A chemist fills a reaction vessel with 8.79 atm methane (CH4) gas, 1.16 atm oxygen (O2) gas, 0.995 atm carbon dioxide (CO2) gas, and 1.22 atm hydrogen (H2) gas at a temperature of 25.0°C. Under these conditions, calculate the reaction free energy AG for the following chemical reaction: CH()+0,(g) CO,(g)+2H₂(g) Use the thermodynamic information in the ALEKS Data tab. Round your answer to the nearest kilojoule.. 1kJ х G

Adenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?

Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.

a Calculate K1, at 25C for sulfurous acid: H2SO3(aq)H+(aq)+HSO3(aq) b Which thermodynamic factor is the most significant in accounting for the fact that sulfurous acid is a weak acid? Why?