What is the correct complete IUPAC name for the compound represented by the line-angle formula above.

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: What is the correct IUPAC name for the compound shown here?

A: The given compound is  IUPAC Name of this compound has to be determined.

Q: What is the correct IUPAC name of the following compound? Problem viewing the image, Click Preview…

A: To give the IUPAC name to the compound , first we will see the long carbon chain and then the…

Q: Give the IUPAC name of the compound below. Br Br

A:

Q: Write the IUPAC name of the following compound in lowercase and without using any spaces where not…

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Q: The IUPAC name of the compound below

A: Organic compounds are named according to the IUPAC nomenclature which has some general rules. The…

Q: Provide the correct IUPAC name for the compound shown here. CH3 CH3 CH2 H2C, CH2 ČH3

A: The IUPAC name of the given compound is

Q: Name the IUPAC name of the following compound. N-

A:

Q: Give  the correct IUPAC name and spelling of the following compounds. Note proper notations (like…

A:

Q: What is the correct IUPAC name for the compound below?

A: Given,

Q: Provide the correct IUPAC name for the compound shown here. CH3

A:

Q: s the IUPAC name of the compound below?

A: Aldehyde is an organic compound having functional group of RCHO. Ketone is an organic compound…

Q: Provide the correct IUPAC name for the compound shown here. H

A:

Q: Identify the IUPAC Name of the following compounds.

A: Given compound: (1)  The numbering of the main carbon chain can be done as follows:

Q: Provide the correct IUPAC name for the compound shown here. SH

A: According to IUPAC , First provide numbering to the longest carbon chain (4carbon chain). Start…

Q: What is the IUPAC name for the following molecule? Br

A:

Q: What is the Iupac name of the following compound sh

A: We have to write the iupac name of the following compound sh as follows in step 2:

Q: what is the IUPAC name of the picture below

A:

Q: Provide the correct IUPAC name for the compound shown here. OH

A: IUPAC nomenclature of carboxylic acid: • Identify the longest continuous carbon chain. • Identify…

Q: Identify the IUPAC name of the following compounds.

A:

Q: Give the correct IUPAC name for the following compound:

A:

Q: Which of the following is the correct IUPAC name of the compound below O,N CHO

A:

Q: What is the IUPAC name of the compound below?

A: The longest chain in the molecules consist of 7 C-atoms The molecule also has 3 methyl side chains…

Q: What is the correct IUPAC name for the compound shown here? HO,

A: The name of the given compound will be based on IUPAC (International Union of Pure and Applied…

Q: What is the IUPAC name for the compound shown below?

A: First , Choose the longest carbon chain which has highest number of carbon ,then start  numbering to…

Q: Provide the IUPAC name for the compound shown here. SH

A:

Q: The correct IUPAC name for the following compound is:

A: I

Q: The IUPAC name of the compound below is

A: 9

Q: HO Provide the correct IUPAC name for the compound shown here.

A:

Q: What is the IUPAC name for the compound shown below? он Он

A: The given compound contains 3 carbon atoms that are connected linearly and 2 –OH groups are…

Q: Select the correct IUPAC name of the molecule shown here.

A: The IUPAC name of the given structure is benzene.

Q: What is the correct IUPAC name of the following compound? *

A: The general skeleton of IUPAC name is Prefix + Parent carbon chain/ring + suffix Here, Parent carbon…

Q: Br HBr

A: The IUPAC names of the given compounds are

Q: What is the correct IUPAC name of the following compound? Br

A:

Q: What is the correct IUPAC name of the following compound?

A: An IUPAC name of a molecule is also called a systematic name as it is created obeying some specified…

Q: What is the IUPAC name of this compound? H Other Exp

A: Write IUPAC name of the given structure ?

Q: rovide the most correct IUPAC name for the compound draw H₂C CH₂

A:

Q: Provide the correct IUPAC name for the compound shown here. `CH3

A:

Q: What is the IUPAC name of the compound shown below?

A:

Q: What is the preferred IUPAC name of the compound in Figure

A: We have given that  What is the preferred IUPAC name of the compound in Figure 1

Q: Write a complete IUPAC name for each of the following compounds

A: In this question, the IUPAC name of the provided compounds has to be determined. (i) IUPAC Name:…

Q: What is the IUPAC name of the following compound? HO HO.

A:

Q: Choose the correct IUPAC name for the following compound

A: The correct IUPAC name for the given compound can be shown below,

Q: Give the correct IUPAC name for the following compound.

A:

Q: Determine the correct IUPAC name for the compound shown here.

A: IUPAC rules to assign  names to the organic compounds Choose the longest chain as parent chain ,…

Q: What is the correct IUPAC name of the following compound? но

A: Carboxylic acids have –COOH as the functional group. This functional group is bonded with the parent…

Q: What is the correct IUPAC name for the compound shown here? to

A: Note: According to our guidelines we are supposed to answer only one question.

Q: Fl in the blank What is the IUPAC name for the following compound? H.

A: The given compound is drawn below :

Q: What is the IUPAC name of the following molecule? Write your answer without any spaces or any…

A: As per the rules of IUPAC Nomenclature, olefin will get the priority first and the number shall…

Q: Write a complete IUPAC name for each of the following compounds.

A: The solution is given below -