**Redox Reaction Balancing under Basic Conditions****Instructions:** Enter electrons as e⁻.**Problem Statement:** The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced **REDUCTION** half reaction.Chemical Equation:\[ \text{N}_2\text{H}_4 + \text{Zn(OH)}_2 \rightarrow \text{Zn} + \text{N}_2 \]Diagram:- **Reactants Box:** Indicates where reactants are listed.- **Arrow:** Indicates the reaction process.- **Products Box:** Indicates where products are listed.This exercise involves balancing the reduction half-reaction of the given redox process.

Reduction refers to the addition of electrons.

Answered: The following skeletal…

The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. N2H4 + Zn(OH)2-¬Zn + N2 Reactants Products

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: What is the balanced oxidation half-reaction and reduction half-reaction in the following reaction…

A: A half reaction can be oxidation or reduction reaction and both the reaction takes place…

Q: Balance the following net ionic equation and write the sum of the coefficients of the reactants and…

A: Skeleton unbalanced reaction: For balancing this redox reaction, we 1st need to determine the…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Write the balanced REDUCTION half reaction. MnO4- + Mg → Mg2+ + Mn2+ The oxidation-reduction…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

Q: alance the following reaction in basic solution. Ag(s) + Zn²+(aq) → Ag,O(aq) + Zn(s) ill in the…

A: Recall the reaction Ag(s) + zn2+(aq) --> Ag2O(aq) + Zn(s)

Q: Enter electrons as e. The following skeletal oxidation-reduction reaction occurs under acidic…

A: We have to predict the oxidation half reaction .

Q: redox

Q: Complete and balance the following redox reaction in basic solution. Be sure to include the proper…

A: The given redox reaction is as follows: A redox reaction is balanced by balancing the mass and…

Q: AsO,3 + I2 → AsO,3 + I (basic) Cr + CIO, → CrO2 + CIO;- (basic)

A: A reaction is said to be balanced when the number of atoms of each element on the reactant side is…

Q: Classify the half-reactions as reduction half-reactions or oxidation half-reactions. H, (g) – 2…

Q: Study this chemical reaction: 2 Cr+0₂ Then, write balanced half-reactions describing the oxidation…

A: Oxidation : oxidation is the reaction in which electron are lost. Reduction : reduction is the…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The redox reaction is given as follows: Fe+Zn2+------------>Zn+Fe2+

Q: Balance the following reaction in basic solution. Ag(s) + Zn²+ (aq) → Ag₂O(aq) + Zn(s) Fill in the…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: In the given cell reaction, the oxidation state of sulfur in sulfate ion is +6 and the oxidation…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

Q: Complete and balance the following half-reactions. In each case, indicate whether the half-reaction…

A: In basic solutions, the base dissociates to form OH- ions, so OH- ions are needed for balancing the…

Q: Balance the following reaction in acidic solution. 3+ Cr20, (aq) + HNO2(aq) → Cr" (ag) + NO, (aq)…

A: We have to balance the given reaction in acidic medium.

Q: Given the reaction: 2Fe(s) + 3C12(g) --> 2FEC13(s) Write the half reaction showing reduction.

A: Reduction is the process of gain of electron. And oxidation is the process of loss of electron. To…

Q: Ca + HBr Oxidation Reduction

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Redox reaction : Chemical reactions involving both oxidation and reduction processes.Oxidation:…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Answer

Q: 63. In this reaction, which substance behaves as the oxidizing agent? Pb + PbO₂ + 2H₂SO4 → 2PbSO4 +…

A: Oxidising agent: Substance which oxidises other substances but itself get reduced. Oxidising agent:…

Q: Enter electrons as e. The following skeletal oxidation-reduction reaction occurs under basic…

A: Balanced oxidation half reaction: S2- → S + 2e- Reactant…

Q: Balance the following aqueous reactions. Determine the oxidation states of the ions that have…

A: The molecular equation is : H3PO3 + HgCl2 = H3PO4 + Hg2Cl2 The oxidation number of P in H3PO3 and…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: The electrons' gain-loss reactions are identified by their special names that are togetherly…

Q: A sample of a new cleaning product, "Joe's Famous Bleach Cleaner," with a mass of 61.0 g, was…

A: Bleach contains the active ingredient NaClO. Analysis of bleach involves two sequential…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: Balance the following reactions in an acidic solution. Identify the oxidizing and the reducing agent…

A: The full solutions are shown below: Reaction 3Oxidizing Agent: NO3-Reducing Agent: As2O3 Reaction…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The reaction given is

Q: Enter electrons as The following skeletal oxidation-reduction reaction occurs under basic…

