What is/are the product(s) when 2-methylhpentan-2-ol undergoes mild oxidation

Q: Draw the structural formula of  (E)-1,2-dibromo-3-isopropyl-2-hexene. EXPLAIN reasoning behind the…

A:

Q: Determine the product of the addition reaction. NaCN CH—CH—CH,— CH + H—СN

A: When an aldehyde or ketone is allowed to react with (HCN) hydrogen cyanide, nucleophilic addition…

Q: When compound CH3-C(CH3)=CH-CH2-CH(CH3)2 is the SUBSTRATE (reactant) in a HALOGENATION reaction with…

A: The halogenation of an alkene is an anti addition reaction.

Q: Cyclopentene reacted with bromine, Br 2, gives what product?

A: Alkenes reacts with bromine in presence of dichloromethane. The reaction is an addition reaction in…

Q: ti NH CH₂ -(CH3)- + || -NH–C-(CH2)6-C

A:

Q: Give the major organic product(s) of the following reaction NaOCH3 NaOH H30* ? CH3OH H20, heat heat

A: the solution is as follows:

Q: Classify each compound as an aldehyde or a ketone. Give the common name for each ketone.…

A: Any compound with a -CHO group is an aldehyde and any compound with a -C=O group is a ketone.  In an…

Q: Alkyl sulfonates undergo the same type of substitution reactions as alkyl halides and can also be…

A: A question based on introduction to organic chemistry that is to be accomplished.

Q: What is the Molecular formula of 3,7-Diethyl-4-isopropyl-2,2,5-trimethylnonane?

A: Molecular formula denotes  the number of  each atomic species present in a molecule. The given…

Q: what classes do these compounds belong to - list as many classes as possible

A: For these compound Classes means how they are derived like which functional group or which…

Q: Determine the name and draw the structure of the product formed from the reaction: H2C=CHCH3 + H+ /…

A:

Q: Draw the skeletal (line-bond) structure of 3,5,5-trimethylhex-1-ene

A:

Q: NO2 HN" a) H3C- CH3 + NO2 b) + H;C CH3 →

A:

Q: Write the structure of the following compound: 2-(2-chlorophenyl)-1 -iodoethane.

A: The structure of the compound gives the arrangement of the atoms in the space. Various physical and…

Q: OH LIAH4 SOC2

A: Carboxylic acids on reduction with lithium aluminium hydride ( LiAlH4 ) forms the corresponding…

Q: Is CH3F or CH3CH2OH more soluable in water.

A: Between CH3F or CH3CH2OH, which is more soluable in water.

Q: CH,CH,CH,CH,CH.CH,OH b CH,CH,CHCH,CH,CH, OH сH, Br CH,C-CCH, 1. OH Br CH, OH CH,CH-CHCH,CH,

A: Alcohol is a important functional group in organic chemistry. It has a hydroxy group (-OH). Alcohols…

Q: ОН

A: Dehydration of alcohol may give trans and cis alkenes. But here, the alkene formed has two phenyl…

Q: Name the products of the following reaction. Put the IUPAC name of the most oxidized product in the…

A: Amides upon hydrolysis in aqueous acidic conditions form carboxylic acids and amines. The most…

Q: Draw a structure for 4-bromo-2-pentene where the double bond has a Z geometry and the chiral carbon…

A:

Q: H3C- -CH3 H₂ Lindlar's catalyst H H₂C H CH3

A:

Q: H3C- CH3 [(4E)-hex-4-en-3-yl]cyclopentane

A: The given compound is [(4E)-hex-4-en-3-yl]cyclopentane.

Q: What is the structural formula of 1,3-dibromo-5-methylcyclohexane?

A: Structural formula are the representation of molecule with indication of each atoms present in…

Q: OH OH HO H,C `N' H3C CH3 CH, H- H3CO- CH3 CH3 OH C-NH2 エーZ O=

A: ester and amide

Q: Draw the structure for   a) (Z)-1-chloro-2-ethyl-1,3-butadiene   b) glycerol   c)…

A: Structure of the given species is    a) (Z)-1-chloro-2-ethyl-1,3-butadiene   b) glycerol   c)…

Q: Which reagent is needed to change an alkyne to an alkane? * Н:0+, Hg (COОH)2 N2, Pt Ог, Pd Н, Pt…

A: Alkene is a compound contaning a double bond between carbon and carbon

Q: Write the structural formula for butanoic acid, 4-iodo-3-methylpentanoic acid and…

A: In the reaction of alcohol with carboxylic acid ester is obtained having sweet flavor of various…

Q: The monomers H H -H and H- но- (CH2)4- -OH OH OH would react with each other to form a polycarbonate…

A: Polymer can be defined as large molecule formed by combination of a number 9f monomer molecules.

Q: Pt 6-bromo -2-heptene + H2 →

A: Alkenes reacts with hydrogen in presence of catalyst to convert into alkanes.

Q: FO OH 1. CH3MgCl 2. H3O+ A B (2 organic products)

A: The objective of the question is to find two organic products from the given reaction in which…

Q: ethylene to 2-methylbutanoyl chloride

A: The steps involved in this conversion are the formation of alkyl hallide from alkene followed by…

Q: The reaction of the organoborane intermediate in the anti-Markovnikov hydration of an alkene is said…

A: Addition of alkenes can happen through markovnikoff additon as well as antimarkovniloff addition.…

Q: Indicate the principal product or complete the following chemical reactions. NH2 1. KMNO4, HO, calor…

A: Formation of quaternary amineHoffman eliminationOxidation of alkene to dicarboxylic acidAddition of…

Q: Convert propan-2-ol [(CH3)2CHOH] to attached compound. You may use any other organic or inorganic…

A: Convert propan-2-ol [(CH3)2CHOH] to attached compound.

Q: Rank the compounds in order of increasing oxidation state (most reduced to most oxidized) for the…

A: Oxidation number of any atom is a hypothetical charge on that atom when all the bonds of that atom…

Q: What alcohol is formed by the addition of water in the presence of sulfuric acid (an addition…

A: we have to determine the major product of the reaction

Q: Alkenes can be converted to alcohols by reaction with mercuric acetate to form a…

A: In the oxymercuration reaction, the addition of Hg(CH3COO)2 and OH occur via the anti-addition…