Please help with 3a and 3b 3. A sealed vessel contains 0.25 M COC1, 0.11 M CO, and 0.11 M Cl2 at 668 K, which is anequilibrium mixture at this temperature.COCl2(g) = cO(g) + Cl2(g)a. When the temperature is increased and equilibrium is re-established, [COC22] = 0.18 M. Isthe reaction endothermic or exothermic? How do you know?b. To the equilibrium mixture at 668 K, 0.25 M CO is added. Calculate the concentration ofeach gas at equilibrium.

Answered: Image /qna-images/answer/15a5a316-96d0-4fe3-8039-4c909bf14184.jpg

Answered: 3. A sealed vessel contains 0.25 M…

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 13Q: Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this...

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Use the solubility product constant from Appendix F to determine whether a precipitate will form if 10.0 mL of 1.0 106 M iron(II) chloride is added to 20.0 mL of 3.0 104 M barium hydroxide.
The ore cinnabar (HgS) is an important source of mercury. Cinnabar is a red solid whose solubility in water is 5.5 X 10-2 mol L-1. Calculate its \p. What is its solubility' in grams per 100 g of water?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
What is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
In the gas phase, acetic acid exists as an equilibrium of monomer and dimer molecules. (The dimer consists of two molecules linked through hydrogen bonds.) The equilibrium constant, Kc, at 25 C for the monomer-dimer equilibrium 2 CH3CO2H (CH3CO2H)2 has been determined to be 3.2 104. Assume that acetic acid is present initially at a concentration of 5.4 104 mol/L at 25 C and that no dimer is present initially. (a) What percentage of the acetic acid is converted to dimer? (b) As the temperature increases, in which direction does the equilibrium shift? (Recall that hydrogen-bond formation is an exothermic process.)
In a solution with carbon tetrachloride as the solvent, the compound VCl4. undergoes dimerization: 2VCl4V2Cl8 When 6.6834 g VCl4. is dissolved in 100.0 g carbon tetrachloride, the freezing point is lowered by 5.97C. Calculate the value of the equilibrium constant for the dimerization of VCl4 at this temperature. (The density of the equilibrium mixture is 1.696 g/cm3, and Kf = 29.8C kg/mol for CCl4.)

Recommended textbooks for you

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry for Engineering Students

Chemistry

ISBN:

9781337398909

Author:

Lawrence S. Brown, Tom Holme

Publisher:

Cengage Learning

Chemistry: The Molecular Science

Chemistry

ISBN:

9781285199047

Author:

John W. Moore, Conrad L. Stanitski

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS