What is the coordination number of the Fe? 4 What is the oxidation number of the Fe? +3 tetrahedral What is the shape of the complex? (Use the table to see what type of complexes Fe usualy forms.) Sketch the complex: CI 1 Br-Fe-Br 117 1 CI Try to construct a geometric isomer of the complex. Then try to superimpose the complex that you just made on the original. If the two are different, draw each complex and label each as cis- and trans- respectively. If they superimpose, write the word "superimposeable" in the space below. Construct a model of the mirror image of each of the geometric isomers sketched in the space above or of the single complex if geometric isomers do not exist. Sketch the appropriate mirror images.

What is the coordination number of the Fe? 4 What is the oxidation number of the Fe? +3 tetrahedral What is the shape of the complex? (Use the table to see what type of complexes Fe usualy forms.) Sketch the complex: CI 1 Br-Fe-Br 117 1 CI Try to construct a geometric isomer of the complex. Then try to superimpose the complex that you just made on the original. If the two are different, draw each complex and label each as cis- and trans- respectively. If they superimpose, write the word "superimposeable" in the space below. Construct a model of the mirror image of each of the geometric isomers sketched in the space above or of the single complex if geometric isomers do not exist. Sketch the appropriate mirror images.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 117QRT

See similar textbooks

Similar questions

A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen