3. A 0.0560 g quantity of acetic acid is dissolved in enough water to make 50.0 mL of solution. Calculate the concentrations of H;0*, CH;CO0 and CH;COOH at equilibrium. What is the pH of the solution? (Ka = 1.8x105) CH;COOH(aq) CH;COO (aq) + H;O* (aq) a) Calculate the initial concentration of CH;COOH. (C:12; H:1; 0:16) b) Calculate the concentration of CH;COO- (aq) and H3O* (aq) at equilibrium. c) Calculate pH of the solution.

Q: A large volume of 0.1760 M H2SO3(aq) is treated with enough NaOH(s) to adjust the pH of the solution…

A: Introduction: pH: pH is used to express the acidity of the solution. It is defined as negative…

Q: What is the pH and pOH of a 28% KH2PO4?

A:

Q: The pH of human blood is steady at a value of approximately 7.4 owing to the following equilibrium…

A:

Q: 1. Determination of Vitamin C in Grape Juice acid, which gives the characteristic citrus taste to…

A: Citrus fruits contain Vit C. It is antioxidant that is essential for human body. Vit C content can…

Q: In a liter of 0.2F solution of propionic acid, HC3H$O2 it has ionization constant of 1.34 x 10-3,…

A: The formality solution is the number of formula mass of any solute dissolved in 1 litre of solution.…

Q: 1) Calculate the pH (aq., 25 °C) of a 0.073 M Novocaine (C13H21O2N2CI) solution, which is the salt…

A: Solving only first question in accordance with guidelines. We will first draw ICE table and then…

Q: What is the pH of a 0.0520 M solution of HONH;CI (Kb of HONH2 is 1.1 x 10-8)?

A: HONH3Cl is a salt of weak base HONH2 and strong acid HCl Recall the following expression to…

Q: what is the pH of a 2.32 molar solution of NH4Cl(aq)? The Kb for NH3 is 1.2 x10^-5.

A:

Q: Suppose a 0.48M aqueous solution of phosphoric acid (H,PO,) is prepared. Calculate the equilibrium…

A: Given, Concentration of aqueous Phosphoric acid solution = 0.48 M     Required,…

Q: Pyridine is a weak organic base, and readily forms a salt with hydrochloric acid. C,H;N(aq) +…

A: Pyridinium chloride is a salt made up of weak base pyridine and strong acid HCl.  Hence, pyridinium…

Q: calculate the pH of the solution eith an H+1 concentration of 2.90×10-12 and identify the solution…

A: Given,  The concentration of H+ = 2.90 × 10-12 M The pH of the solution is:

Q: Calculate the pH of a .10 M solution of formic acid (HCHO2). The Ka of formic acid is 1.8 x 10-4.

A:

Q: culate the pH of an 3.09 x 103 mol/L solution of hydrochloric acid to two wer:

A:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: When a solution is prepared by dissolving one pellet of KOH weighing 128 mg in 500 ml of dH2O…

A: Mass of KOH = 128 mg1mg = 10-3 gMass of KOH = 0.128 gMolar Mass of KOH = 56.1 g/molMoles of KOH =…

Q: The pH of a lime is 1.90. What is the [H3O*]?

A: Power of hydrogenpH value indicates the acidic and basic nature of a solution. pH ranges between 0…

Q: The pH of an aqueous solution of 3.34×10² M potassium acetate, KCH3COO (aq), is This solution is

A:

Q: 5. When 50.0 mL of 0.125 mol/L ethylamine (CH,CH2NH2) is titrated with o. 00 mol/L HCI, what is the…

A: According to the mole concept, in terms of mass, the amount of substance in moles is equal to the…

Q: Let's assume that there is 400 μatm of pCO2 in our atmosphere. Assuming there is nothing else in the…

A:

Q: In a solution of 0.015 mol L-1 HBr(aq) at 25 °C (a) What are the concentrations of the hydronium,…

A: pH stands for the potential of hydrogen ion concentration or power of hydrogen. The pH of an aqueous…

Q: The pH of a 0.70 mol/L weak base solution is 10.22. What is the Kb of the base?

A:

Q: Determine the pH of a 0.461 M C3H5CO,H M solution if the K, of C6H5CO2H is 6.5 x 105. 4.52 11.74…

A: pH  is commonly known power of hydrogen,  it measures the concentration of hydrogen ion in the…

Q: What is the pH of a 1.47 mol/L solution of HCN(aq) if its Ka = 3.5 ´ 10-11?

