For the reaction: 2 H₂(g) + O₂(g) → 2 H₂O(g), the enthalpy change is -484 kJ/molx a. Are the bonds in the reactants or products the strongest? Explain your choice. b. What would be the enthalpy change for the reaction: 2 H₂O(g) → 2 H₂(g) + O₂(g)[ kJ/molx rxn

Compounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJ

We burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.

The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.

The enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?

Salicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?

The reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?

What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.

The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).

Which of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?