Consider the combustion reaction of propane, C3H8, with oxygen gas.a. Write the balanced chemical equation for this reaction.b. What mass of oxygen is needed to burn 100.0grams of propane?c. What is the theoretical yield of water when 100.0g of propane undergoes combustion?

If a reaction is run that is supposed to produce 125 g (theoretical yield) of product and the actual yield of product that was produced was 73.5 g, what is the percent of yield of this reaction?   A. 170%   B. 1.70%   C. 73.5%   D. 58.8%

6.) Sodium Acetate reacts with Magnesium Sulfite. a.) Write a balanced chemical equation for the reaction. b.) If you started with 50.0 g of Magnesium Sulfite (and excess Sodium Acetate), how much Magnesium Acetate will you make?

Adsız - Paint osya Giriş Görünüm OBA D Anahat - * Kes t Kırp Doldur Kopyala O Yeniden boyutlandır 2. Воyut 1. Firçalar OPO Renk Dıştır Seç A Döndür " Renk Resim Araçlar Şekiller Pano Please balance the given reaction. Calculate how many grams of O2(g) are produced from the decomposition of 2 moles of potassium chlorate addressing to the stochiometry? H;PO4 + CaO → Ca3(PO4)2+ H2O KC1O3(6) KCle) + Oze) You can reach to the atomic numbers and the molar masses of atoms from the link given below: https://www.thoughtco.com/thmb/ZRnAQRiLFYTpaGAu32K9uZnqPEI=/1250x0/filters:no upscale():max_ bytes(150000):strip_icc():format(webp)/PeriodicTableoftheElements- 5c3648e546e0fb0001ba3a0a.jpg 593, 256рх 52 x 22px O 1152 x 648px P Aramak için buraya yazın 立

Glucose (CeH12O6) can be fermented to yield ethanol (C2H5OH) and carbon dioxide (CO2). a. What is the theoretical yield of ethanol (in grams) produced with a 72% yield2 and actual yield of 43.5 g? b. What is the mass of glucose (in grams) in the fermentation reaction? C6H1206 → 2 C2HSOH + 2 cO2 Molar mass of CGH1206 = 180.156 g/mol Molar mass of C2HSOH = 46.07 g/mol Molar mass of CO2 = 44.01 g/mol

Consider the generic chemical equation: 2 A + 4 B --------> 3 C 1. If 10.0 moles of each reactant were used to complete that reaction, which of the following is true.  a. A is the limiting reactant and 15.0 moles of C will be produced. b. A is the limiting reactant and 20.0 moles of C will be produced. c. B is the limiting reactant and 7.50 moles of C will be produced. d. B is the limiting reactant and 22.5 moles of C will be produced.  2. What is the percent yield of this reaction if 6.40 moles of C were actually produced?

Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield

2A. Molecular Weight of Ammonia Atomic weight: Nitrogen 14.0g/mol Hydrogen 1.00g/mol   2B. Nitrogen gas and Hydrogen gas were combined to form Ammonia.  What is the coefficient of Ammonia?   2C. Nitrogen gas and Hydrogen gas were combined to form Ammonia.  What is the coefficient of Hydrogen?   2D. Balance the equation P2O5 + H2O -> H3PO4 What is the coeffiecient of P2O5, H2O, H3PO4 respectively?   2E. Balance the equation B10H18 + O2 -> B2O3 + H2O What is the coeffiecient of B10H18, O2,  B2O3, H2O respectively?

Consider the balanced chemical reaction: 2Al+3Br2-----2AlBr3 If 6.0 g of aluminum reacts with 68 g of bromine and the reaction has an 85% yield, how many grams of aluminum bromide can you form? a. Theoretical yield of AlBr3= ? b. Actual yield of AlBr3=?

1. In a reaction of phosphorus and chlorine, both species is 25.0 g, which of the following assumption will be considered so P4 is the limiting reactant? a. Cl2’s mass must be lesser than the molar mass of P4. b.Cl2 must be greater than 25.0 g. c. Cl2 ­must be less than 25.0 g. d. Cl2’s mass must be greater than the molar mass of P4. e. Cl2 should be greater than 25.0 g 2.Which of the following approaches cannot be employed in doing the stoichiometry of gases? a.The approaches in solving gas stoic can be done on both reversible and irreversible. b.Differences in physical dimensions of variables may not be considered. c. Stoichiometry of gases can be proceeded regardless of quantity known. d. Gases should be taken differently due to physical conditions. e. Use the conservation of matter the same as solid and liquid. 3. Bleaching products contain sodium hypochlorite, a chlorine bleach. If you are the manufacturer of the bleach, how will you consider the amount of the…