Answered: 69. A 0.185 M solution of a weak acid…

Science

Chemistry

69. A 0.185 M solution of a weak acid (HA) has a pH of 2.95. Calculate the acid ionization constant (K,) for the acid.

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter18: Acids And Bases

Section: Chapter Questions

Problem 66A: Explain why equilibrium arrows are used in the ionization equations for some acids.

See similar textbooks

Related questions

Q: A 0.040 M solution of a monoprotic acid is 14 percent ionized. Calculate the ionization of the acid.

Q: The K, of yittrium hydroxide, Y(OH),(s), is 1 x 10 22 at 298 K. The pH of this solution to one…

A: The product of equilibrium concentrations of the constituent ions raised to the power equal to their…

Q: A solution is prepared that is initially 0.092 M in methylamine (CH,NH,), a weak base, and 0.10 M in…

A: Given data: A solution is prepared that initially contain 0.092 M in methylamine (CH3NH2 ),a weak…

Q: A chemist makes four successive 1:10 dilutions of 1.0X10⁻⁵ M HCl. Calculate the pH of the original…

A: The pH of a solution is the negative of logarithm of the concentration of hydrogen ions in the…

Q: Compare the concentrations of H* and OH" for solutions that are acidic, basic, and neutral. CO

A: Acidic solutions are the ones which have the ability to donate proton in the solution and basic…

Q: A 0.05 molar acidic solution has an ionization constant of 2.50, what is the concentration of…

A: Given data: The molar concentration of acid c = 0.05 M. The ionization constant Ka = 2.50. To find:…

Q: Calculate the pH of a 0.877 M solution of NaF. The K, for the weak acid HF is 6.8 x 10*. pH =

Q: A 0.085 M solution of a monoprotic acid has a percent ionization of 0.59%. Determine the acid…

A: Let the monoprotic acid be HA. HA dissociates as: Where c is the concentration of the acid, HA…

Q: A chemist dissolves 641. mg of pure nitric acid in enough water to make up 60. mL of solution.…

A: Molecular mass of nitric acid = 63 gm / mol => moles of nitric acid = mass in gm / molecular mass…

Q: 80.0 mL of 0.30 M NaOH and 80.0 mL of 0.30 M HCl are mixed together. What is the approximate pH of…

A: Acid and base react with each other and form salt and water it is a neutralization reaction In this…

Q: If the K, of a weak base is 7.2 × 10-6, what is the pH of a 0.33 M solution of this base? pH =

A: in this question given data is α=KaC ka×kb=10-14C=0.33MPH=-logH+ Apply the value given formula,…

Q: The pH of an acid solution is 6.20. Calculate the K, for the acid. The initial acid concentration is…

A: Assuming the acid to be monoprotic weak acid, ionization equilibrium can be written as: HA(aq) +…

Q: A solution is prepared by adding NaOH to pure water until a pH = 9.34 is obtained. Calculate the pH…

Q: Enter your answer in the provided box. The K, for benzoic acid is 6.5 x 10. Calculate the pH of a…

A: Given that : Ka for benzoic acid = 6.5 x 10-5 Concentration of benzoic acid = 0.13 M We have to…

Q: A solution is prepared that is initially 0.24M in ammonia (NH,), a weak base, and 0.28M in ammonium…

A: Weak electrolytes are those which do not dissociate completely rather there occurs equilibrium…

Q: Is it possible that a weak acid solution and strong acid solution have the same pH? Explain.

A: Weak acid- Acids which do not dissociate completely in aqueous solution. Example - HCl Strong…

Q: The compound methylamine, CH,NH,, is a weak base when dissolved in water. Write the K, expression…

Q: Sodium hypochlorite (NaOCI) is the active ingredient in laundry bleach. Typically, bleach contains…

A: NaOCl is a salt of weak acid HOCl and strong base NaOH. The equilibrium reaction will be:…

Q: The K, for benzoic acid is 6.5 x 10. Calculate the pH of a 0.13 M benzoic acid solution.

A: Benzoic acid i.e HC7H5O2 is a weak monoprotic acid. Hence it can be presented as HA. Hence the…

Q: The pH for 0.185 M solution of an unknown weak base, B, is 12.95. Determine the value of Kb for the…

A: pH = 12.95 pH = 12.95pOH = 14-pH=14-12.95=1.05 OH-=10-pOH=10-1.05=0.089 M

Q: Do basic solutions also have H+ ions? If yes, then why are these basic?

A: Basic solutions:

Q: How many moles of nitric acid do you have in a 0.650 L solution of 0.035 M nitric acid? What is the…

A: a) Calculate the moles of nitric acid in a 0.650 L of 0.035 M nitric acid. Given: Volume of nitric…

Q: Enter your answer in the provided box. The K, for benzoic acid is 6.5 X 10. Calculate the pH of a…

A: Given- Ka for benzoic acid =6.5×105 Concentration of benzoi acid= 0.13M

Q: A 0.148 M solution of a monoprotic acid has a percent ionization of 1.55%. Determine the acid…

Q: In the laboratory, a general chemistry student measured the pH of a 0.591 M aqueous solution of…

A: Dear student I have given answer to your question in the image format.

