What is the conjugate base of boric acid, B(OH)3?             (A) OH–            (B) B(OH)4–                              (C) B(O)(OH)22–                       (D) B(H2O)(OH)2+

Q: Which is the stronger acid, NH4+ or HBrO?

A:

Q: Write the formula of the conjugate base of CH3CO2H

A: Conjugate base of an acid contains one less proton.

Q: What is the pH of [H30+]= 2.4 * 10 3 M?

A: Given :- [H3O+] = 2.4 x 10-3 M  To calculate :- pH of solution   pH = -log[H3O+]

Q: Write the formula of the conjugate base of C6H5NH2.

A: The conugate base is formed by removing one H+ ion from any molecule.

Q: Write the formula of the conjugate acid of CH3CO2H

A: We have to tell the conjugate acid of CH3COOH

Q: 1) Calculate the pH (aq., 25 °C) of a 0.073 M Novocaine (C13H21O2N2CI) solution, which is the salt…

A: Solving only first question in accordance with guidelines. We will first draw ICE table and then…

Q: What is the pH of a 0.21 M solution of methylamine (CH3NH2, Kb = 4.4 x 10–4) at 25 degrees C?

A:

Q: What is the pH of a 0.0730 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A: Given :- concentration of methylamine solution  = 0.0730 M  Kb for methylamine = 4.4 × 10-4  To…

Q: If pH is equal to 3.92, what are the values of H+, poH, and OH-?

A:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: Calculate the pH of 1M solution of acedic acid (pKa = 4.76)?

A: The pH of the acetic acid solution can be calculated using the formula shown in belowpKa =…

Q: What is the pH of (a) a 0.028 M solution of NaOH, (b) a 0.0011 M solution of Ca1OH22?

A: What is the pH of (a) a 0.028 M solution of NaOH, (b) a 0.0011 M solution of Ca(OH)2?

Q: Arrange the following in order of INCREASING acidity. I. II. III. IV. ... ÇI CI HO HO HO HO

A: Given question of mainly phenol group.    We have difine a increasing acidic order.    Attached a…

Q: Define concept of Acid Strength and pKa ?

A: Acid strength means the tendency of acid to dissociate into H+ and anion. The dissociation of strong…

Q: 2. The pH of a lime is 1.90. What is the [H3O*]?

A: pH is negative log of Proton concentration.

Q: What is the conjugate base of formic acid, HCO2H?

A:

Q: What is the pH of a 0.150 M solution of acetic acid (pKa=4.75) at 25 degree celsius?

A: Given, the concentration of acetic acid =0.150 Mand pKa of acetic acid =4.75 at 25 °Cwe are asked to…

Q: 5. Which of the following are expected to act as a Lewis acid? Why? d. Et,O а. ВНз b. EtОH e. NH,+…

A: A Lewis acid is therefore any substance,  that can accept a pair of nonbonding electrons. In other…

Q: What are the pH, pOH and [H3O+] for a 2.37x 10–2 M HClO4 solution? HClO4 is a strong mineral acid.

A:

Q: The balanced molecular equation for complete neutralization of H 2SO 4 by KOH in aqueous solution is

A: When an acid reacts with a base it produces salt and water. Such reactions are known as acid-base…

Q: The pH of a lime is 1.90. What is the [H3O+]? What is the [-OH]?

A: Since the relationship between pH and  [H3O+] is  pH = -log[H3O+] and the relationship between pH…

Q: Write the formula of the conjugate acid of CH₃CO₂⁻

A: A chemical compound formed by the reception of a proton by a base is known as a conjugate acid.  In…

Q: Place the following acids in order of increasing strength: -H​3P​O​4,​ H3P​O​2​ and H3P​O​3.​…

A: We have to explain the acidity order: -H​3P​O​4,​ H3P​O​2​ and H3PO3.

