3. Draw a structure (your preferred type) for each of the following unsaturatedhydrocarbons.a. 2,5,6-trimethyl-3-heptyneb. p-difluorobenzene4. Draw a structure (your preferred type) for each of the following:a. m-lodobenzoic acidb. Ethyl propyl etherc. 5-ethyloctanald. 4-isopropyl-3-hexanone

Note : As per our guidelines we are supposed to answer first question .please resubmit the other…

Answered: 3. Draw a structure (your preferred…

3. Draw a structure (your preferred type) for each of the following unsaturated hydrocarbons. a. 2,5,6-trimethyl-3-heptyne b. p-difluorobenzene

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter21: Hydrocarbons

Section: Chapter Questions

Problem 91A

See similar textbooks

Related questions

Q: Addition of HCl to an alkene forms 2-chloropropane. What is the alkene?

A: The addition of halogen molecule across the double bond of unsaturated hydrocarbons is termed as a…

Q: What is the molecular formula for a hydrocarbon with 23 carbons that is (a) completelysaturated; (b)…

Q: what does KMnO4, SOCl2, and NaBH4 to in an organic compound reaction? more specifically, to a…

Q: What are structural isomers? What is the smallest alkane that has a structural isomer? Draw…

A: Isomers are the compounds with the same molecular formula but different properties.

Q: Alkenes are unsaturated hydrocarbons because they have fewer thanthe maximum number of hydrogen…

A: Alkanes are called saturated hydrocarbons because each carbon atom has the maximum number of…

Q: What is an alkane? OA. A hydrocarbon containing carbons joined only by single bonds B. A hydrocarbon…

A: We have to tell what is an alkane. The given options are A hydrocarbon containing carbons joined…

Q: 27. Which of these is/are isomers of butane? A. propane B. propane C. 2-metylpropane D.…

A: Isomers are the molecules that have the same molecular formula but different arrangement of atoms.…

Q: Define A Disubstituted Cycloalkane ?

A: Alkane: Saturated hydrocarbons are called alkanes. The cyclic forms of alkanes are known as…

Q: Draw the constitutional isomers of pentane?

Q: What are structural isomers? How do the properties of structural isomers differ from one another?

A: Structural isomers:Isomers which have same molecular formula but different structural formula are…

Q: Draw the structures of octane and isooctane.

A: Given compounds: Octane and isooctane

Q: Define concept of saturated hydrocarbons ?

A: In organic chemistry, various compounds are studied. They have different functional groups. These…

Q: 1.Organic chemistry refer to OA. Study carbon compounds. O B. Study carbon and hydrogen compounds C.…

A: Hydrocarbon are the compound which contains hydrogen and carbon atoms.

Q: B. Draw the Structural formula for the given hydrocarbons. 1.) Decane 2.) 2- Pentene 3.) 3- Hexyne

A: Structural formula:

Q: Draw a structure for alkane. 3-ethylhexane

Q: Explain the differences between saturated and unsaturated hydrocarbons. (In few words)

Q: Draw a structure for alkane. 4,4-diethyloctane

A: Given compound name, 4,4-diethyloctane

Q: Which of the following statement is true about alkanes? a Alkanes are one of the three…

A: Ans : C. Alkanes are saturated hydrocarbons. Therefore option a is wrong. Alkanes are always linear…

Q: Brochure about Hydrocarbons and Functional Groups

A: The brochure refers to a pamphlet or a magazine or a small book which helps in explaining any…

Q: Draw the structure for 2,3-dimethylhexane

A: The structure for 2,3-dimethylhexane is to be drawn.

Q: 22. Which of these are not hydrocarbons? A. Alkynes B. Alkanes C. Alkenes D. Functionalized…

A: Chemical compounds which are totally composed of hydrogen and carbon as the chief component is known…

Q: For every one double bond in a structure of a hydrocarbon, there is one less hydrogen than found in…

A: The general formula of alkane is CnH2n + 2 while that of alkene (with 1 double bond) is CnH2n

Q: Why does Halogenation increase the reactivity of Alkanes?

A: Halogenation of an alkane generates a hydrocarbon derivative in which one or more halogen atoms are…

Q: 6. What is a hydrocarbon containing one double bond per molecule called? O alkane O alkene O…

A: Hydrocarbons :- It is an organic compound containing only carbon and hydrogen only. This can be…

Q: You are teaching a class in organic chemistry to grade 12 students. Outline the steps that they…

A: According to IUPAC nomenclature system, there are Following rules are used to name an alkane - (1)…

Q: Define Alkyne

A: To find: The definition of alkyne

Q: What kinds of reactions are common to alkanes? List an example of each.

