Answered: THE ZnCl2 / HCl TEST DETERMINES THE…

THE ZnCl2 / HCl TEST DETERMINES THE REACTIVITY OF ALCOHOLS. ORDER IN ORDER FROM GREATEST TO LOWEST REACTIVITY METHANOL-TERBUTANOL-2PROPANOL TERBUTANOL-METHANOL-METHANOL METHANOL-2 PROPANOL-TERBUTANOL

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter10: Alcohols

Section: Chapter Questions

Problem 10.16P

See similar textbooks

Related questions

Q: Arrange the following sets of organic compounds according to increasing solubility in water I.…

A: If the aliphatic carbon chain length of alcohol is longer then the solubility in water like polar…

Q: he reason for its appearance in the molecule? Show the effect of the inductive effect in molecules:…

A: When there is unequal sharing of bonding electron between a covalent molecule then a permanent…

Q: Predict which member of each group is most soluble in water, and explain the reasons for your…

A: Solubility is defined as the amount of solute that is dissolved in a given amount of solvent.…

Q: Describe an experiment you will carry out and the result that you will expect to distinguish between…

A: Introduction: Ethanol, bromoethane and ethanal are organic compounds. All the compounds can be…

Q: Describe a simple CHEMICAL test to distinguish between: Methanoic acid (HCO2H) and Ethanoic acid…

Q: The reaction of a ketone with an alcohol in acidic conditions will result in: an alkane an…

A: When ketones react with alcohols in the acidic conditions they result in the formation of acetals.

Q: 1. Draw structural formulas for 1-bromobutane, 2-bromobutane, 2-bromo-2- methylpropane,…

A: Structural formulas:

Q: All of the following alcohols can be classified as secondary alcohols EXCEPT: 2-methyl…

Q: Predict which member of each group is most soluble in water, and explain the reasons for your…

A: Solubility is a physical property of matter and is the ability of a substance or solute to be…

Q: 1. List the letters that correspond to the functional groups that each compound contains. The…

A: Functional group imparts the chemical properties to the compound.

Q: Choose one test that can be applied on hydroxybenzene and heptane; cyclohexane and cyclohexene.

A: Given compounds : 1.Hydroxy benzene and heptane : In hydroxy benzene -OH group is present and…

Q: 2. Draw out the following alcohols and choose the tertiary alcohol with 7 carbons. A.…

Q: 16 Is this a primary, secondary, or tertiary alcohol? H3C OH H3C CH3 O Primary Secondary Tertiary

A: Alcohols are organic molecules containing a hydroxyl functional group connected to an alkyl or aryl…

Q: Is this a primary, secondary, or tertiary alcohol? H3C H3C H3C OH

Q: 2 chlorobutane +sodium hydroxide = alcohol

Q: NaNH2 H3C-OH methanol NANH2 CHạCH-OH ethanol NANH2 cyclobutanol

A: Note: According to our guidelines we are supposed to answer only first three subparts. Kindly repost…

Q: Complete the following equations, write structures for reactant and product 1) Lucas + methanol 2)…

A: Since your question has multiple sub-parts, we will answer the first three sub-parts for you. If you…

Q: Water can dissolve in alcohol (CH3CH2OH). Group of answer choices True False

A: To solve this problem we have to know about mixing of alcohol and water .

Q: Write TRUE if the underlined word/phrase makes the statement correct. Otherwise, write the correct…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first 3 sub-parts of…

Q: Which member of each of the following would you expect to be more soluble in water? Briefly explain…

Q: Using the relationship between the structure and the boiling point. Obtain a table for the listed…

A: Boiling point is “the temperature at which a substance changes its state from liquid state to vapour…

Q: Design syntheses to produce the following compounds starting with any alcohol with 3 or less carbons…

A: We have to design the synthesis for the following given compounds starting with any alcohol with 3…

Q: Which of the following alcohols is least likely to be soluble in water? 3-pentanol 2-butanol…

Q: Write structural formulas for each of the following alcohols and alkyl halides: (C) 3-Heptanol (d)…

Q: I. Structural Analysis of Alcohols, Phenols and Ethers Consider the following table shown below are…

A: Since you have posted multiple questions, we will solve only first question for you. If you want any…

Q: Why would concentrated HBr be an inappropriate catalyst for the dehydration of alcohols?

