4. dibromotetracarbonyliron(I): 5. pentaamminechlorocobalt(III) chloride: 6. triaquabromochloroiodochromium(0): 7. trisoxalatocobaltate(3-): 8. pentaammineazidecobalt(2+) sulfate: 9. potassium pentachloronitridoosmate(VI):

Q: Which complex compound is used in chemotherapy? Write its formula also.

A: Solution- complex compound is used in chemotherapy Cisplatin and oxaliplatin.

Q: Explain the formation of complexes/coordination compounds

A:

Q: Define coordination compounds?

A: The compounds which contain the coordinate bond are known as coordination compounds. The coordinate…

Q: Two Fe (II) complexes are both low spin but have different ligands. A solution of the other is red.…

A: The stronger the field, the greater the separation (in energy) between the split levels.  Electrons…

Q: The compound formula is [Al(OH)&]Clh 1. Indicate central ion and its oxidation number. 2. Write down…

A: Coordination compounds: The compounds having coordination covalent bonds which form when metal ions…

Q: A given ligand is tetradentate. How many ligand donor atoms does it have? Enter your answer as a…

A: The objective of the question is to identify-The ligand donor atoms does tetradentate have.The…

Q: The energy of the absorption band in the electronic spectrum of the  [Ti(H2O)6]3+ complex is…

A: Given that [Ti(H2O)6]3+ has more energy of absorption band than [Ti(H2O)4]3+

Q: Cr(iii), Mn(ii), Fe(ii), Fe(iii), Co(ii), Ni(ii), Cu(ii), Zn(ii),  in solution reacts with NH4Cl .…

A: Different reactions can occur when Cr(III), Mn(II), Fe(II), Fe(III), Co(II), Ni(II), Cu(II), and Zn(…

Q: 7. Glycine has the structure below. It can lose the proton from the carboxyl group and form chelate…

A: Step 1: Step 2: Step 3: Step 4:

Q: Draw the structure of a gold-PR3 complex with chloroquine as a ligand and briefly discuss the role…

A: The structure of a gold-PR3 complex with chloroquine as a ligand is as follows:

Q: What is the preparation methods of coordination compounds

A: Preparation of complex compounds

Q: NH NH, NH, Terpyridyl (terpy) Bisethylenetriamine (tris) How do you expect these molecules to…

A: Denticity refers to the number of donor groups in a single ligand that bind to a central atom in a…

Q: For the metal-ligand complexation that forms coordination compounds, ligands act as: Reducing agent…

A:

Q: Is it possible for a complex of a metal in the transition series to have six unpaired electrons?…

A: Transition metals form stable ions due to its incompletely filled d-orbitals. The d-subshell in…

Q: Write the chemical formula of the following metal complex: diamminetetrachloridoplatinum(IV). Write…

A:

Q: The energy of the absorption band in the electronic spectrum of the  [Ti(H2O)6]3+   complex is 20300…

A: Stability of a complex can be explained by CFSE i.e. crystal field stabilisation energy. For this…

Q: Draw all the isomers of an octahedral complex having four different monodentate ligands.

A: The isomers of an octahedral complex having four different monodentate ligands can be drawn as…

Q: True or False: Elements exists in various oxidation states in the second and third transition series…

A: #1: Transition elements are present in between s-block and p-block elements in the periodic table.…

Q: A given ligand is tetradentate. If a transition metal cation complexed (coordinate covalently…

A: Here we are required to find the coordination number of resulting hypothetical complex ion

Q: A tetrahedral complex is determined to be of the "weak field" type. It is determined that the metal…

A: Tetrahedral complex, there are four ligands attached to the central metal. The d orbitals also split…

Q: 4. The structure of [Cu(NH3)4]²+ is known to be square planar. Using the ligand o orbitals only,…

A: Given that  Square planer metal complex [Cu(NH3)4]2+ (ML4) Draw orbitals symmetries of the central…

Q: Answer the following question for a coordinate complex with the name…

A: Given coordinate complex is dicyanobis(ethylenediamine)cobalt(III) nitrate dihydrate. Its chemical…

Q: Write an equation for the reaction of a metal ion with a ligand in natural water (which functional…

A: EDTA is ethylenediaminetetraacetic acid is a ligand, also an indicator. It has 2 amino and 4…

Q: Give the chemical formula of the following coordination compound. Enclose complexes in square…

A: Coordination compounds are substances in which a central metal is surrounded by ligands through…

Q: Complex or Compound K₂[CoC14] Name Metal Metal d Charge electrons Molecular Geometry Obeys 18-…

A: K2[CoCl4]   Name: potassium tetrachloridocobaltate(II) Metal charge:  +2 metal d electrons: 7(seven)…

Q: A) Elaborate the different features of coordination compounds.

A: Coordination compound is the compound in which the central atom is a metal and it is surrounded by…

Q: For each of the following transition metal complex ions : see image (i) Draw the structure of the…

A: In presence of strong field ligands or metal of 5d and 6d with higher oxidation state form low spin…

Q: Provide formulas for the following Coordination Species. 7) chlorodinitrotriaminoplatinum (IV) ion…

A: [7.]  chlorodinitrotriaminoplatinum (IV) ion The formula for the following coordination species is…

Q: Werner first published his thoughts concerning the possibiolity of chiral coordination compounds in…

A: Geometrical isomer Geometrical isomer having the same molecular formula and same structure but it…

Q: With your knowledge in coordination chemistry, help these students label the solutions.

A: In contrast to non-transition metal ions, transition metal complex ions are usually colored because…

Q: Answer the following question for a coordinate complex with the name…

A: Coordination compounds are chemical compounds that consist  of an  array of anions or neutral…

Q: Fill in the blanks and make the right choice The condition for a complex to be low spin; crystal…

A: Crystal field splitting energy decides the low/high spin complexes.

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: In coordination compounds, metal shows different linkages, primary and secondary. The primary…

Q: Three solutions containing transition metal complexes have lost their labels. We know that all of…

A: Color blue occurs at a higher wavelength (lower energy) and green occurs at a lower wavelength…

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.