Q: What is the percent ionization of an acid? Explain what happens to the percent ionization of a weak…

A: The percent ionization is the comparative ratio of the ionized acid’s concentration to the initial…

Q: Hydrofluric acid is considered a weak acid in (aq) solution; Ka is equal to 6.7x10^(4-). Calculate…

A: We have to calculate the Kb for F-

Q: The pOH of an aqueous solution at 25°C was found to be 7.30. The pH of this solution is The…

A: Given : pOH = 7.30

Q: When answering this problem, report the answer with the appropriate number of significant figures.…

Q: A solution of methylamine (CH, NH,), a weak base, has an initial concentration of 0.358 M.…

Q: Calculate the pH of a formic acid solution that contains 1.35% formic acid by mass. (Assume a…

Q: If the K, of a weak base is 1.7 × 10-6, what is the pH of a 0.18 M solution of this base? pH =

A: pH of a substance represents the strength of an acid or base. If the pH is small, it is a strong…

Q: What is the concentration of hydroxide ion in a 0.160 M aqueous solution of hydroxylamine, ? What…

A: Given: The concentration of the aqueous solution of hydroxylamine (NH2OH) is 0.160 M The Kb value is…

Q: When 90 mL of water is added to 10 mL of 0.1 M sodium hydroxide, NAOH, the pH.. .... O changes to 3.…

A: The pH of solution will before adding water : If [NaOH] = 0.1 M [OH-] = 0.1 M [H+][OH-] = 10-14 [H+]…

Q: A 0.1130 M solution of a base is 4.9% ionized. Calculate the base ionization constant Kb.

Q: In the laboratory, a general chemistry student measured the pH of a 0.386 M aqueous solution of…

A: Note: As per our guidelines we are suppose to do only first question. To get the solution of other…

Q: Identify the chemical reaction occuring? Identify the acid and the base According the particle…

A: In this question, we have to find out the correct answer of given problem by the help of…

Q: The pH value of a substance is defined by pH =-log[H* ]where[H* ] denotes the concentration of…

A: pH is a scale to measure the concentration of hydrogen ions. The negative logarithm of hydrogen ion…

Q: A 1.57 M solution of a weak acid HA is found to have a pH of 2.05. Determine the pH of a 2.00 M…

A: The concentration of hydrogen ions can be calculated as follows-

Q: Enough of a monoprotic weak acid is dissolved in water to produce a 0.0120 M solution. The pH of the…

Q: For each of the following solutions, calculate the initial pH and the final pH after adding 0.0100…

A: a) For pure water, [H+]=[OH-]=10-7pH=-log[H+]pH=-log(10-7)pH=7

Q: In the laboratory a student measures the percent ionization of a 0.558 M solution of formic acid ,…

A: The dissociation of formic acid: Concentration of formic acid =0.558M. Percentage ionization of…

Q: A chemist dissolves 505. mg of pure hydrobromic acid in enough water to make up 150. mL of solution.…

A: The molar mass of the compound HBr is 80.9 g/mol. The number of moles of the compound is calculated…

Q: a 0.0800 M solution of a base, B, is 23.0% ionized. Calculate the value of the base ionization…

A: Given, The molarity of a base B = 0.0800 M. Percent of ionization = 23.0 % The ionization constant…

Q: A 0.2690 M solution of a base is 2.8% ionized. Calculate the base ionization constant Kh.

A: Base ionization constant Kb is a measure of the strength of the base.

Q: Please explain the effect of strong acid and base on the pH of the solutions.

A: pH of solution is defined as negative logarithm of hydrogen ions.

Q: a 0.100 M solution of an acid is 6% ionized calculate the acid ionization constant for this acid

A: The ionization of the acid can be represented as follows,

Question

100%

solution.)
69. A 0.185 M solution of a weak acid (HA) has a pH of 2.95.
Calculate the acid ionization constant (K,) for the acid.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

What is a salt? List some anions that behave as weak bases in water. List some anions that have no basic properties in water. List some cations that behave as weak acids in water. List some cations that have no acidic properties in water. Using these lists, give some formulas for salts that have only weak base properties in water. What strategy would you use to solve for the pH of these basic salt solutions? Identify some salts that have only weak acid properties in water. What strategy would you use to solve for the pH of these acidic salt solutions? Identify some salts that have no acidic or basic properties in water (produce neutral solutions). When a salt contains both a weak acid ion and a weak base ion, how do you predict whether the solution pH is acidic, basic, or neutral?
Explain why equilibrium arrows are used in the ionization equations for some acids.
What term is used to describe the formation of ions, in aqueous solution, from a. a molecular compound b. an ionic compound
When perchloric acid ionizes, it makes the perchlorate ion, ClO4. Draw the Lewis electron dot symbol for the perchlorate ion.
In Arrhenius acidbase theory, what ion is responsible for the properties of a. acidic solutions b. basic solutions
Why have chemists not tabulated the fraction ionized for different acids? Such a table would make problems such as calculating the pH of an acid solution quite simple.
Acids You make a solution by dissolving 0.0010 mol of HCl in enough water to make 1.0 L of solution. a Write the chemical equation for the reaction of HCl(aq) and water. b Without performing calculations, give a rough estimate of the pH of the HCl solution. Justify your answer. c Calculate the H3O+ concentration and the pH of the solution. d Is there any concentration of the base OH present in this solution of HCl(aq)? If so, where did it come from? e If you increase the OH concentration of the solution by adding NaOH, does the H3O+ concentration change? If you think it does, explain why this change occurs and whether the H3O+ concentration increases or decreases. f If you were to measure the pH of 10 drops of the original HCl solution, would you expect it to be different from the pH of the entire sample? Explain. g Explain how two different volumes of your original HCl solution can have the same pH yet contain different moles of H3O+. h If 1.0 L of pure water were added to the HCl solution, would this have any impact on the pH? Explain.
A student prepares 455 mL of a KOH solution, but neglects to write down the mass of KOH added. His TA suggests that he take the pH of the solution. The pH is 13.33. How many grams of KOH were added?
The weak base, CIO (hypochlorite ion), is used in the form of NaCIO as a disinfectant in swimming pools and water treatment plants. What are the concentrations of HCIO and OH and the pH of a 0.015 M solution of NaCIO?