If a solution known to be made up of an octahedral cobalt complex ion [Co(NH3)6]3+ appears orange to the eye, (a)    What wavelength of light does it absorb from the color wheel? Please explain. (b)    What is the crystal field splitting Δo (10Dq) for the complex ion? Please calculate in kJ.mole-1. (c)   Calculate the crystal field stabilization energy of the complex ion in kcal.mole-1 (Please neglect πe and πc energies when calculating). (Co:27, h=6.626x10-34 J.s, c=3x108 m.s-1)

Q: The DO3A ligand is an acyclic octadentate ligand with three N- donors and five O-donors. '

A: This statement is false  It has three N donar  but it has only four O donar atom .

Q: Briefly speculate on why many cobalt (III) compounds are prepared by oxidizing CO(II) salts rather…

A:

Q: The coordination sphere of a complex consists of __________.     the central metal ion only…

A: Coordination compound are salts in which metal is bonded to ligands.

Q: What type of isomerism is shown by the following complex: [Co(NH3)6][Cr(CN)6]

A: The type of isomerism shown by the complex [Co(NH3)6[Cr(CN)6 is "Coordination isomerism".

Q: What is the coordination number of a complex ion that consists of 2 tridentate ligands?     6…

A:

Q: Hexaamminechromium(III) ion, [Cr(NH3)6]°* is a metal complex containing six ammonia ligands i. Using…

A:

Q: A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: Suitably substituted square planar and octahedral complexes can show the cis-trans isomerism.…

Q: Suppose that the complex ion [Co(NH3)2(OH2)2Cl2]+ is synthesized with the two ammine ligands cis to…

A:

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: The complex diamminedichloroplatinum(II), [Pt(NH3)2CI2], is diamagnetic and exhibits geometrical…

A: If we check the oxidation state of Pt  Pt + 0 - 2 = 0 Pt = 2 NH3 being neutral molecule contributes…

Q: What determine whether a molecule or ion complex is chiral? How would you differentiate between…

A: A chiral is an object that is not identically super-imposable with a mirror image of itself. An…

Q: Crystals of hydrated chromium(III) chloride are green, have an empirical formula of CrCl3 . 6 H2O,…

A: According to the Werner’s theory, any metal ion in the coordination complex consists of two types of…

Q: Draw the structure of the complex, [Ni(NH3)6][BF4]2, including approximate bond angles (in °).…

A: The objective of the question is to draw the given complex and write the angle and geometry.

Q: Hexaamminechromium(III) ion, [Cr(NH3)s]³* is a metal complex containing six ammonia ligands i. Using…

A: A question based on coordination compounds that is to be accomplished.

Q: If the ligands are either Cl", ethylenediamine or H₂O, which of the following is TRUE? O a. The…

A:

Q: 4) What is the shape of the complex ion? 5) Are the ligands strong or weak? 6) Is the compound high…

A:

Q: a. Compounds 1 and 2 are complex ions of cobalt. 2+ 2+ NH2 H2 PME2 Me2 H,N. H,N NH, H2 Me,P. Me,P…

A:

Q: A d' octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

A:

Q: The complex [COF6]¯ absorbs light at a wavelength of 290 nm. What is the value of the crystal filed…

A:

Q: on the basis of crystal field theory explain why Co(III) forms paramagnetic octahedral complex with…

A: CFT stands for crystal field theory which explains the splitting of degeneracies of d- and…

Q: i. State TWO (2) characteristics of a o-donor ligand. By using one example, explain how to change a…

A: A sigma-donor ligand is a ligand that acts as a Lewis base donating electrons from a lone pair to…

Q: Q3. Calculate the crystal field stabilization energy (in terms of Da) for the complexes:…

A: Applying formula of CFSE  =[ x×-0.4+y×0.6]∆° + ZP  Where  X is no of electrons in t2g  Y is no of…

Q: 9 A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A:

Q: The absorption spectrum of the complex ion [Rh(NH,)6+ has maximum absorbance at 295 nm. Calculate…

A: Given, Maximum absorbance of the ion  295 nm ∆ = hc/ λ = [( 6.626 x 10 -34 Js ) x ( 3 x 10 8 m/s) x…

Q: Write the hybridization and shape of the following complexes: (i) [CoF6]3- (ii) [Ni(CN)4]2- (Atomic…

A: The hybridisation and shape of the given compounds are

Q: Would you expect the complex [Cu(NH3)4(H2O)2]2+ to have isomers? If yes, what isomers would exist?

