Answered: 6. What is needed in significant…

Science

Chemistry

6. What is needed in significant amounts to convert ammonia to nitrate? 1. Oxygen 2. Helium 3. Carbon 4. Hydrogen

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter9: Chemical Reactions

Section: Chapter Questions

Problem 111A: Complete the missing information in the following skeletion equation and balance the chemical...

See similar textbooks

Related questions

Q: Problem 10-3 For each molecular formula, draw all the possible constitutional isomers of alcohols…

A: All possible constitutional isomers of alcohol are attach with image ( I draw in chemdraw but here…

Q: None

A: Markovnikovs's rule: The negative part of the reagent is added to the double bonded carbon atom…

Q: Find the pH of the equivalence point and the volume (mL) of 0.0370 M NaOH needed to reach the…

A: At the equivalence point in a titration, the amount of titrant (in this case, NaOH) added is exactly…

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: 3(a) Difference between Enantiomers and DiastereomersEnantiomers:Enantiomers are stereoisomers that…

Q: Mechanism Explorer: Sketch and Submission (Intermediate) Reactant OH :ÖH Tip: Add curved arrows in…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: The linear regression equation for the data is given as,y=11.336x+0.0147 ......equation(1) From the…

Q: 2 (a). Device a synthesis of each of the following compounds from benzene. (i) OH Br (ii)

A: Step 1: The synthesis of the given compound from benzene by using reagents is as follow: Some…

Q: What is the name of this structure ° с

A: Approach to solving the question: point to point lines in grid pattern Detailed explanation:…

Q: A 2% solution is diluted 1/10 what is the final concentration? Is it 0.2?

Q: a. Given the following standard cell notation, draw and label the electrochemical cell. Be sure to…

Q: How many moles of CO would be needed to reduce 14.5 grams of iron(III) oxide if the equation for the…

A: The molar mass of a compound is calculated by adding up the molar masses of each of the elements in…

Q: How many grams of Na3PO4 are needed to react with 2.535 moles of Ba(NO3)2 in the reaction2 Na3PO4…

A: The balanced chemical equation for the reaction is:2 Na3PO4 + 3 Ba(NO3)2 ———> Ba3(PO4)2 + 6…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1: 2ICl + H2 ----> I2 + 2HCl General rate equation for the above reaction is, Rate = k [ICl…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: First of all, the following center is not chiral as contains two O-CH3 groupsSecondly: The marked…

Q: given full mechanism with explanation...

Q: ONLY ANSWER NUMBER 5 the other questions are there in case you need information from them and the…

A: First, we need to identify the accepted specific heat value for the metal used in the experiment.…

Q: Question 5 (1 point) Equimolar quantities of potassium fluoride and hydrofluoric acid are placed…

A: The addition of acetic acid results in an increased concentration of H3O+ ions, causing the…

Q: How many chiral carbons are in the following molecule? 2 4 5 3 1 OH

A: Menthol is an organic compound with the chemical formula C10H20O and a structure based on a…

Q: None

A: For the given reaction, we need to determine the sign of ΔS_sys (change in entropy of the system).…

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: We need to consider the procedure and possible reaction in the presence of H2SO4 The reaction…

Q: help please answer in text form with proper workings and explanation for each and every part and…

Q: Part A MISSED THIS? Read Section 8.4 (Page). An electron traveling at 3.6×105 m/s has an uncertainty…

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: We should know about normality before solving this question.Normality is the number of gram…

Q: Please correct answer and don't use hend raiting

A: thank you

Q: None

A: Explanation:Step 1: Identify the relevant pKa value for the aspartic acid R-group carboxylic…

Q: How many lone pairs are there on the underlined atom in the molecules and ions below? System SF2…

Q: (a) You are about to prepare exactly 0.1 mol dm-3 solution of KCI by weighing out the exact amount…

Q: Determine the molecular geometry from Lewis structure H₂C H&C. H CH CH 6 CH2 CH CH C5-C6-C7 ✓…

A: Please note that single bond have one Sigma bond Double bond have one Sigma bond and one pi bond…

Q: a sars cov 2 virion has a mass of approximately 1.0 nanograms. aerosolized droplets froma. sneeze or…

A: Given:m = 1.0 nanograms = 1 x 10-12 kgv = 15.0 m/s Calculating wavelength:We know that the de…

Q: 3. Draw Newman projection for the highest and lowest energy conformers of your assigned molecule.…

