For the following table fill in the missing values and calculate the theoretical yield.                                            A     +     2B à         C                                   moles 0.00242 0.00242 ?_________   MW   ?_________   98.06   164.16         g ?_________ ?__0.00002467_______ ?_________ mL 0.20     d(g/mL) 0.80

Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield

Balance the reaction.   note: Add four numbers.___________ Fe(OH)3   +   _________ H2SO4   →   ________ Fe2(SO4)3   +   ________  H2O

How would you balance this equation N2H4(I) -----> NH3(g) + N2(g)

MISSED THIS? Watch KCV: Limiting Reactant, Theoretical Yield, and Percent Yield IWE: Limiting Reactant and Theoretical Yield; Read Section 4.4. You can click on the Review link to access the section in your e Text. For the reaction Ti(s) + 2 F2 (g) → TiF4(s) compute the theoretical yield of the product (in grams) for each of the following initial amounts of reactants. y Part B Correct The limiting reagent of this reaction is F2 as it only yields 4.89 of TiF4 comp Ti to calculate yield. 2.5 g Ti, 1.7 g F2 Express your answer using two significant figures. m = Submit ΠΫΠΙ ΑΣΦ Request Answer C ? 80

A chemist combines 3.12g of magnesium nitride with 1.770g of water which react to produce magnesium oxide and ammonia. Answer the following about this reaction.

Sodium and chlorine react to form sodium chloride:   What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl

1. What coefficients (in order from left to right) are needed to balance the following chemical equation? ___Fe2O3(s) + ___C(s) → ___Fe(s) + ___CO(g)   a. 1, 2, 3, 3 b.1, 2, 1, 3 c 1, 3, 2, 3 d.2, 1, 2, 3

9. Balance the following reaction: P4010 (s) 6PCI (s) → → lU POCI3 (1) \U POCI3 (1) What mass of each substance will be present after 15.00 g of P4010 and 15.00 g of PCI5 are reacted completely? (Hint: This is a limiting reactant problem!)