6. Draw a molecule with each of the following characteristics: 1) a chiral carbon with (R) configuration; 2) a chiral carbon with an (S) configuration; 3) a tertiary amine; 4) a group that has torsional strain; 5) an ester

The fact that sweet-tasting carbohydrates like table sugar are also high in calories has prompted the development of sweet, low-calorie alternatives, (a) Identify the functional groups in aspartame, the artificial sweetener in Equal, (b) Label all of the sites that can hydrogen bond to the oxygen atom of water, (c) Label all of the sites that can hydrogen bond with a hydrogen atom of water.

2. Draw the following organic compounds. a) 1,1-diethylcyclobutane c) 2-hexoxynonane b) N-ethyl-3-ethylpentanamide d) 2,2-dimethylhexan-3-one

The fact that sweet-tasting carbohydrates like table sugar are also high in calories has prompted the development of sweet, low-calorie alternatives, (a) Identify the functional groups in aspartame, the articial sweetener in Equal, (b) Label all of the sites that can hydrogen bond to the oxygen atom of water, (c) Label all of the sites that can hydrogen bond with a hydrogen atom of water.

Determine (A.) functional groups presents in the molecules and (B) determine the number of chiral carbons in the molecule (Exclude alkane) (Hint: Only 5 functional groups available)

5) Draw a different constitutional isomer of heptane (C₂H₁6) that contains a quaternary (4°) carbon. Then draw at least 3 other constitutional isomers.

Determine (A.) functional groups presents in the molecules and (B) determine the number of chiral carbons in the molecule (Exclude alkane) NH2 HO (Hint: Only six functional groups available)

18. Consider the following two compounds: CH3CH2CH2CH2CH3 and (CH3)2CHCH2CH3 Which statement below is INCORRECT? A) CH3CH₂CH₂CH₂CH3 has the higher boiling point. B) Greater surface area leads to more intermolecular attraction which results in a higher boiling point. C) (CH3)2CHCH2CH3 has the higher boiling point D) As the degree of branching increases, the surface area of the molecule decreases and the potential for intermolecular attraction via London forces decreases.

To Which category does the molecule below belong? A) Protein B) alcohol C) aromatic hydrocarbons D) carbohydrate   PLEASE HELP ME UNDERSTAND PLEASE PLEASE There is an image attached!

1. How many chiral carbon atoms are in the following compound? CHCIBRCH2CHBRCH3 a) 0 b) 1 c) 2 d) 3 4. Which of the following compounds will not show optical activity? a) CH2CICHBRCI b) CH;CH(OH)CH3 c) CH;CH2CHĆICH3 d) CH2(OH)CH(NH2)COOH 2. How many chiral carbon atoms are in the following compound? 5. Three of the following projection formulas are the same compound. The other is the enantiomer. Which is the enantiomer? CH2(OH)CH(OH)CH(OH)CH(OH)CH2OH CH,OH c=0 a) 1 b) 2 c) 3 d) 4 ОН Н H-C=0 a) НО -H 3. The maximum number of ČHHOH stereoisomers theoretically possible for the compound below is: b) H-C =0 -CH2OH CH2(OH)CH(OH)CH(OH)CH(OH)CHO c) CH2OH a) 8 b) 6 c) 16 d) 4 H. - OH d) H-C=0