when naturally occuring arsenic becomes solubilized and contaminates water sources it can result in arsenic poisoning. arsenic with the oxidation state in H3AsO3 is more toxic than in H3AsO4. the balanced one electron reduction half reaction for reduction of H3AsO4 to H3AsO3 is 1/2H3AsO4 (aq) + H+ (aq) + e- ~> 1/2H3AsO3 (aq) + 1/2H2O (l) -what is oxidation state of As in H3AsO3 -what is oxidation state of As in H3AsO4 -given the standard Ecell for the reduction half reaction is +0.56 V, write an equation for pE in terms of pH and the ratio of two arsenic containing species -the pH of a particular sample is 2.00 and the pE value is 8.97 what is the ratio of H3AsO3(aq) to H3AsO4(aq) in this system

Q: A total of 1.429 F of electricity (1 F = 1 mol e) was required to electrodeposit all of the Zn and…

A:

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A:

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: The relationship between the potential of an redox reaction and ΔG° is given as-  ∆G° = - nFE° ;…

Q: Complete and balance the following half-reaction in acidic solution H2SO;(aq) → SO,² (aq)

A:

Q: For the following electron-transfer reaction: 3Cl₂(g) + 2Cr(s) →→→→ 6Cl¯(aq) + 2Cr³+ (aq) The…

A:

Q: Balance the following electrochemical reaction in acid: MnO 4 (aq) + Zr( s) → Mn –"( aq) + Zr + Zr…

A:

Q: Balance the following reactions by the half-reaction method in acidic conditions (include phases at…

A: We are authorised to solve only one question at a time. Please post rest of the questions…

Q: Applications of Principles (continued) 5. Balance the following reactions and identify the species…

A: Identify the oxidised and reduced product of the given reactions---

Q: Consider the following reductions. Cu+(aq) +  e- ⟶⟶ Cu(s)                                     Eored…

A: Oxidizing agent:-  It is a substance that oxidizes other substances and gets reduced by itself.…

Q: Which species functions as the oxidizing agent in the following reduction-oxidation reaction: 5…

A: The Correct option is MnO-4 (aq).

Q: For the following redox reaction, state which species is being oxidized and which is being reduced.…

A: Oxidation: Increase in oxidation numberReduction: Decrease in oxidation number

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The redox reaction is given as follows: Fe+Zn2+------------>Zn+Fe2+

Q: Jse the standard reduction potentials located in the 'Tables' linked above to calculate the standard…

A: Solution- Fe2+(aq) + Cu(s) → Fe(s) + Cu2+(aq)E0cell=EoCu /Cu2+  + EoFe2+ / Fe=-0.34n +…

Q: Write a balanced half-reaction for the oxidation of solid manganese dioxide (MnO₂) to permanganate…

A: Oxidation : Loss of electrons with increase in the oxidation state .Solid manganese dioxide MnO2…

Q: Write balanced half-reactions for the following re Cl₂(g) + Bi³+ (aq) + 3 H₂O(1)→ reduction:…

A:

Q: [Réview Topics] [References) Use the half-reactions shown below to answer the following questions.…

A: The species which has higher reduction potential that is reduced and oxidize other which has lower…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: Use the oxidation number method to balance the following skeletal equation. The reaction occurs in…

A: IO3- (aq) + HSO3- (aq) -----> I- (aq) + SO42- (aq)   Oxidising agent : IO3- (Change in the…

Q: Balance the following redox equation, for a reaction that takes place in acidic solution. Co(aq) +…

A: The objective of the question is to balance the given redox equation and identify the species that…

Q: For the following skeletal reaction, use the half-reaction method to write a balanced net reaction…

A: Answer:- This question is answered by using the simple concept of balancing the redox reaction using…

Q: Complete and balance the following redox reaction in basic solution Cr20,2 (aq) + Hg(1) → Hg2* (aq)…

A: 1- Oxidation Half reaction :  Hg(l) -------> Hg2+(aq) + 2e-  Multiple with 3  3Hg(l) ------>…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Oxidising agent is the one which oxidises others and itself gets reduced by gaining electron.  For…

Q: 16. Balance by the half-reaction method, Fe(s) + NO3 Reductant half-reaction: Oxidant half-reaction:…

