Balance the following equations.(a) CaC2(s)+H2O(l)----->Ca(OH)2(s)+C2H2(g)(b)(NHa)2Cr2O7(s)------>Cr2O3(s)+N2(g)+H2O(g)(c)CH3NH2(g)+O2(g)----->CO2(g)+N2(g)+H2O(g) 3.12. Balance the following equations.(a) CaC2 (s) + H2O(t) → Ca(OH), (s) + C2H2 (g)(b) (NH,), Cr2 O7 (s) → Cr,O3 (s) + N2(g) + H2O(g)(c) CH;NH2 (g) + O2(g) → CO2(g) + N2 (g) + H2O(g)

While balancing the reaction, number of atom in reactant should be equal to number of that atom in…

Answered: 3.12. Balance the following equations.…

3.12. Balance the following equations. (a) CaC2 (s) + H2O(t) → Ca(OH), (s) + C2H2 (g) (b) (NH,), Cr2 O7 (s) → Cr,O3 (s) + N2(g) + H2O(g) (c) CH;NH2 (g) + O2(g) → CO2(g) + N2 (g) + H2O(g)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: (1) [Text - Problem 2.6] 2-6 Balance the following chemical equations: (a) CaCl2 + Na2CO3 CaCO3 +…

Q: Fe(NH,)2(SO4)2 6H;0 + H2C,O4 + K2C,04 + H2O2 → K3FE(C20.)3-3H2O + (NH.);SO4 + H,SO, + H,O. 1.…

A: Answer - The balance dchemical reaction is 2Fe(NH4)2(SO4)2*6H2O+ 3H2C2O4 + 3 K2C2O4 +H2O2…

Q: Balance the following equations:

A: balancing of reaction is done to follow the conservation of mass.

Q: Question 4 of chapter 4, General Chemistry: Principles and Modern Apps by Petrucci Balance…

A: (a)The chemical reaction of sulphur dioxide gas with oxygen gas to produce sulphur trioxide gas is…

Q: Lead(II) carbonate, also called “white lead,” was formerly used as a pigment in white paints.…

A: Given,Mass of lead (II) acetate = 1.25g.Mass of carbon dioxide = 5.95g.The balanced equation can be…

Q: 1. Balance the following equation: Al(s)+ 4H₂SO,(aq)+. KOH(aq) - KAI(SO),(s) + H₂O(1)+3H₂(g)

A: A chemical reaction follows the law of conservation of mass. According to the law of conservation of…

Q: Balance the following equations:(a) Ca3P21s2 + H2O1l2 ¡ Ca1OH221aq2 + PH31g2(b) Al1OH231s2 +…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: (a)If 12.06 g of NH4+ was found in the soil, how many ions of NH4+ was present initially? (b)If 500…

A: Given : Mass of NH4+ = 12.06 gm Mass of H2O produced = 500 gm

Q: 1. Use chemical symbols to generate the factor needed to convert the weight of the substance in uie…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Balance the following chemical equation (if necessary): Si,H,(s) + O,(g) → SiO,(g) + H,O(g)

A: We have to predict the balanced chemical reaction.

Q: How to balance the chemical equation for sodium potassium tartrate

A: A balanced chemical equation justifies the law of conservation of mass.

Q: •5H2U, is important commercially to the photography business as "hypo", because it has the ability…

A: Theoretical Yield = mass of product which can be produced during the reaction. Actual Yield = Mass…

Q: Aqueous solutions of ammonia (NH3) and bleach (activeingredient NaOCl) are sold as cleaning fluids,…

A: Hey, since there are multiple sub-part questions posted, we will answer first three questions. If…

Q: Balance the following equations and indicate whetherthey are combination, decomposition, or…

A: In a combination reaction, two substances combine together to form a single substance. In a…

Q: Balance the following reactions: a) Mg + N2 + MgsN2 PCes + H20 + H3PO4 + HCe Al + FesO4+ Al,O3+ Fe…

A: Since you have posted a question with multiple sub-parts, we will solve the first three sub-parts…

Q: Do either of the following reactions go to completion? If so,what factor(s) cause(s) each to do…

A: a) Magnesium sulfite (MgSO3) acts as a base and hydrochloric acid (HCl) acts as an acid in the…

Q: 3. Balance the following equations: (a) SO2 (g) + O2 (b) P:Os (s) + H2O (1) (c) CH« (g) + Cl2 (9)…

A: While balancing the reaction, number of atoms in reactant should be equal to number of that atoms in…

Q: Part A) Place the following elements in order of increasing atomic radii: Mg, Na, Rb, Cl.…

