Which of the following is the correct condensed structure for the following compound? O CH3C(CH3)2(CH2)2(CH)BrC(CH3)2 O CH3CH3CH3C(CH2)2C(CH3)2CHBr O (CH3)3C(CH₂)3BrCHCH3CH3 O CH3CH3CH3C(CH₂)2CHBrCHCH3CH3 O (CH3)3C(CH2)2CHBRCH(CH3)2 Br

In chemistry, reactive intermediates are termed as short-lived, highly reactive atoms with high energy. They rapidly transform into stable particles during a chemical reaction. In specific cases, by means of matrix isolation and at low-temperature reacti…

A hydride shift is a rearrangement of a hydrogen atom in a carbocation that occurs to make the molecule more stable. In organic chemistry, rearrangement of the carbocation is very easily seen. This rearrangement can be because of the movement of a carboc…

A carbocation where the positive charge is on the alkene carbon is known as the vinyl carbocation or vinyl cation. The empirical formula for vinyl cation is C2H3+. In the vinyl carbocation, the positive charge is on the carbon atom with the double bond t…

It is an aromatic carbocation having a general formula, [C7 H7]+. It is also known as the aromatic tropylium ion. Its name is derived from the molecule tropine, which is a seven membered carbon atom ring. Cycloheptatriene or tropylidene was first synthes…

Carbocations are positively charged carbon atoms. It is also known as a carbonium ion.