The cell potential for a voltaic cell composed of zinc and copper is 1.0 V under standard conditions. Zn(s) + Cu2+(aq) => Cu(S) + Zn2+(aq) What is the cell potential when one of the following deviations from standard conditions are made?  A) [Zn2+] = 0.25 M; [Cu2+] = 0.25 M B)  [Zn2+] = 0.25 M; [Cu2+] = 0.50 M C)  [Zn2+] = 0.75 M; [Cu2+] = 0.75 M

a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.

Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.

For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)

What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?

Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)

A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.

A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?