Q: 1. Methanoic acid, HCO,H, also known as formic acid, is partly responsible for the characteristic…

A:

Q: Predict the products of the following acid-base reaction. Identify and label the conjugate acid /…

A: Complete the given reaction and identify acid-base pairs ----

Q: What is the pH of a 0.0930 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A:

Q: what is the formula of the conjugate acid of SO32-

A: Given species: SO32- We have to write the formula of the conjugate acid of SO32-.

Q: What is the pH of a 0.0310 M solution of hydrocyanic acid, HCN (Ka = 4.9 x 10-10)?

A: Answer:- This question is answered by using the simple concept of calculation of pH of weak acid…

Q: What is the pH of a 0.0360 M solution of hydrocyanic acid, HCN (Ka = 4.9 x 10-10)?

A:

Q: What is the pH of a 0.0270 M solution of hydrocyanic acid, HCN (Ka = 4.9 × 10¬1º)?

A: Here, hydrocyanic acid is weak acid as compared to mineral acids , thus when it ionized it will form…

Q: What is the pH of wine that has an H 3O + concentration of 3.2 × 10 −4 M?

A: The pH scale is used to measure the acidity and basicity of aqueous solutions. pH is the negative…

Q: Write the formula of the conjugate base of C6HSNH2.

A: A base after accepting proton forms a conjugate acid.  An acid after donating proton forms a…

Q: What is the pH of a 0.40 M solution of benzoic acid, C6H5COOH?

A: Given information: Concentration of benzoic acid = 0.40 M

Q: Write the formula of the conjugate acid of the Brønsted-Lowry base, C₄H₃N₂O₃⁻ ?

A: If we add H+ in base then it will convert into conjugate acid   C₄H₃N₂O₃⁻ +H+= C4H4N2O3

Q: Based on the pH measured for the solution of (NH4)2CO3, is NH4+ is a stronger acid or is CO2−3…

A: Given: To determine whether (NH4)2CO3  is strong acid or strong base.   Definition: (NH4)2CO3 is…

Q: What is the conjugate acid for H_2SO_3(aq)?

A: The pair of acid and base differing from each other by just one proton is called conjugate acid-base…

Q: What is the conjugate acid of potassium hydrogen phosphate, K2HPO4?

A: K2HPO4 is a base. Its conjugate acid can be obtained by adding a hydrogen atom to it. The net ionic…

Q: Give the formula of the conjugate acide of H2O ?

A: Conjugate acid, according to Bronsted-Lowry-acid-base theory, is chemical compound that is formed…

Q: If pH = 5.7, what is [OH ] ?

A: Given a PH = 5.7  Calculate the [OH-] concentration.    calculate the [OH-] of first of calculate…

Q: The hydroxide ion concentration, [OH*], of an aqueous solution of 0.591 M trimethylamine (a weak…

A: Trimethylamine dissolved in H2O and since it is a weak base so it dissociates partially as follows

Q: What is the pH of a 0.0680 M solution of hydrocyanic acid, HCN (Ка %3D 4.9 х 10-10)?

A:

Q: Fill in the left side of this equilibrium constant equation for the reaction of diethylmethylamine…

A:

Q: In the following reaction, identify the Lewis acid. Co** (ag) + 6NH3 (ag) - Co(NH3),**(aq)

A: Lewis acid is an electron-pair acceptor. That is Lewis acid is any substance which can accept a pair…

Q: What is the pH of a 0.500 M solution of trimethylamine (pKb = 4.13)?

A:

Q: Identify the conjugate acid of SO 4 2–.

A: In this question we have tell the conjugate acid of the given SO42-

Q: Which of the following is the stronger Brønsted–Lowry acid, HClO3 or HClO2?

A: Any chemical species able to gain (receive) a proton (H+) ion from another species gets referred as…

Q: The [H3O+] of Coca-Cola Classic ® is 3.2 x 10-3. What is its pH? Is it acidic or basic?

A: The pH of the given solution can be defined as the measure of its basicity or the acidity. It is…

Q: What is the pH of a 0.975 M solution of acetic acid, HC2H3O2?

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.