What is the equilibrium constant expression for3Cl2(g) + NH3(g) = NC13(g) + 3HCI(g)?[NH, ][Cl,][NCI, [HCI](B) K¸ = NCI, ][HCI][NH,][Cl,](А) К, 3(В) К.[NH,][Cl,]'[NCI, ][HCI}[NCI, ][HCI}[NH, ][Cl,J'(С) К.(D) K.

What is the equilibrium constant expression for 3Cl2(g) + NH3(g) = NC13(g) + 3HCI(g)? [NH, ][Cl,] [NCI, ][HCI] [NH, ][Cl,} [NCI, J[HC1} [NCI, ][HCI] [NH,][Cl,] (А) К. (В) К, . %3D [NCI, J[HCI} [NH, ][Cl,]' (C) K̟ (D) K.

What is the equilibrium constant expression for 3Cl2(g) + NH3(g) = NC13(g) + 3HCI(g)? [NH, ][Cl,] [NCI, ][HCI] [NH, ][Cl,} [NCI, J[HC1} [NCI, ][HCI] [NH,][Cl,] (А) К. (В) К, . %3D [NCI, J[HCI} [NH, ][Cl,]' (C) K̟ (D) K.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: At a certain temperature, the equilibrium constant, Kc , is 0.00324 for the reaction…

A: A)The Kc expression for given reaction is as follows,

Q: At 100 °C, the equilibrium constant for the reactionCOCl21g2 ∆ CO1g2 + Cl21g2 has the value Kc =2.19…

A: For a reversible reaction at any stage other than the equilibrium, the ratio of the products of the…

Q: Calculate the equilibrium concentration of C2H4 when starting with 1.00 M C4H8. Kc = 2.4 times 10-5…

A: Equilibrium constant (KC) is the ratio of the equilibrium concentration of reactant and products,…

Q: 8. The equilibrium concentrations of H,(g) and NH, (g) are 0.56 mol·L and 0.48 mol/ L respectively.…

A: A reaction is said to be in equilibrium if the rate of forward reaction is equal to the rate of…

Q: Consider the following equilibrium system: 2CrO4 2-(aq)+2H+(aq) 12 Cr2O72 (aq)+H2O(1) Write the…

A: Option AExplanation:

Q: 2CO2(g) 2CO(g) + O2(g) If the initial concentration is [CO2]i = 0.010 M and the equilibrium constant…

Q: Consider the following reaction: N2 (g) + 3 H₂ (g) = 2 NH3 (9) Complete the following table. Assume…

A: Consider the following reaction: N2(g) + 3H2(g) <----> 2 NH3(g) Complete the given table.…

Q: Predict the equilibrium concentration of NH, in the reaction described below (for which Kc = 1.2 x…

A: Answer:For any reaction, value of equilibrium constant KC is equal to the ratio of molar…

Q: Write the equilibrium formula for the following chemical reactions (do not actually solve for Keq):…

Q: Which of the following statements is correct concerning the value of the equilibrium constant of the…

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: At a certain temperature, 0.382 mol CH, and 0.945 mol H,O is placed in a 2.50 L container. CH, (g) +…

A: The equilibrium reaction given is, Given : Moles of CH4 taken = 0.382 mol Moles of H2O taken =…

Q: 5. What is the correct equilibrium constant expression for the reaction below? NHg) + HCl(g) –…

Q: 10) For the reaction below at a certain time, temperature and pressure, the [CO2] is 2.24 M, [H*] is…

A: Given: [CO2] = 2.24 M [H+] = 0.058 M [HCO3-] = 0.097 M KC = 9.81 x 10-6

Q: At equilibrium, the concentrations in this system were found to be [N2]=[O2]=0.100 M and [NO]=0.400…

Q: C1. Subject :- Chemistry

A: The final quantity of reaction's species for any reversible reaction is computed using equilibrium…

Q: 9) Which of the following is the correct equilibrium law for the following reaction? N₂(g) + 3H₂(g)…

Q: 7.11x +.15 =.975-2 7 Calculate the equilibrium concentrations of all species if 3.000 moles of H2…

Q: At a certain temperature, 0.312 mol CH, and 0.728 mol H, S are placed in a 2.00 L container. CH(g) +…

Q: WRITE THE EQUILIBRIUM EXPRESSION FOR EACH OF THE HETEROGENOUS EQUILIBRIUM (A) P4 (S) + 6F2 (G) ->…

A: Given(A) P4 (s) + 6F2 (g) ⇌ 4PF3 (g) (B) Xe(g) + 2F2(g) ⇌ XeF4(s) (C) 2SiO (s) + 4Cl2(g) ⇌ 2SiCl4…

Q: The equilibrium constant for the reaction A(g) B(g) is Keg = 1.2 x 103. %3! At equilibrium [A] =…

A: If the two opposing process in a reversible change are chemical change and the state in this change…

