3 Si(s) +2 N₂(g) → Się N₁ (s) In this synthesis equation for production of trisilicon tetranitride (used to create a tough, break-resistant material for strong plane turbines), 75.0 g of silicon are combined with excess nitrogen gas. The molar mass of trisilicon tetranitride is 140.3 g/mol. 1) Calculate the theoretical yield of product. (round to the nearest whole number; enter only a number) 8 2) With an 88% yield, approximately what mass of Si3N4 is actually produced? (round to the nearest whole number; enter only a number)

3 Si(s) +2 N₂(g) → Się N₁ (s) In this synthesis equation for production of trisilicon tetranitride (used to create a tough, break-resistant material for strong plane turbines), 75.0 g of silicon are combined with excess nitrogen gas. The molar mass of trisilicon tetranitride is 140.3 g/mol. 1) Calculate the theoretical yield of product. (round to the nearest whole number; enter only a number) 8 2) With an 88% yield, approximately what mass of Si3N4 is actually produced? (round to the nearest whole number; enter only a number)

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter3: Equation, The Mole, And Chemical Formulas

Section: Chapter Questions

Problem 3.48QE

See similar textbooks

Similar questions

Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.