14. Calculate the standard enthalpy change for the reaction: 2Al(s) + Fe2O3(s) 2Fe(s) + Al2O3(s) given that: 2Al(s) + 3/202(g) → Al2O3(s) 2Fe(s) + 3/202(g) → Fe2O3(s) AH°x=-1675.7kJ/mol AH x =-824.2kJ/mol

14. Calculate the standard enthalpy change for the reaction: 2Al(s) + Fe2O3(s) 2Fe(s) + Al2O3(s) given that: 2Al(s) + 3/202(g) → Al2O3(s) 2Fe(s) + 3/202(g) → Fe2O3(s) AH°x=-1675.7kJ/mol AH x =-824.2kJ/mol

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 69E: Using the data in Appendix G, calculate the standard enthalpy change for each of the following...

See similar textbooks

Related questions

Q: Please correct answer and don't use hend raiting

A: Carbonyl electrophileThe question is asking to draw the structure of the carbonyl electrophile which…

Q: What would be the major product from the reaction below? CH3 DMSO ? CI + NaCN CH CH3 CH₂ H₂C CN CN…

A: The given reaction involves a reaction of a secondary alkyl halide with NaCN in the presence of…

Q: How many grams of potassium hydroxide (KOH) should be added to 0.800 L of 0.250 M hydrochloric acid…

A: Concentration of HCl = 0.250 MVolume of HCl = 0.800 LKa of HCl = Required pH after the addition of…

Q: 1) RCO₂H 2) [H2SO4], ? OH Modify the given structure to draw the major product(s). Use the single…

A: Alkenes react with peroxy acid to gives epoxides.Epoxidation is described as the addition of a…

Q: A chemist adds 210.0 mL of a 0.00279 mol/L calcium sulfate (CaSO4) solution to a reaction flask.…

A: The volume of calcium sulfate is .The molarity of calcium sulfate is .To calculate the millimoles of…

Q: R-CEN M₂OR-Cook эк-соон н write acid catalyzed mechanism

Q: 3 A student trying to prepare aspirin begins with 3.25 g of salicylic acid and excess acetic…

A: Given,mass of salicylic acid = 3.25 g

Q: Draw the major elimination and substitution products formed in this reaction. Use a dash or wedge…

A: Step 1:Nucleophilic substitution (SN1 and SN2):Nucleophilic substitution is a fundamental reaction…

Q: Calculate the volume in milliliters of a 1.3 mol/L sodium carbonate solution that contains 25.0 g of…

A: Step 1: Calculation of moles of sodium carbonateGiven,mass of sodium carbonate = 25.0 g we know,…

Q: Draw the organic product of the Lewis acid-base reaction shown below. Include all lone pairs and…

A: Given that, the reaction is:

Q: Draw the structure(s) of the major organic product(s) of the following reaction. 1. lithium…

Q: Which statement is true regarding Ecell and Eocell? Group of answer choices When Q > K, Ecell…

A: The objective of the question is to identify the correct statement regarding the relationship…

Q: Consider the titration of 100.0 mL of 0.200 M acetic acid (Ka = 1.8x10^-5) by 0.100 M KOH. Calculate…

A: The objective of the question is to calculate the pH at the given volumes of the base added.

Q: Cl₂ major product CH,CH₂OH

A: Product 3,4 are formed because ethanol attacks from opposite side of chlorin attached. CH3CH2O-…

Q: When 0.253 g of benzoic acid, C6H5COOH, is dissolved in 12.45 g of cyclohexanol, C6H11OH,…

Q: 322 II. Calculations Show all of your work, where indicated, including any formulas, units, etc. Pay…

A: Given : Reaction of permanganate ion and Fe (II).Permanganate ion : MnO4- Iron (II) : Fe2+Oxidation…

Q: None

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: (b) The 1H-NMR spectrum of compound B, C5 H10O2, consists of the following signals: 81.2 (d, 6H),…

A: NMR spectroscopy is a very important tool for the determination of the structure of the organic…

Q: common name molecule (not the IUPAC name) C=O H3N H CH2-C-NH2 0 C=O CH2 H C=O + H CH3 NH3 ☐

A: The name which is simpler and more widely recognized than the systematic names assigned by the…

Q: For an ethanol-chloroform mixture at 545 mmHg, determine: a) The Liquid - Vapor equilibrium diagram…

A: Distillation of Ethanol-Chloroform Mixture (Simplified Approach)While we cannot determine the exact…

Q: None

A: 1. Given: [B]=0.175M;[OH−]=0.00462M;Kb=???Step 1: Write the acid dissociation of the base in…

Q: Write electron configurations for each of the following elements. Use the symbol of the previous…

A: The objective of the question is to determine the electron configuration of the element Gallium (Ga)…

Q: consider an oxygen molecule confined in a 0.127m^3 three-dimensional box with equal sides and a…

A: A three dimensional box with equal sides the length is The total energy is

Q: Given below are suitable synthetic equivalents for the indicated synthons.