Q: 8. Balance the following equations: (a) SO₂ + 0₂ - SO3 (b) Li₂O(s) + H₂O(1) LiOH(aq) (c) Na + H₂O…

A: Note: As per bartleby guidelines, solutions of first 3 questions has been made. For the exper…

Q: (a) 1. Balance the following equations and provide the type of reaction (TOR) Text TOR: (b). TOR:…

Q: Balance the following equations by adding the appr

A: Answer: Given chemical equation: Na3PO4+Ca(OH)2→Ca3(PO4)2+NaOH

Q: Complete and balance the following equations: a)AgCl(s)+NH3(aq)--> b)Pb2+(aq)+CrO42--->…

A: Note: Since you have posted a question with multiple sub-parts, we will solve the first three…

Q: What mass (in g) of silver oxide, Ag2 O, is required to produce 23.4 g of silver sulfadiazine,…

Q: 4. Looking Ahead: The above reactions are balanced according to the number of moles of each type of…

Q: Balance the following equations: (g) Hg2(C2H3O2)2(aq) + KCl(aq) ----> Hg2Cl2(s) + KC2H3O2(aq) (h)…

A: Given reaction equations, (g) Hg2(C2H3O2)2(aq) + KCl(aq) → Hg2Cl2(s) + KC2H3O2(aq) (h) KI + Br2 →…

Q: Identify the oxidation state of nitrogen in the following: (b) NO2 (a) NO3- (c) NO,-

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: complete ionic equation:

Q: Predict the product of the following reactions: (a) BaCl2(ag) + K,SO4(aq) (b) Fe,(SO4)3(aq)…

A: Balancing a chemical equation involves making the number of atoms of an element on each side equal

Q: minum hydroxide reacts with sulfuric acid as follows 2 Al(OH)3 (aq) + 3 H,SO (aq) AlSOh (aq) 6HO0 1.…

Q: Q1:-(A) Choose(5) the correct answer:- 1- Rusting " applies to the corrosion of (iron or iron- base)…

A: * Please resubmit the question for part 4-6*

Q: Blast furnaces extra pure iron from the iron(III) oxide in iron ore in a two step sequence. In the…

A: Answer:During the production of iron from iron ore, iron oxide is reduced into iron by using CO gas…

Q: 03 CaCl2(aq) +2 K3PO4 (aq) →> 6 KC1 (aq) + Ca(PO4)2 (5)

A: Ionic equation : An ionic equation is a chemical equation in which the electrolytes in acqueous…

Q: Give a clear explanation handwritten answer....give detailed answer with explanation

A: Balanced chemical equation is the equation in which number of atoms on both sides of equation are…

Q: (f) Balance the following equations: (i) C4H10+ O₂ →>> (ii) H3PO4 + Mg(OH)2 (iii) (NH4)2Cr₂O7 →…

Q: Which one of the following represents the net ionic equation for the reaction of HBr with Ca(OH)₂?

A: The given reactant are: HBr and Ca(OH)₂ The reaction will be: 2HBr (aq) + Ca(OH)₂ (aq) -->…

Q: The oxidation state of chromium in potassium dichromate in the following reaction is: 2 K2Cr2O7 (aq)…

A: Potassium dichromate is K2Cr2O7...

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: Thank you,Please rate my response.

Q: 1) We will be using the following chemical reaction in this lab: HC2H;O2aq) + NaHCO3(aq) →…

A: For the reaction HC2H3O2(aq) + NaHCO3(aq) → NaC2H3O2(aq.) + CO2(g)amount of NaHCO3 used = 10…

Q: Balance the following equations. (Use the lowest possible whole number coefficients. Include…

A: a) Au2(SO3)3 + H3PO4 → Au(H2PO4)3 + H2SO3b) (NH4)2V2O7(s)→V2O3(s)+H2O(g)+N2(g)c)…

Q: Balance the following equations.