A: The molecule (2R,3S)-2-Bromo-3-Floro butane is a four-carbon chain with a bromine atom attached to…

Q: 2. 3. What is meant by the phrase, "the energy of an electron in a given orbital is quantized"? How…

A: The phrase 'the energy of an electron in a given orbital is quantized' refers to the concept that…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1:To determine the correct IUPAC name for the given structure, let's analyze the structure and…

Q: On determining temperature and COz concentration that occurred thousands of years ago: (12 pts)…

A: Q. 2If isotopes were obtained from ocean sediments instead of polar ice cores, the plot associating…

Q: None

A: Step 1: To solve these problems using Hess's law, we need to manipulate the given reaction and use…

Q: In a sample of CaCl2 • 2H2O(s), the mass of water is ___ the mass of calcium. Question 5…

A: Step 1:To determine whether the mass of water in a sample of calcium chloride dihydrate…

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: Molecular equation: The given chemical equation is: Mg(OH)2(s) + HClO3(aq) -----> Mg(ClO3)2(aq) +…

Q: Please help me with drawn mechanisms to show how the products in the following are formed.…

A: The possible pericyclic stages that convert linear polyene E.4 to tetracyclic natural product E.5 at…

Q: Check the box under each structure in the table that is an enantiomer of the molecule shown below.…

A: Enantiomers are pairs of molecules that are mirror images of each other, just like left and right…

Q: Classify each chemical compound listed in the table below. base type of compound (check all that…

A: Thank you.

Q: Deconstruct the given Diels-Alder adduct. Draw the reactants, in any order, that would be needed to…

A: Step 1: Introduction:The Diels-Alder reaction is a powerful organic reaction that involves the…

Q: Please show a drawn mechanism, including intermediates where necessary for the reaction shown below.…

A: Step 1 Step 2 Step 3 : Step 4

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Given: Isotope118Sn115SnMass(amu)117.90114.90RelativeAbundance,%52.48.Step 1: Write the formula…

Q: None

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Answer: The %(w/w) of solution is given as 65%. It means 65 g of solute (HNO3) is present in 100g of…

Q: Draw the product of the reaction of isobutyryl chloride with cyclohexanecarboxylic acid in diethyl…

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: Assuming that Pb(OH)2 is the compound dissolving with regards to the equilibrium: Pb(OH)2 (s) ↔…

Q: None

A: To solve the given problem of converting toluene to the specified products using the available…

Q: na The 2. Consider the reaction below and complete parts (a)-(c): (Complete a to c in the next…

A: Step 1: Step 2:

Q: Give the IUPAC name for each compound. Part 1 of 3 H,CCH H С. CH3 -CH,CH,CH,CH, Part 2 of 3 Х б CCH,…

A: Part 1For the first compound, the structure can be written as: CH3CH2−CH(CH3)−CH2CH2CH2CH3…

Question

None

6. What is needed in significant amounts to convert
ammonia to nitrate?
1. Oxygen
2. Helium
3. Carbon
4. Hydrogen

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
4.20 Assuming a charcoal briquette is composed entirely of carbon, what mass of oxygen is needed to completely burn a 37.3-g briquette?
Complete and balance the equations of the following reactions, each of which could be used to remove hydrogen sulfide from natural gas: (a) Ca(OH)2(s)+H2S(g) (b) Na2CO3(aq)+H2S(g)
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
What is the mass of fish, in kilograms, that one would have to consume to obtain a fatal dose of mercury, if the fish contains 30 parts per million of mercury by weight? (Assume that all the mercury from the fish ends up as mercury (II) chloride in the body and that a fatal dose is 0.20 g of HgCl2.) How many pounds of fish is this?
A 2.5624-g sample of a pure solid alkali metal chloride is dissolved in water and treated with excess silver nitrate. The resulting precipitate, filtered and dried, weighs 3.03707 g. What was the percent by mass of chloride ion in the original compound? What is the identity of the salt?
4.22 Generally, an excess of O2 is needed for the reaction Sn+O2SnO2 . What is the minimum number of moles of oxygen required to oxidize 7.3 moles of tin?
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Complete the missing information in the following skeletion equation and balance the chemical equation: NaOH(aq)+3NaCl(aq)+Al(OH)3(aq)
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)Si(s)+CO(g) b. Silicon tetrachloride is reacted with very pure magnesium, producing silicon and magnesium chloride. c. Na2SiF6(s)+Na(s)Si(s)+NaF(s)
Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?