Q: 3. The following equilibrium process has been studied at 458°C. NazCO3 (s) + SO2 (g) +02 (g) )…

Q: which of the following expressions is the correct equilibrium constant expression

A: We have to select the correct expression for equilibrium constant for the given expression

Q: 36) The equilibrium constant Ke for the reaction HF(aq) + H2O(1) =H3O+aq) +F-(aq) is 3.5 x 10-4.…

A: The equation concentration (KC) of the reaction is . The equilibrium concentration of HF is 1.0 M.…

Q: Based on the information below, determine the value of the unknown equilibrium constant, K. 2 NOCI…

A: If reaction is reversed Kc become reciprocated If reaction is divided Kc become Quberoot i.e…

Q: The reaction equilibrium constant N2 (g) + O2 (g) chemical balance NO (g) Kc = 1.00.10-5 at 1200 ºC…

Q: The K. for the formation of HI from iodine and hydrogen gas is 54. If the concentrations of HI, 12,…

Q: Which of the following expressions is the correct equilibrium-constant expression for the following…

Q: PCI3(g) + Cl(g) =PPCI<(g) Assuming that you start with equal concentrations of PCl, and Cl, and no…

A: PCl3(g) + Cl2(g) <-> PCl5(g)

Q: Hzlg) + Bra(1) = 2HBrig) K. 4.8x 105 Assume initial conditions of 0.400 MHlg) and excess Br). What…

A: Equilibrium constant gives the relation between concentration of reactants and products when the…

Q: Consider the equilibrium below A2lg) + B2lg) 2AB(g) where Kc = 57.7 If the following are the…

A: The given chemical reaction as follows,A2(g)+B2(g)⇌2AB(g)the equilibrium constant for the above…

Q: A vessel originally contained 0.200 mol iodine monobromide (IBr), 0.0010 mol I2, and 0.0010 mol…

Q: Consider the following equilibrium reaction: N2(g) + 6 HCl(g) 2 NH3(g) + 3Cl2(g) The equilibrium…

Q: [NH₂] = 3.6 X 102 mol L- 12.34 The equilibrium constant for the reaction, 3 H₂(g) + N₂(g) 22 NH3(g),…

A: Equilibrium constant is defined as ratio of concentration of product to the concentration of…

Q: Consider the following reaction: 4 NHK + 50.210, 04 NO. + 6H2O) If 1.00 mole of NH, 1.00 mole of O,…

A: The chemical reaction is 4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g) Given that, The volume of container = 4…

Q: The equilibrium constant, Ko, for the following reaction is 9.52×10-2 at 350 K. CH4 (g) + CC14 (g)…

Q: At a certain temperature, 0.317 mol CH, and 0.834 mol H,O is placed in a 3.00 L container. CH, (g) +…

Q: = 2 S03 (g) came to equilibrium, the concentration of reactants and products were as follows: [SO3]…

Q: H2 + Cl2 à HCl for which the equilibrium constant K = 320 at 150 C. Suppose 0.400 mol of H2…

Q: At 25 °C, K. = 1.6 x 10-34 for the reaction 2HCI(g) + I2(s) - 2HI(g) + Cl2(g) Suppose 0.100 mol of…

A: Given,

Q: Be sure to answer all parts. The equilibrium constant Kc for the reaction 2NH3(g) = N2(g) + 3H2(g)…

Q: b. the system is at equilibrium, and dichlorine (Cl2) is added to the reaction (no change in…

Q: What is the K, equilibrium-constant expression for the following equilibrium? Sro(s) + H₂(g) = Sr(s)…

A: Kc is the ratio of the equilibrium concentrations of product over equilibrium concentrations of…

Q: At a certain temperature, 0.347 mol CH, and 0.619 mol H,S are placed in a 2.50 L container. CH,(g) +…

A: Given equilibrium reaction is CH4 (g) + 2 H2S (g)…

Q: A sample of ammonia gas was allowed to come to equilibrium at 400 K. 2NH3(g) --------> N2(g) +…

A: To determine the equilibrium constant for the reaction: 2NH3(g) --------> N2(g) + 3H2(g) Given…

Q: At a particular temperature, K = 7.0 x 10-6 for the reaction 2 CO₂ (g) 2 CO(g) + O₂(g) If 4.5 moles…

A: Since,Equilibrium constant or Kc is the ratio of the equilibrium concentrations of product over…

Q: for the reaction 2IBr -- I2(g) + Br2, Kc=.026. Consider that the starting composition is .010 mol…

A: The objective of the question is to find the moles of all species present at equilibrium for the…

Q: H2+ F2 > HF for which the equilibrium constant K = 172 at 100 C. Suppose 0.300 mol of H2 and 0.600…

Q: 5. Consider this equilibrium 4HCl(g) + O₂(g) 2H₂O(g) + 2Cl2(g) The equilibrium law expression for…