A: Alcohols upon dehydration to give alkenes It is an example for elimination reactions Generally…

Q: Mixing cyclohexanol with phosphoric acid is an exothermic process, whereas the production of…

Q: It was determined that benzoic acid (structure below) is not soluble in water. However, it can be…

A: We have to predict the substance for increasing solubility.

Q: Drinking of too much alcohol cause liver cirrhosis because ethanol is converted to toxic Acetone…

A: Drinking of too much alcohol cause liver cirrhosis because ethanol is oxidized into the liver and…

Q: Determine if the given alcohols are positive for the Lucas Test or not. Ethanol - Butanol…

A: The given alcohols can give positive Lucas test or not it is to be determined. The Lucas test is…

Q: Name the following alcohol. O2-Bromo-4-ethylcyclopentanol 4-Ethyl-2-bromocyclopentanol…

A: Name of the alcohol is given below.

Q: Choose one test that can be applied on isopropyl alcohol and tert-butyl alcohol; methylamine and…

A: Solubility test :- It is the common or preliminary test for any compound in their suitable…

Q: s this a primary, secondary, or tertiary alcohol? ОН H3C CH O Primary Secondary O Tertiary

Q: 2. Arrange the following compounds in order of decreasing boiling point: (a) 3- hexanol; (b)…

A: Boiling point is directly proportional to H-bonding. Less hindered alcohol will more boiling point…

Q: Design syntheses to produce the following compounds starting with any alcohol with 3 or less carbons…

A: We have to design the synthesis for the following given compounds with any alcohol with 3 or less…

Q: Description Solubility in water (+/-) Sample Skeletal Structure (i.e., physical state, odor, clarity…

A: There is a concept that 'like dissolves like'. Water being a polar molecule , thus more polar…

Q: 4. Which of the following has a higher boiling point? Explain your answer: (a) 2-propanol or…

A: Hydrogen bonding can increases boiling point.

Q: Arrange the compounds of each group in order of increasing boiling point. a. 1-butanol, 1-pentanol,…

A: Alcohols have higher boiling points than alkanes due to the possibility of hydrogen bonding…

Q: 1. Classify the alcohols as primary, secondary, or tertiary. LOH `OH (A) (В) 2. Provide IUPAC names…

A: 1. carbon is attached to one carbon it is called primary carbon, carbon is attached two carbons it…

Q: Predict the water solubility of each compound: (a) KCl; (b) methanol (CH 3OH); (c) hexane (C 6H 14).

A: Solubility: It is the property of any chemical substance to get dissolved or miscible in any…

Q: Which of the following three solute/solvent pairs are insoluble? Choose one or more: O…

Q: Which of these compounds is a properly named 2° alcohol? a) 1,3-Propandiol но он b)…

Q: 1. Ethoxy hexane 2. Heptyl alcohol 3. Ethoxybutane CH3-CH2-CH-CH2-CH2-CH-CH₂-CH2-CH3 1 OH CH 3 1 | 1…

A: Rule of IUPAC-1) Longest chain as parent chain.2) Numbering start from those side where more prior…

Q: Give the structural formula of the ff: 1. n-hexane 2. n- butyl alcohol 3. sec- butyl alcohol 4.…

Q: Draw structural formulas for organic products A and B in the window below. Br CH₂CH₂CCH3 CH3 Mg…

Q: Name the functional group present in the following molecule: C2H5COCH3…

A: In organic chemistry, a functional group is a specific group of atoms or bonds within a compound…

Q: Give IUPAC names of the following compounds and identify the alcohols as primary, secondary or…

A: The IUPAC name of the compound can be written on the basis of the main carbon chain, functional…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH

A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…

Q: Suggest a simple chemical test that will differentiate between the following pairs of compounds.…

A: Since you have posted a question with multiple sub-parts ,we will solve first three sub-parts for…

Q: The reaction of a certain alcohol with HBr yields a mixture of alkyl bromides. Consider the…

A: Reaction of alcohol with HBr proceeds through the carbocation intermediate. The carbocation formed…

