The corrosion of aluminum in cookwares is prevented as the aluminum metal reacts with oxygen in the air, producing a protective coat of aluminum. a. write the balance equation for the reaction. b. How many grams of oxygen gas(MM=16.0 g/mol) will react with 25.0 grams of aluminum (MM=26.98 g/mol)? c. How many grams of aluminum oxide(MM=101.96 g/mol) will be produced by the reaction in (b) d. What is the percent yield of the reaction if the actual yield is 36.4 grams.
The corrosion of aluminum in cookwares is prevented as the aluminum metal reacts with oxygen in the air, producing a protective coat of aluminum.
a. write the balance equation for the reaction.
b. How many grams of oxygen gas(MM=16.0 g/mol) will react with 25.0 grams of aluminum (MM=26.98 g/mol)?
c. How many grams of aluminum oxide(MM=101.96 g/mol) will be produced by the reaction in (b)
d. What is the percent yield of the reaction if the actual yield is 36.4 grams.
2. Phosphoric acid (H3PO4) can be prepared from phosphorus trioxide (PI3) according to the reaction: PI3(s)+H2O(I)=H3PO4(AQ)+HI(g)
Balance the equation. If 150 grams of PI3 (MM=411.7 g/mol) is added to 250 milliliters of H2O(MM=18.01 g/mol,p=1.00 g/mol), identify the limiting and excess reagents.How many grams of H3PO4(MM=97.99 g/mol) will be theoretically produced?
Step by step
Solved in 5 steps with 5 images