A: Given is retrosynthetic reaction. Retrosynthetic analysis is useful tool for determination of…

Q: Write full electron configurations for each of the following elements. Sr

A: The objective of the question is to find the full electron configuration for the element Strontium…

Q: From the solubility data calculate the solubility product of the following compounds: a. A fluoride…

A: Given,a. solubility of MF2 = 7.3 x 10-2 g/Lmolar mass of MF2 = 125.6 g/molb. solubility of M3PO4 =…

Q: Choose the correct product for each reaction. A. B. C. D. PPh3 H PPh3 || I ။

A: Step 1:The Wittig reaction is stereoselective with nonstabilized ylides, the reaction is…

Q: Draw the expected major product for the following reaction. очь AICI 3 CI

A: Given,The reaction is:

Q: Find out all the unknown compounds (A, B and C) in the following multistep synthesis.

A: Find out A,B,C

Q: 8) Draw complete Lewis structures and indicate, using VSEPR, which of the following species (there…

A: Approach to solving the question: Analyze Lewis structures to determine central atom's bonding…

Q: If the following polysaccharide were to attach to a protein, to which atom(s) in the carbohydrate…

A: The objective of the question is to identify the atom(s) in a polysaccharide that could potentially…

Q: sketch a simple orbital overlap diagram to show how a bridging ligand can facilitate the coupling of…

A: Antiferromagnetism is a type of magnetism in which adjacent ions or electrons are aligned in…

Q: Draw the complete, detailed mechanism (curved arrows) for the reaction between alanine and DCC and…

A: Step 1:Step 2: Step 3: Step 4:

Q: The pH of a 0.57M solution of acetic acid (HCH3CO2) is measured to be 2.49. Calculate the acid…

Q: Calculate the energies, in Joules, of the v = 0, 1, 2, and 3 vibrational states for HCI (Mosc 2991…

A: Step 1:Step 2: Step 3: Step 4:

Q: - Predict the product of the following reactions. Part A OEt Ph 1. NaOEt, EtOH, heat 2. H₂O+ quench…

A: We have to predict the products.

Q: Payalben

Q: The pH of a 0.82M solution of hexanoic acid (HC6H1102) is measured to be 2.47. Calculate the acid…

A: Given that,The concentration of hexanoic acid,pH of the solution = Acid dissociation constant of…

Q: 3. Draw the resonance structure of the following compound O-N

A: Resonance structures, also known as resonance forms or resonance contributors, represent the…

Q: None

A: Step 1:Principle carbon chain has 4 carbon atoms, root name is but. -CN group is the primary…

Q: NaOH, H-O

Q: Predict the products of this organic reaction: Δ + H2O + HCI ? N H Specifically, in the drawing area…

A: The products are,

Q: Convert product C, shown below, into its Fischer projection. One of the carbon atoms has been marked…

A: Step 1:To convert the given product C into its Fischer projection, you need to visualize the…

Q: Write electron configurations for each of the following elements. Use the symbol of the previous…

A: The objective of the question is to write the electron configuration for the element Iron (Fe) using…

Q: Which are viable ways to prepare the amine shown? || H NH + N ZI N NaBH3CN NaBH3CN A. Method I only…

A: ACCORDING TO THE ABOVE CONCEPT CORRECT OPTION WILL BE (OPTION "A" MATHOD I ONLY )

Q: 3. Provide the mechanism for the formation of product A: NBS, ROOR CCl45 subni Br ASC Br od…

A: Step 1: Step 2: The given reaction is known as the halogenation of alkanes in the presence of…

Q: What is the IUPAC name of the following compound? NH, Ọ CH3CHCHCOH CH3

A: Every compound (and its various isomers) has only one officially recognized name according to UPAC…

Q: • Draw the less stable chair conformation of myo-inositol clearly indicating the axial and…

A: Given compound is myo-inositol.It is a cyclohexane derivative. The less stable chair conformation is…

Q: For the following reaction, 26.0 grams of bromine are allowed to react with 16.5 grams of chlorine…

A: For the given reaction,Mass of Molar mass of Mass of Molar mass of Molar mass of Then,

Q: A gas in an open container is heated from 27°C to 127°C. The fraction of the original amount of the…

A: Initial temperautre ,T1 = 27°C = (273+27)K = 300KFinal temperature, T2 = 127°C =(273+127)K = 400KWe…

Question

14. Calculate the standard enthalpy change for the reaction:
2Al(s) + Fe2O3(s) 2Fe(s) + Al2O3(s)
given that:
2Al(s) + 3/202(g) → Al2O3(s)
2Fe(s) + 3/202(g) → Fe2O3(s)
AH°x=-1675.7kJ/mol
AH x =-824.2kJ/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
Calculate H for the reaction N2H4(l)+O2(g)N2(g)+2H2O(l) given the following data: Equation H(KJ) 2NH3(g)+3N2O(g)4N2(g)+3H2O(l) 1010 N2O(g)+3H2(g)N2H4(l)+H2O(l) 317 2NH3(g)+12O2(g)N2H4(l)+H2O(l) 143 H2(g)+12O2(g)H2O(l) 286
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?