A: Steps to balance a chemical equation 1. Write unbalanced equation 2. Make a list…

Q: Please predict the products and balance the following chemical equation Rg(HCO3)3 (aq)+ Na2S (ag) →

Q: how many moles of CO2 are expected from 0.01428 moles of baking soda NaHCO3 in the equation NaHCO3…

A: Given, moles of NaHCO3 reacted = 0.01428 mol moles of CO2 produced/expected = ? In this type of…

Q: Balance the following equations and indicate whether theyare combination, decomposition, or…

A: Given reactions, (a) C3H6(g) + O2(g) ---> CO2(g) + H2O(g) (b) NH4NO3(s) --> N2O(g) +…

Q: Balance these chemical equations. (Use the lowest possible whole number coefficients.) (a) SO2 +…

Q: Balance the equation (g) C4H, NO. (ay) + Of (g) -> Co₂ly) + H₂O(d) + CH₁, N₁₂O(a) O2 8 3

Q: Complete and balance ---Fe(s)+---O2(g)---> ---Cu(s)+---H2SO4(aq)---> ---Rb2O(s)+---H2O(l)--->

A: We have been given three chemical reactions and We have been asked to complete and balance the given…

Q: Balance these chemical equations. (Use the lowest possible whole number coefficients.) (a) N2H4…

Q: Complete and balance the equations for each of the following reactions. All yield products. (a)…

Question

Balance the following equations.

(a) CaC2(s)+H2O(l)----->Ca(OH)2(s)+C2H2(g)
‍‍
(b)(NHa)2Cr2O7(s)------>Cr2O3(s)+N2(g)+H2O(g)
‍‍‍
(c)CH3NH2(g)+O2(g)----->CO2(g)+N2(g)+H2O(g)
‍

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Name: Balancing Chemical Equations Balance the following equations using whichever method you prefer: 1) K (s) + MgBr2 (aq) → KBr (aq) + Mg (s) 2) CHSOH (I) + CO2 (g) + H20 (g) 3) P (s) + (a) 30 P20s (s) 4) CO: (g) + H2O (1) > O2 (g) + CH12O6 (s)
Balance the following equations:(a) Al4C31s2 + H2O1l2¡Al1OH231s2 + CH41g2(b) C5H10O21l2 + O21g2¡CO21g2 + H2O1g2(c) Fe1OH231s2 + H2SO41aq2¡Fe21SO4231aq2 + H2O1l2(d) Mg3N21s2 + H2SO41aq2 ¡MgSO41aq2 + 1NH422SO41aq2
Balance these chemical equations. (Use the lowest possible whole number coefficients.) (a) S8 + O2 → SO3 chemPad Help (b) NaNO3 → NaNO2 + O2 chemPad Help (c) C4H10 + O2 → CO2 + H2O chemPad Help (d) AgCl2 + H2 → Ag + HCl chemPad Help (e) Ga + H2SO4 → Ga2(SO4)3 + H2 chemPad Help (f) N2H4 + O2 → H2O2 + N2 chemPad Help
(a) Iz(s) + 5 Cu²* (aq) + 6 H2O(1) (b) Hg²*(aq) + 21 (aq) (c) H2SO3(aq) + 2 Mn(s) + 4 H*(aq) → S(s) + 2 Mn²* (aq) + 3 H,O(I) 2 10;"(aq) + 5 Cu(s) + 12 H*(aq) - Hg(1) + I2(s) - -
Balance these chemical equations. (Use the lowest possible whole number coefficients.) (a) Sr + H2O → Sr(OH)2 + H2 (b) Na2SO4 + C → Na2S + CO (c) NH3 + O2 → NO2 + H2O (d) N2H4 + O2 → H2O2 + N2 (e) Pb(NO3)2 → PbO + NO2 + O2 (f) P2H4 → PH3 + P4
Balance the following chemical equations.
What is the balanced net ionic equation for the following reaction: H2SO4(aq) + KOH(aq) + K2SO4(aq) + 2H20(1) O H,SO4laq) + 20H'(aq) SO, (aq) + 2H2O() O H,SO4laq) + 2KOH(aq) K2SOa(aq) + 2H201) O 2H*(aq) + SO,2 (aq) +2K*(aq) + 20H'(aq) + 2K*(aq) + SO, (aq) + 2H2O(1) O H(aq) + OH (aq) H2O(I) O There is no reaction.
How do I calculate % aluminum in this sample?
Please help me fill in the blanks to find out theoretical yield
5. (a) What do you mean by 'atom economy' of a reaction? How does atom economy differ from % yield? Calculate the atom economy for the following reaction: CaCO3 > CaO + - CO
Balance the following equations: (a) SO2 + O2 ------>SO3 (b) Li2O(s) + H2O(l) ------> LiOH(aq) (c) Na + H2O ------> NaOH + H2
Balance the following equations and determine which type of reaction is occurring. CO2 (g) 3. (NH4)2CO3 (S)→ Zn (s) + NH3 + H₂O + H3C6H5O7 (aq) → Zn (C₂H3O2)2 (aq) + Zn3(C6H5O7)2 (aq) H₂ (g) Na3PO4 (aq) → NaC2H3O2 (aq) + Zn3 (PO4)2 (S)