A: In a redox reaction, both oxidation and reduction processes take place simultaneously. There are two…

Q: A solution of Mno is electrolytically reduced to Mn3+. A current of 7.79 A is passed through the…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: First balance the atoms other than O and H. Then balance the oxidation number. Balance charge by OH-…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Reduction is the process of gain of electrons while oxidation is the process of loss of electrons.…

Q: Balance the following reaction in acidic solution. Cr₂O² (aq) + HNO₂ (aq) → → Cr³+ (aq) + NO3(aq)…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The given redox reaction is as follows, The above reaction contains both oxidation and reduction…

Q: balanced REDUCTION half reaction. SO3²- + P→→PH3 + 2- →PH3 2- + SO4²-

Q: Indicate whether the balanced equation involves oxidation–reduction. If they do, identify the…

A: The reaction given is 3 SO2 (g) + 2 HNO3 (aq) + 2 H2O (l) -> 3 H2SO4 (aq) + 2 NO (g)

Q: For a particular redox reaction, NO₂ is oxidized to NO3 and Cu²+ is reduced to Cut. Complete and…

Q: The following skeletal CIO₂ + Fe³+ oxidation-reduction reaction occurs under acidic conditions. →…

A: A redox reaction is balanced by balancing the mass and charge. Hence the number of atoms of all the…

Q: Cl2{g) + 2 F¯ (aq) F2(g) + 2 CI (aq) i. Write the reduction half-reaction. ii. Write the oxidation…

A: The given reaction is :- Cl2(g) + 2F-(aq) ⇔ F2(g) + 2Cl-(aq)

Q: Is Zn+2AgNO3>>>Zn(NO3)2+2Ag an oxidation-reduction reaction? If so, what is oxidized and what is…

Q: Which of the following is an oxidation-reduction reaction? PbCO3(s) + 2HNO3(aq) → Pb(NO3)2(aq) +…

A: The question is based on the concept of redox reactions. Redox Reactions are the one in which…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The following skeletal oxidation-reduction reaction occurs under acidic conditions. The balanced…

Q: Write balanced half-reactions for the following redox reaction: 12 Cu( reduction: oxidation:…

A: Oxidation:Loss of electrons or increase in magnitude of potive oxidation state or decrease in the…

Q: Enter electrons as e-. The following skeletal oxidation-reduction reaction occurs under basic…

Question

**Redox Reaction Balancing under Basic Conditions**

**Instructions:** Enter electrons as e⁻.

**Problem Statement:** The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced **REDUCTION** half reaction.

Chemical Equation:
\[ \text{N}_2\text{H}_4 + \text{Zn(OH)}_2 \rightarrow \text{Zn} + \text{N}_2 \]

Diagram:
- **Reactants Box:** Indicates where reactants are listed.
- **Arrow:** Indicates the reaction process.
- **Products Box:** Indicates where products are listed.

This exercise involves balancing the reduction half-reaction of the given redox process.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

consider the reaction of rubidium metal with water to form aqueous rubidium hydroxide and hydrogen gas 2rb(s)+2h2o(l)->2rboh(aq) assign the oxidation state for each reaction
Consider the reaction below. Is this an oxidation-reduction? What information are you using to determine if this is an oxidation-reduction reaction.2 H2 (g) + O2 (g) à 2 H2O (l)
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced OXIDATION half reaction. BrO3 + CICIO3¯ + Br Reactants Enter electrons as e Products
2
The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. N2H4 + NiO2- →N2 + Ni(OH)2 Reactants Products
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced OXIDATION half reaction. So,- + NO- →SO2 + HNO3 Reactants Products
In the following reaction, what species is undergoing reduction (being reduced)?: Ca + Br2 --> CaBr2 Са Br2 O This not an oxidation-reduction reaction
The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced OXIDATION half reaction. S2O32- + Bi(OH)3Bi + SO32- Reactants Products
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced REDUCTION half reaction. Fe + SO4²- SO₂ + Fe²+ Enter electrons as e. Reactants Products
Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy AGO for the following redox reaction. Be sure your answer has the correct number of significant digits. 2 MnO₂ (s) + 80H(aq) + 3Cl₂ (g) → 2 MnO4 (aq) + 4H₂O(1) +6Cl¯¯ (aq) 2 kJ x10 X S ? olo Ar
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced OXIDATION half reaction. Al3+ + NiAl + Ni2+ Reactants -> Products
consider the reaction of Rubidium metal with water to form aqueous rubidium hydroxide and hydrogen gas 2Rb(s)+2H2O(l)->2RbOH(aq) assign the oxidation state for each reaction