A: Alkanes undergo different kind of reactions. The most important reactions are combustion reaction…

Q: Illustrate the Combustion of Alkanes ?

A: During combustion, alkane is heated in the presence of sufficient air or dioxygen it forms carbon…

Q: List isomers of: a) cycloalkanes; b) ethers; c) esters: d

A: As per the policy, we are allowed to answer only first three parts. to get answer of other parts,…

Q: Draw a structure for each alkan 4-ethyl-2,2-dimethylhexane

A: The hydrocarbons which contain C - C single bonds are called alkanes. Their general formula is…

Q: What kinds of reactions are common to alkenes? Give an example of each.

A: Addition Reaction: It is defined as chemical reaction in which two given molecules combines and…

Q: а. b. 2,4,4-trimethylhexane

A: The IUPAC name of the compounds has to be provided.

Q: Name all the functional groups

Q: Draw the molecular structure of ether that is an isomer of 1-propanol.

Q: Explain about sesquiterpene ? How many carbons a sesquiterpene contains ?

A: Sesquiterpenes are obtained naturally. These can be used as a media to find many disease and cure…

Q: Draw a structure for alkane. 2,3-dimethylbutane

A: Alkanes are saturated compounds which contain single bonds only. The general formula of alkanes is…

Q: In what test/s are the unsaturated hydrocarbons and benzene similar?

A: Unsaturated hydrocarbons are those hydrocarbons which have double or triple bonds between two Carbon…

Q: How many structural isomers can you draw for pentane?

Q: Which alkane would have a higher boiling point? a) ethane Ob) pentane c) heptane

A: Given, a) ethane b) pentane C) heptane The molecule which have a higher boiling point is:

Q: What is the functional group of chlorobenzene explain with reaction as a example?

A: A) functional group of chlorobenzene - Halide. For example:- In chlorobenzene halide is chloride.

Q: Do saturated and unsaturated hydrocarbons show similar observable positive results in all tests?

A: Hydrocarbons are compounds of hydrogen and carbons. These are classified into two types on the basis…

Q: 2. What is the difference between a saturated hydrocarbon and an unsaturated hydrocarbon?

A: Saturated hydrocarbon- Hydrocarbons in which carbon atoms are connected by single bonds Unsaturated…

Q: Write the structure for: a.) 2,2,4 trimethyl pentane b.) 2-methylbutane

A: a. The name of the given compound is 2,2,4 trimethyl pentane. The word pentane indicates the…

Q: Some polymers are copolymers, formed from two different alkene monomers joined together. An example…

A: Structure of saran polymer is given below.

Concept explainers

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.

Question

3. Draw a structure (your preferred type) for each of the following unsaturated
hydrocarbons.
a. 2,5,6-trimethyl-3-heptyne
b. p-difluorobenzene
4. Draw a structure (your preferred type) for each of the following:
a. m-lodobenzoic acid
b. Ethyl propyl ether
c. 5-ethyloctanal
d. 4-isopropyl-3-hexanone