A: HCN is a weak acid hence it can dissociate partially Ka value of HCN=3.5×10^-11

Q: The pH is measured to be 2.58 for a solution of 0.035 M cyanic acid, HOCN (aq). Write the hydrolysis…

A: HOCN is a weak acid. Weak acid are those acid which does not dissociates completely in equilibrium.…

Q: Calculate the pH of 2.5 M CH2ClCOOH(aq) given that its Ka = 0.0014.

A:

Q: The Ka value for acetic acid, CH3COOH(aq), is 1.8×10−5. Calculate the pH of a 2.80 M acetic acid…

A:

Q: 11.An acid-base equilibrium system is created by dissolving 0.20mol CH3COOH in water and diluting…

A:

Q: If the pH of a 0.200 M solution of the CICH2O¯ ion is 12.05, then what is the value for the basicity…

A: Given: pH = 12.05 Thus, pOH = 14 - 12.05 = 1.95 As pOH = -log[OH-] Thus, [OH-] = 10-pOH = 10-1.95 =…

Q: Suppose a 0.48M aqueous solution of phosphoric acid (H,PO,) is prepared. Calculate the equilibrium…

A:

Q: Calculate the pH of a solution prepared by dissolving 0.482 mol of benzoic acid and 0.104 mol of…

A: Buffer solution: The solution that resists the change in pH is known as a buffer solution. The…

Q: The Ka of a weak acid is 5.42 x 10-5. What is the pKb of its conjugate base?

A: Ka = 5.42 × 10-5 (given )  pKa = - log [Ka]  pKa = - log ( 5.42 × 10-5 )  pKa = 4.266

Q: As the pKb of a series of weak bases decreases, the strength of their corresponding conjugate acids…

A: Bronsted-Lowry acid-base theory: The Bronsted-Lowry acid-base theory states that the acid is a…

Q: a. If 15.0 mL of H2SO&are required to neutralize 25.0 mL of 0.660 N KOH solution, to what volume…

A: These type of questions are based on the formula: M1V1 = M2V2 or N1V1 = N2V2 We will use the given…

Q: When ammonium acetate is dissolved in water, the following reaction takes place: NH,C,H,O2 (aq) - NH…

A: Given reaction:   NH4C2H3O2 (aq)   ----->  NH4+(aq)  + C2H3O2-(aq)  volume of 0.15 M NH4C2H3O2…

Q: The molar concentration of H3O+ ions in the following solutions was measured at 25 °C. Calculate the…

A: pH is used to measure acidity or basicity of an aqueous solution. pH of any solution can be…

Q: Estimate the pH of 0.0025 M NH(CH3)3Cl(aq) at 25°C. It is given that trimethylamine ((CH3)3N) has a…

A: Given : Concentration of salt = 0.0025M pKb = 4.19

Q: The pH of a 1.00 M NaCH3COO (aq) solution is 9.38. a/ Determine the concentration of [OH] in the…

A:

Q: Calculate the pH and pOH of a solution resulting from dissolving 0.75 grams of perchloric acid in…

A: Given: Mass of perchloric acid i.e HClO4 = 0.75 g And volume of solution = 1500 mL = 1.500 L…

Q: What is the degree of ionization (i) for H₂SO₄(aq)?

A: H2SO4 is a strong acid.

Q: 6. Acid-Base Equilibria. If HNO, is added to water, how does [OH ] change? How does pH change? a Use…

A: For pure water,  [H+] = [H3O+]  Hydrogen ion is not stable so with water it form hydronium ion. [H+]…

Q: What are the equilibrium concentrations of HF(aq), F (aq) ions, and H3O+ (aq) in a 0.10 mol L-¹…

A: Given :

Q: Suhe you dissolve 0.235 g of the weak acid benoic acd, CyCo, in enough water to make 1.00 10 m of…

A:

Q: (е) Ва(NO,),(аq) + NaOH(aq)-

A:

Q: The pH of asSolution is l,4lI. what is thep what is the TOM]? OH? What is the [H30*]?

A: Given   PH    = 1.411  POH  =   ? [ H3O+ ]   =  ?  [ OH- ]     =  ?

Q: The conjugate acid of H2O is

A: Conjugate acid is a chemical species same as original species combined with H+ ion.  In general, a…

Q: Which is the stronger acid, H2SO4 or H2SeO4? Why?

A:

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.