A: Yes there will be isomers of the complex [Cu(NH3)4(H2O)2]2+  this is because the H2O ligands can be…

Q: The complex [Mn(NH3)6]2+ contains five unpaired electrons.Sketch the energy-level diagram for the d…

A:

Q: Two Fe(II) complexes have low spin but different ligands. The solution of one is green, while the…

A: Given:- Two Fe(II) complexes have low spin but different ligands. The solution of one is green,…

Q: The octahedral complex ions [FeCl6]3- and [Fe(CN)6]3- are both paramagnetic, but the former is high…

A: Both the octahedral complex ions [FeCl6]3- and [Fe(CN)63- have Fe in +3 oxidation state. The number…

Q: A complex absorbs photons with an energy of 4.51 * 10-19 J. If this is the only place in the visible…

A: Given: Energy, E=4.51×10-19 J

Q: [CoF6]3- absorbs 700 nm (red) radiation whereas [Co(H2O)6]3+ absorbs 600 nm (orange) radiation.…

A: The crystal field energy diagram f the given complexes is drawn as follows:

Q: Using crystal field theory, prove [NiCl4]2¯ is a tetrahedral paramagnetic complex.

A: Crystal field theory ia an electrostatic model which considers the metal-ligand bond to be ionic…

Q: The octahedral complex ion [CoF6]3– is paramagnetic with four unpaired 3d-electrons, whereas the…

A:

Q: Arrange the following complexes in terms of ligand strength: [Cr(OH)6]3–, [Cr(NH3)6]3+, and…

A: The ligand strength is determined by the value of ∆° ie splitting energy. Various ligands are…

Q: You have a solution of the following ion: [Fe(H2O)6]3+ a) Is the ion more likely paramagnetic or…

A: In the crystal field theory, the paring of electrons in the splitted state does not take place for…

Q: The maximum absorption for the complex ion [Co(NH3 )6 ] 3+ is located at 470 nm. A) Predict the…

A: The wavelength absorbed by the complex is 470 nm Color of the coordination complex will be…

Q: What is the formula for the complex ion made by iron(IIl) with 4 aqua and two thiosulfato (S,0022)…

A: Known Metal ion - Fe3+   ; ligands are 4 aqua - 4 H2O S2O32- Complex should be written in square…

Q: The pentacarbonylferro complex (0) has a trigonal bi-pyramid geometry. Demonstrate the orbital…

A: In this question, it is given that pentacarbonylferro complex (0) has a trigonal bi-pyramid…

Q: Draw the geometrical isomers of complex [Pt(NH3)2Cl2]. (ii) On the basis of crystal field theory,…

A: Geometrical isomers: These are the two or more coordination compounds that contain the same number…

Q: The complex ion [Co(CO3)3]3-, an octahedral complex with bidentate carbonate ions as ligands, has…

A: (a)

Q: Write the IUPAC name of the complex [CoBr2(en)2]+. (b) What type of isomerism is shown by the…

A: Since you have posted multiple questions, we will solve only first question for you. If you want any…

Q: 9 A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: [MA2B2]X2 ->The coordination number of metal is 4.

Q: An octahedral complex, MA4B2 (A and B are monodentate ligands), has two stereoisomers (trans and…

A: The correct option is as follows:

Q: For the complex [Fe(en)2Cl2], Cl, (en = ethylene diamine), identify(i) the oxidation number of…

A: Organometallic compounds contains a bond between a metal and a carbon atom of an organic ligand.…

Q: Answer the following questions about the complex ion [Co(en)₂Br₂]CI, where en = ethylenediamine.…

A: The complex ion : Coen2Br2Cl                       Where, en : ethylenediamineWe have to write -…

Q: (a) Construct a clearly labelled molecular orbital energy level diagram for an octahedral complex…

A:

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.