Be sure to answer all parts.  A quantity of 0.0350 mol of a gas initially at 0.050 L and 29.0°C undergoes a constant-temperature expansion against a constant pressure of 0.200 atm. If the gas is allowed to expand unchecked until its pressure is equal to the external pressure, what would its final volume be before it stopped expanding, and what would be the work done by the gas?   V=_____L W=____J

Dry ice is solid carbon dioxide; it vaporizes at room temperature and normal pressures to the gas. Suppose you put 21.5 g of dry ice in a vessel fitted with a piston (similar to the one in Figure 6.9 but with the weight replaced by the atmosphere), and it vaporizes completely to the gas, pushing the piston upward until its pressure and temperature equal those of the surrounding atmosphere at 24.0C and 751 mmHg. Calculate the work done by the gas in expanding against the atmosphere. Neglect the volume of the solid carbon dioxide, which is very small in comparison to the volume of the gas phase.

Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?

A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?