A: Loss of electrons is oxidation and loss of electrons is reduction.  Reduction half reaction = 3e +…

Q: When the following skeletal equation is balanced under basic conditions, what are the coefficients…

A: The unbalanced reaction involved is HXeO4- + SO32- ------> Xe + SO42- In HXeO4- , Oxidation…

Q: Complete and balance the following redox reaction in acidic solution As(s) + 10 H*(aq) → H3ASO,(aq)…

A: Complete and balanced the redox reaction under acidic condition ----

Q: Balance the following oxidation-reduction reaction in basic solution. Hint: Oxygen oxidation number…

A: Given: Cr2O72-(aq)+H2O2(aq)→Cr+3(aq)+O2(g)   Calculation for oxidation state of Cr in Cr2O72-: let x…

Q: Calculate the equilibrium constant, K, for the reaction shown at 25 °C. Fe*(aq) + B(s) + 6H,O(1) -…

A:

Q: Complete and balance the following half-reaction in acidic solution S20,2 (aq) → S,06² (aq)

A: S2O32-(aq) -----> S4O62-(aq) We have to balance the equation.

Q: Balance the overall oxidation-reduction reaction given the following balanced half-reactions: 2H2O…

A: Balanced overall redox reaction: By addition of both half reactions, 4CrO42-(aq)  + 3Cl-(aq) +…

Q: Consider the following skeletal half-reaction. H₂SeO3(aq) → Se(s) The oxidation number of Se The…

A: Oxidation state of Se is +4 in H2SeO3 . Oxidation state of hydrogen and oxygen is known so we can…

Q: Example #6 Balance the following redox reaction which occurs in a basic solution: SO₂2- + MnO → SO²…

A: The unbalanced reaction is, SO32- + MnO4- → SO42- + MnO2 Using half-reaction method, the above…

Q: The table below shows the standard reduction potential of some biochemical reactions. As per the…

A: On the basis of reduction potential given in table we have to tell which of the molecule reduced…

Q: Enter electrons as e The following skeletal oxidation-reduction reaction occurs under basic…

A:

Q: Identify the oxidizing and reducing agents in the skeletal (unbalanced) reaction. Then, balance the…

A: The balanced equations are incorrect because question ask to balance in Basic aqueous medium but in…

Q: Balance the following equations. When balancing equations for redox reactions in aqueous solution,…

A:

Q: Balance the following oxidation-reduction reaction in acidic conditions: C207 2-(a) + C2H50(a) →…

A: Redox reactions are reactions which involve the transfer of electrons from one species to another…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A:

Q: Complete the statements about the redox reaction below. 2Au*(aq) + 3Cd(s) → 2Au(s) + 3Cd²*(aq)…

A:

Q: Use the standard reduction potentials located in the 'Tables' linked above to calculate the standard…

A: Given ReactionCo2+ (aq)  + Zn(s) → Co(s)  +  Zn2+ (aq)Oxidation Half cell Zn(s) →   Zn2+ (aq) +…

Q: Consider the following equation in aqueous solution: PO₃³⁻(aq) + SO₂(g) → PO₄³⁻(aq) + S²⁻(aq) The…

A: The potential, via which the tendency of a species to gain electrons from an electrode or to lose…

Q: Aqua regia, a mixture of concentrated HNO3 and HCl, was developed by alchemists to “dissolve” gold.…

A: Answer: Aqua regia is a combination of two strong acids nitric acid and HCl when they are mixed in…

Q: The following skeletal oxidation-reduction reaction occurs under primary conditions. Write the…

A: Redox-reaction are those reaction in which oxidation and reduction both occur simultaneously. In…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: A redox reaction is balanced by balancing the mass and charge. Hence the number of atoms of all the…

Q: Enter electrons as e. The following skeletal oxidation-reduction reaction occurs under basic…

A: We have to predict the balance reduction half reaction.

Q: 1. Refer to Table 10.1, calculate the standard-stage voltage for the following reduction half-…

A:

Q: plete balance lne following han ICtion in SOluli CIO: (aq) → CI-(aq) O3- D2+ 3+ 14+ 1 2 3 6. 7 8 D4…

A: The half-reaction is as follows: ClO3-(aq)→Cl-(aq)

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.