The number of possible E/Z isomers of 2,5,8-decatriene is 4 Que Multip

Assign E or Z configuration to the following alkenes: CH, H Co,H HN- NC. H. CH;OH H,NH,C CH3 A B A = E B = E, Z A = Z B = E, E A = E B = E A = Z B = E, Z A =Z B = E

For the substituted cyclohexane compound shown, identify the atoms that are trans to the bromo substituent. I CH3 Br HD HCI- HA HB НОЕ K ČI HG Identify the atoms that are trans to the bromine. A В C D E F G H K

Please help with the substituent

estion 12 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: 0 CH2-0-C-(CH2)16-CH3 о о O= = = CH-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 13 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: CH₂-01 CH-O ང CH₂-01 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 14 of 33 Draw the skeletal ("line") structure of the triacylglycerol that could be formed from lauric acid.

Please help with row 1, highlighted:

Assign the following alkene molecules as being cis or trans, E or Z isomers.

Give the systematic (IUPAC) name for the following compounds. Include stereochemistry in the name ONLY FOR THOSE STRUCTURES THAT ALLOW YOU TO DETERMINE STEREOCHEMISTRY. In other words, describe the stereochemistry if the molecule is shown as a Fisher projection, or as a perspective formula, or if an alkene is drawn with the correct stereochemistry representation

Name the following molecule: 7-methyloctan-4-one O 2-methyloctan-5-one O 6-isopropylhexan-4-one 7-methyloctanone O 1,1-dimethylheptan-4-one