Question

THE ZnCl2 / HCl TEST DETERMINES THE REACTIVITY OF ALCOHOLS. ORDER IN ORDER FROM GREATEST TO LOWEST REACTIVITY

METHANOL-TERBUTANOL-2PROPANOL

TERBUTANOL-METHANOL-METHANOL

METHANOL-2 PROPANOL-TERBUTANOL

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Using the relationship between the structure and the boiling point. Obtain a table for the listed chemicals below showing how the boiling point will be different with (1) the different chemical structures, (2) with different functional groups. Boiling Point and Functionalized Compounds: Chemical: Cyclohexanol Cyclohexanone Cyclohexene Benzaldehyde Benzyl alcohol
Drinking of too much alcohol cause liver cirrhosis because ethanol is converted to toxic * Acetone Ethanal Acetic acid Methyl ethanoate Ethers have lower boiling points compared to alcohols of comparable mass because they form dipole-dipole interaction among themselves. they cannot form hydrogen bond among themselves. they can form hydrogen bond with water. they are solvents in organic reactions. Dehydration of two molecules of methanol under acidic condition (H2SO4) at high temperature will produce * Acetone Ethanal Acetic acid Methoxymethane
What functional group distinguishes each of the following hydrocarbon derivatives? a. halohydrocarbons b. alcohols c. ethers d. aldehydes e. ketones f. carboxylic acids g. esters h. amines Give examples of each functional group. What prefix or suffix is used to name each functional group? What are the bond angles in each? Describe the bonding in each functional group. What is the difference between a primary, secondary, and tertiary alcohol? For the functional groups in ah, when is a number required to indicate the position of the functional group? Carboxylic acids are often written as RCOOH. What does COOH indicate and what does R indicate? Aldehydes are sometimes written as RCHO. What does CHO indicate?
Which of the following reactions can be used to make the following alcohol? OH 1. LIAIH4, ether 2. H30* 1. OsO4 2. NaHSO3, H20 1. CH3CH2MgBr, ether H. 2. H3O*, H2O 1. Hg(OAc)2, H2O/THF 2. NABH4 MacBook Pro
Phenols are aromatic rings with an alcohol functional group attached directly to the ring. These compounds have unique acidity and solubility for alcohol groups. Predict the solubility of this phenol in water.
1. Write the skeletal structures of propanal, acetone and cyclohexanone. What is the major intermolecular force (IMF) found in them? Based on their major intermolecular force and molecular weight, what can you predict on their solubility in water? Chemical Name Skeletal Structures Major IMF Solubility in water Propanal Acetone Cyclohexanone 2. What is the purpose of Tollens’ test (Part B)? What is the evidence of a positive result? 3. What is the purpose of oxidation test (Part C)? What is the evidence of a positive result?
Which is NOT a physical property of alcohols or phenols? O Phenols are generally only slightly soluble in water. O The hydroxyl group of an alcohol is nonpolar. The solubilities of normal primary alcohols in water decrease with increasing molecular weight. Boiling points of normal primary alcohols increase with increasing molecular weight.
Suggest a simple chemical test that will differentiate between the following pairs of compounds. Write equations for the reactions involved. ▪ phenol and isopentyl alcohol ▪ tert-butyl alcohol and isobutyl alcohol ▪ neopentyl alcohol and ether ▪ sec-butyl alcohol and neopentyl alcohol ▪ propene and 2-butanol
Mixing cyclohexanol with phosphoric acid is an exothermic process, whereas the production of cyclohexene is endothermic. Construct an energy diagram showing the course of this reaction. Label the diagram with the starting alcohol, the oxonium ion (the protonated alcohol), the carbocation, and the product.
Predict which member of each group is most soluble in water, and explain the reasons for your predictions. phenol, cyclohexanol, or 4-methylcyclohexanol
Predict which member of each group is most soluble in water, and explain the reasons for your predictions.chlorocyclohexane, cyclohexanol, or cyclohexane-1,2-diol
Stingless bees use complex systems to communicate. One aspect of this communication is chemical: the bees produce 2-nonanol, 2-heptanol, and 2-undecanol in their mouthparts (mandibles) to direct other bees to pollen sources. Draw the condensed structure of each of these alcohols. Classify each as a primary, secondary, or tertiary alcohol.