The electrogravimetric method by controlling the cathode potential is used for the separation of ions in a solution buffered to 0.100 M and pH 1.5 in terms of both Bi3+ and Sn2+. Find the concentration of the more easily reduced species as soon as the more difficult to reduce species begins to decompose. Sn2+ + 2 e- ↔ Sn (k)             E0 = - 0,136 V BiO+ +  2 H+ + 3 e- ↔ Bi (k) E0 = 0,320 V

Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.

Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)

What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?

An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?

Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)

The formation constant for the mercury(II) acetate complex is Hg2++ 2OAc- Hg(OAc)2(aq) Kf = 2.7 108 Calculate the standard potential for the half-reaction Hg(OAc)2(aq) + 2e- Hg(l) + 2OAc-

A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.

An electrochemical cell consists of a silver metal electrode immersed in a solution with [Ag+] = 1.0 M separated by a porous disk from a copper metal electrode. If the copper electrode is placed in a solution of 5.0 M NH3 that is also 0.010 M in Cu(NH3)42+, what is the cell potential at 25C? Cu2+(aq)+4NH3(aq)Cu(NH3)42+(aq)K=1.01013

What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)