Concept explainers
(a)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different
To determine: The distinguishable factor between the given pair of compound.
(b)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different functional groups, it is easy to distinguish organic compounds by performing different chemical tests like test for functional group, test for unsaturation and so on.
To determine: The distinguishable factor between the given pair of compound.
(c)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different functional groups, it is easy to distinguish organic compounds by performing different chemical tests like test for functional group, test for unsaturation and so on.
To determine: The distinguishable factor between the given pair of compound.
(d)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different functional groups, it is easy to distinguish organic compounds by performing different chemical tests like test for functional group, test for unsaturation and so on.
To determine: The distinguishable factor between the given pair of compound.
Trending nowThis is a popular solution!
Chapter 22 Solutions
Chemistry
- What term describes the structural relationship between (2R,3R,4S)-2,3,4-trichloroheptane and (2R,3R,4R)-2,3,4-trichloroheptane? A. enantiomers B. diastereomers OO OO C. constitutional isomers D. not isomersarrow_forwardGive the systematic name for the following compounds. 1. C(CH3)3CH(CH3)CH2CH(CH2CH3)CH2CH3 2. CH3CH2CH2C(CH2CH3)2CH(CH3)2arrow_forwardA. Identify and name the functional group in each of the following. 1. Снзсоснз 2. снзосн2сHз 3. CH3CH=CH2 CH3CH2COOH 5. CH3CH2CHO 6. CH3CH2CH20H 4.arrow_forward
- What is the IUPAC names of 1. CH3CH2COOCH2CH3 2. CH3CH2-CO-O-CO-CH2-CH2-CH3arrow_forward1.Name the following compounds using the IUPAC Nomenclature. a. CH3CH(CH3)(CH2)4CH3 b. CH3 │ CH3-CH-CH-CH3 │ CH3 2. Draw the structures of each of the following compounds a. cis-1,2-Dichlorocyclopropane b.trans-1,4-Diethylcyclohexanearrow_forward1. What functional group is produced when an aldehyde reacts with H2/Pt? A.secondary alcohol B. carboxylic acid C.hemiacetal D. primary alcohol E.alkane F.tertiary alcohol G. alkene 2. What reaction occurs when an aldehyde reacts with H2/Pt to form a primary alcohol? A. Hydration B. Hydration C. Dehydration D. Oxidation E. Reduction( hydrogentation) 3. What reaction occurs when an Ester react with H+/H2O to from a carboxylic acid and alcohol? A. Dehydration B. Reduction ( Hydrogenation) C.Hydrolysis D. Hydration E.oxidationarrow_forward
- Draw the structure of the following compounds. a. 1-ethyl-3-methylcycloheptane b. Cyclopropylcyclopentane c. 1,1-diethyl-4-(3,3-dimethylbutyl)cyclohexanearrow_forward1. Which of the following compounds are isomers of each other? I. 3-hexene II. Cyclohexane III. 2,3-dimethyl-2-butene IV. 2-methyl-2,3-pentadiene a. I and II b. II and IV c. I, II, III d. I, II, III, IV 2. Which of the following does not contain a carbonyl group? A. CH3CH2CH2COCH2CH3 B. CH3CH2CH2COOCH3 C. CH3CH2CH2CHOHCH2CH3 D. CH3CH2CH2CONH2CH3arrow_forward13. Ethylethanoate and butanoic acid can be classified as A. positional isomers B. chain isomers C. functional isomers D. stereoisomers 14. Which of the following pairs are positional isomers A. trans-1,4-dichlorocyclohexane, cis-1,3-dichlorocyclopentane B. trans 1,4-dichlorocyclohexane, cis-1,4-dichlorocyclohexane C. 2-pentanol, Cyclopentanol D. 1,2-cycohexanediol, 1,3-cycohexanediol 15. Which of the following compounds will have zero dipole moment? A. cis-1,2-dibromoethylene B. 1,1-dibromoethylene C. trans-1,2-dibromoethylene D. all of these 16. Which of the following is not aromatic: A. cyclopentadienyl cation B. cyclopentadienyl anion C. Cyclopropenyl cation D. Cycloheptatrienyl cation 17. Which of the following compounds containing lone pair has the least tendency to donate its electrons? A. the lone pair in pyridine B. the lone pair in furan C. the lone pair in pyrole D. the lone pair in thiophenearrow_forward
- 2. Systematically CH₂CH3 OH Br name each of the following compounds. CH3 CI COOH SO3H CH3 H₂N CH₂CH3 NO₂ H. Brarrow_forwardMultple choice 4. To which family of organic compounds does CH₂CH₂CH₂CH₂CHO a. Alcohol b. Aldehyde c. Alkyne 5. Which statement is correct? belong? d. Ketone e. Carboxylic acid a. Aldehydes strongly resist oxidation. b. Ketones are easily oxidized. c. Carboxylic acid groups are easily oxidized. d. An ester may be hydrolyzed to give a carboxylic acid and an alcohol. e. Amides will not react with water. 6. Which statement describes addition polymers? a. They are made of monomers that have two functional groups. b. They may form between an organic acid and an amine. c. When they are produced, a small molecule (such as water) is also produced. d. all of the above e. None of the abovearrow_forwardIn general, which one of the functional groups below does not react with LiAlH4? a. ethers b.esters c.carboxylic acids d. ketonesarrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning