A B D ZO

List the major organic products which are formed when the following compounds react with methylmagnesium bromide (CH3MgBr), followed with the addition of dilute acid. 2-pentanone propanal

↓ Draw the product of this reaction. Ignore inorganic byproducts. Br2 (1 equiv) Drawing Q

Illustrate the series of reactions that can be performed to produce propylmethanoate from two alcohols.

In this task you will compare the chemical properties of alcohols and carbonyl compounds. Complete the table below. Aliphatic compound Homologous series Type of reaction(s) addition/substitution/redox Propan-1-ol     Propan-2-ol     2-methylpropan-2-ol     Ethanal     Propanone       2. Describe the similarities and differences in the chemical reactions between alcohols and carbonyl compounds. Include reaction equations.

Predict the product or products from the hydroformylation of cyclohexene.

Give the systematic (IUPAC) names for these molecules. Boononon cnolonongron. НаСНз CHОССH2СH2СНCHЗ CH3 phenyl propanoate |4-methyl pentane methanoat Incorrect. You mixed up the acyl and alkoxy portions of the molecule. Name the alkoxy part first, followed by the acyl part.

Other than the aromatic ring, what functional group is present in the major organic product of the following reaction? Ophenol Oketone O aldehyde carboxylic acid + KMnO4 H₂O

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?

The production of an ether from an alkyl halide. nucleophilic substitution reaction O radical substitution reaction O addition reaction O elimination reaction