nitrogen dioxide and oxygen when heated. In the laboratory, you find that a sample of this salt produced a 0.195-g mixture of gaseous NO2 and O2 with a total pressure of 725 mm Hg at 35 C in a 125-mL flask (and black, solid CuO was left as a residue). What is the average molar mass of the gas mixture? What are the mole fractions of NO2 and O2 in the mixture? What amount of each gas b in the mixture? Do these amounts reflect the relative amounts of NO2 and O2 expected based on the balanced equation? Is it possible that the fact that some NO2 molecules combine to give N2O4 plays a role? Heating copper(II) nitrate produces nitrogen dioxide and oxygen gas and leaves a residue of copper(ll) oxide.

109 An ore sample with a mass of 670 kg contains 27.7% magnesium carbonate, MgCO3. If all of the magnesium carbonate in this ore sample is decomposed to form carbon dioxide, describe how to determine what volume of CO2 is evolved during the process. What would have to be measured to predict the needed volume in advance?