A: The above questions can be solved as follows

Question

What is the equilibrium constant expression for
3Cl2(g) + NH3(g) = NC13(g) + 3HCI(g)?
[NH, ][Cl,]
[NCI, [HCI]
(B) K¸ = NCI, ][HCI]
[NH,][Cl,]
(А) К, 3
(В) К.
[NH,][Cl,]'
[NCI, ][HCI}
[NCI, ][HCI}
[NH, ][Cl,J'
(С) К.
(D) K.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Chemical Equilibrium
Help me plsss.. *For the reaction N2(g) + O2(g) ↔ 2 NO(g), Kc = 4.080×10–4 at 2000 K. What is the equilibrium concentration of N2 and O2, for the reaction 2 NO(g) ↔ N2(g) + O2(g) if the initial concentration of NO is 0.1000 M? *Following the problem above, what is the equilibrium constant of the reverse reaction used? *Following the problem above, if the reaction is reduced to decomposition of 1 mole NO, what is the value of the equilibrium constant?
please don't provide handwrittin solution....
13) The reaction of bromine gas with chlorine gas, shown below, has a Kc of 1.45 at 230 oC. If a closed vessel was charged with 0.500 M BrCl, what would be the equilibrium concentration (M) of BrCl(g)? Br2(g) + Cl2(g) ó 2 BrCl a) 0.344b) 0.156c) 0.226d) 0.188e) 0.425f) 0.0122
II. For each of the following reactions, write the equilibrium constant (k) expression. 01. 02. 03. 04. 05. CO2 Pb,0. (s) CH, Ag.O (s) HCI + co PbO (s) CS2 Ag (s) Cl, O2 O2 H2 H;S O2 H,O + + + + +
Consider the reaction: S(s) + O2(g); SO2(g) Write the equilibrium constant for this reaction in terms of the equilibrium constants, Ką and K,, for reactions a and b below: а.) 2 S(8) + 3 О2(g) 2 SO3(g) Ka b.) SO2(g) + 1/2 02(g) SO3(g) K, K =
Which is the correct equilibrium constant expression for the following reaction? NiO(aq) + H2(g) Ni(l) + H2O(g) a) Kc = [H2]/[H2O] b) Kc = [NiO] [H2]/[Ni][H2O] c) Kc = [H2O]/[H2][NiO] d) Kc = [Ni][H2O]/[NiO] [H2] e) Kc = [Ni] [H2O]/[H2]
a Choose the equilibrium expression for the following heterogeneous equilibrium: Cag N2 (s) +6H, 0(1) = 3Ca(OH)2 (8) + 2NH, (g) OK= [NH," [Ca(OH),) K = [Ca, N2] NH, [Ca(OH), [Ca,N2][H,O]° [NH,] K = 16 券 K= [H, O]° b Choose the equilibrium expression for the following heterogeneous equilibrium: 4Fe(s) +302(g) 2Fe, O3 (s) 1. K = OK= [0,1'[Fe(s)] Fe, Os = [0,] OK- K 3. 1. [02]
At equilibrium, the concentrations of reactants and products can be predicted using the equilibrium constant, Kc, which is a mathematical expression based on the chemical equation. For example, in the reaction aA+bB⇌cC+dD where a, b, c, & d are the stoichiometric coefficients, the equilibrium constant is Kc=[C]c[D]d[A]a[B]b & where [A][A], [B][B], [C][C], and [D][D] are the equilibrium concentrations. If the reaction is not at equilibrium, the quantity can still be calculated, but it is called the reaction quotient, Qc, instead of the equilibrium constant, Kc.Qc=[C]tc[D]td[A]ta[B]tb where each concentration is measured at some arbitrary time t. Part A A mixture initially contains AA, BB, and CC in the following concentrations: [A]= 0.700 M, [B]= 1.40 M, & [C]= 0.550 M. The following reaction occurs and equilibrium is established: A+2B⇌CA+2B⇌C At equilibrium, [A]= 0.520 M & [C]= 0.730 M. Calculate the value of the equilibrium constant, Kc.
Kk.49.
Express the equilibrium constant for this reaction: 2 NH3(g) <=> N2(g) + 3 H2(g) K = [NH3]2 / ([NH3]2 x [N2]) K = ([NH3]2 x [N2]) / [H2]3 K = ([N2] x [H2]3) / [NH3]2
O KINETICS AND EQUILIBRIUM Helen v Using the small x approximation to solve equilibrium problems A chemist is studying the following equilibirum, which has the given equilibrium constant at a certain temperature: 3 O2(g) = 203(g) K,= 1. x 10-6 d. He fills a reaction vessel at this temperature with 15. atm of oxygen gas. Use this data to answer the questions in the table below. olo Can you predict the equilibrium pressure of O3, using only the tools O yes available to you within ALEKS? O no If you said yes, then enter the equilibrium pressure of O, at right. I atm Round your answer to 1 significant digit. Explanation Check II