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

6. Write the structure of the following compounds. a. 4 - ethyl - 2 - hexoneb. 2-ethyl - 3 – pentanoic acid
4. MAINIDEA Compare and contrast alkyl halides and aryl halides. 5. Draw structures for the following molecules. a. 2-chlorobutane c. 1,1,1-trichloroethane b. 1,3-difluorohexane d. 1-bromo-4-chlorobenzene 6. Define functional group and name the group present in each of the following structures. Name the type of organic compound each substance represents. a. CH3CH,CH2OH b. CH;CH,F c. CH;CH,NH2 7. Evaluate How would you expect the boiling points of propane and 1-chloropropane to compare? Explain your answer. d. CH3C- OH 8. Interpret Scientific Illustrations Examine the pair of substituted hydrocarbons illustrated at right, and decide whether it represents a pair of optical isomers. Explain your answer.
1. What functional group is produced when an aldehyde reacts with H2/Pt? A.secondary alcohol B. carboxylic acid C.hemiacetal D. primary alcohol E.alkane F.tertiary alcohol G. alkene 2. What reaction occurs when an aldehyde reacts with H2/Pt to form a primary alcohol? A. Hydration B. Hydration C. Dehydration D. Oxidation E. Reduction( hydrogentation) 3. What reaction occurs when an Ester react with H+/H2O to from a carboxylic acid and alcohol? A. Dehydration B. Reduction ( Hydrogenation) C.Hydrolysis D. Hydration E.oxidation
1. 1-Ethoxy-2-methylpropane A. Acid anhydride B. Acid chloride C. Ether D. None of the choices 2. C8H16 A. Alkane B. Alkene C. Cycloalkane D. Two of the choices 3. How many CH2 is present in this compound? (Please refer to the timage attached.) A. 6 B. 5 C. 4 D. 3
12. Which of the following structural formulas shows a compound that is an isomer of butane? C. e. H 110-4 H H III H - H c. alkyl halides d. amines e. ethers H н-с HIC CIC-H 'H HIC-H T 4 * ΗΗΗΗ H-C-C-C-C-O-H ΗΗΗΗ b. H-C # H- C-H H H d. H HIĊ-C= H H H 13. Which class of organic molecules can form directly from alkanes? a. alcohols b. ketones H -C-H
12. Which of the following structural formulas shows a compound that is an isomer of butane? C. e. H 110-4 H H III H - H c. alkyl halides d. amines e. ethers H н-с HIC CIC-H 'H HIC-H T 4 * ΗΗΗΗ H-C-C-C-C-O-H ΗΗΗΗ b. H-C # H- C-H H H d. H HIĊIC= H H H 13. Which class of organic molecules can form directly from alkanes? a. alcohols b. ketones H -C-H
What is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3
1. Which of the following compounds are isomers of each other? I. 3-hexene II. Cyclohexane III. 2,3-dimethyl-2-butene IV. 2-methyl-2,3-pentadiene a. I and II b. II and IV c. I, II, III d. I, II, III, IV 2. Which of the following does not contain a carbonyl group? A. CH3CH2CH2COCH2CH3 B. CH3CH2CH2COOCH3 C. CH3CH2CH2CHOHCH2CH3 D. CH3CH2CH2CONH2CH3
13. Ethylethanoate and butanoic acid can be classified as A. positional isomers B. chain isomers C. functional isomers D. stereoisomers 14. Which of the following pairs are positional isomers A. trans-1,4-dichlorocyclohexane, cis-1,3-dichlorocyclopentane B. trans 1,4-dichlorocyclohexane, cis-1,4-dichlorocyclohexane C. 2-pentanol, Cyclopentanol D. 1,2-cycohexanediol, 1,3-cycohexanediol 15. Which of the following compounds will have zero dipole moment? A. cis-1,2-dibromoethylene B. 1,1-dibromoethylene C. trans-1,2-dibromoethylene D. all of these 16. Which of the following is not aromatic: A. cyclopentadienyl cation B. cyclopentadienyl anion C. Cyclopropenyl cation D. Cycloheptatrienyl cation 17. Which of the following compounds containing lone pair has the least tendency to donate its electrons? A. the lone pair in pyridine B. the lone pair in furan C. the lone pair in pyrole D. the lone pair in thiophene
4. Which of the following has isomeric forms?a. C2H3Clb. C2H5Clc. C2HCld. C2H4Cl2 5. Which of the following hydrocarbons always gives the same product when one of its hydrogen atoms is replaced by a chlorine atom.a. Hexaneb. Hex-1-enec. Cyclohexaned. Cyclohexene
1. Identify the SYSTEMATIC name of the aliphatic hydrocarbon a. 1-pentenyicyclopentane b. 1-cyclopentylpent-2-yne c. 1-pentenecyclopent-2-yne d. 1-pentenyicyclopentane 2. Identify the SYSTEMATIC name of the aliphatic hydrocarbon a. Trans-1,2-propylcyclopropane b. Trans-1,2-diisopropylcyclopropane c. Cis-1,2-propylcyclopropane d. Cis-1,2-diisopropylcyclopropane 3. Identify the SYSTEMATIC name of the aliphatic hydrocarbon 3,10-dimethyl-2-decacen-6-yne 3,10-dimethyl-2-dodocen-6-yne 3,10-dimethyl-10-decacen-6-yne d. 3,10-dimethyl-10-dodocen-6-yne a. b. C. 4. Identify which type of isomer the following structures represent HO a. Skeletal Isomer b. E/Z isomer c. Cis/Trans isomer OH OH d. Positional isomer 5. Identify which type of isomer the following structures represent a. Skeletal Isomer Br b. E/Z isomer c Cis/Trans isomer Br d. Positional isomer
Draw structures for the following: a. 4-Isopropyl-3-ethynonane b. 4-Ethyl-2,2-dimethylhexane c. 2,4,4-Trimethylheptane d. 4-Methylheptane 4-Ethyl-3,4-dimethylhexane f. 3,3-Diethyl-2,5-dimethylnonane е.