all 3 questions 10. What are shared in covalent bonds? *CationsProtonsElectronsAnions11. What type of reaction does the equation describe? LICIO2 --> LICI + 02 *SynthesisDouble ReplacementSingle ReplacementDecomposition12. Molybdenum has a molar mass of 95.94 g/mol. How many moles are in 150.0gof Molybdenum? *0.1563 mol0.6396 mol1.563 mol6.396 molO O

1. Covalent bond : Due to sharing of electrons in between to atoms covalent bond is formed. Note:…

Answered: 10. What are shared in covalent bonds?

Science

Chemistry

10. What are shared in covalent bonds?

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section: Chapter Questions

Problem 3STP

See similar textbooks

Related questions

Q: Name the three main types of chemical bonds?

A: Types of Chemical bonds = 1. Covalent bonds 2. Ionic bonds 3. Metallic bonds

Q: what are the conditions required for making a covalent bond?

A: The tendency of an atom to attract the electrons towards itself is known as electronegativity. The…

Q: What household item has a polar covalent bond?

A: Polar covalent bond :- A covalent bond formed between two atoms of dissimilar electronegativities…

Q: 1. Why do solid covalent compounds ( molecules) have low melting points?

Q: D) Classify the following bonds as either ionic, nonpolar covalent, or polar covalent.

A: The magnitude of the polarity of the bond depends upon the electronegativity difference between the…

Q: What is the feature of Covalent bonds ?

Q: how does the molecular shape of a molecule contribute/affect chemical reactivity?

Q: How Lewis structures depict the atoms, bonding pairs, and lone electron pairs in a molecule or…

A: The electrons, protons, and neutrons are the basic constituents of an atom. They help in determining…

Q: octet

Q: How do I know the geometric shape of a molecule?

A: In order to determine the geometric shape of a molecule, first of all its Lewis structure should be…

Q: What do Single bonds consist of?

A: The term chemical bond generally refers to the attractive force that holds the constituent atoms or…

Q: which factors favours the formation of covalent bond?

A: Covalent bonds are formed by sharing of electrons between atoms.

Q: What are the basic features of ionic and covalent bonds?

A: The basic features of ionic and covalent bonds have to be given below.

Q: What are the three basic types of chemical bonds? What happens to electrons in the bonding atoms in…

A: The three basic types of bonds are: 1) Ionic bond 2) Covalent bond 3) Metallic bond

Q: How do compounds with ionic, polar covalent, and nonpolar covalent bonds differ?

A: Ionic bonds in a compounds are formed by the transfer of electron from one atom to the another atom…

Q: Why is the polarity of the bonds and VSEPR shape of the molecule important to determine the polarity…

A: Bond polarity and ionic character increase with an increasing difference in electronegativity.…

Q: What is a good of a nonpolar covalent bond in a household? Like what is a nonpolar covalent compound…

A: covalent bonds are formed between nonmetallic atoms that share electrons with each others forming…

Q: what are the differences between ionic and covalent bond?

A: Ionic bonds are available in ionic compounds in which the atoms are electro statistically attracted…

Q: Consider the effects of bond polarity to predict the polarity of simple molecules

Q: 12. Write a Lewis structure for SbCls. Does this molecule obey the octet rule?

A: Calculating the total valence electron in SbCl5 Electronic configuration of Sb = [Kr] 4d10 5s2 5p3…

Q: How do metals usually attain an octet in chemical reactions?

A: Answer Metals usually attend and opted in chemical…

Q: a covalent bond 00

A: An example of a covalent bond is Al-Al because both same element and same electrnegativity Hence,…

Q: What is symmetric bonds and assymmetric bonds ?

A: All C-H bonds are same environment and these four H atoms are go same direction. So it is symmetric…

Q: 1. What kinds of elements generally form ionic compounds?

Q: Review the types of chemical bonds and then describe how ionic bonds and covalent bonds are…

A: Main types of chemical bonds are Covalent bond ,ionic bond , hydrogen bond and metallic bond .

Q: Define Covalent Compounds ?

A: The term covalent compounds has to be defiend.

Q: The type of bonds present in K2SO4 is/are: A Polar and nonpolar covalent bonds. B) Only ionic bond.…

Q: Q3/A- what is the type of chemical bonds ? and which one is consider as a strong one ? *

A: Chemical bond may be defined as an attraction between ions,atoms or ,molecules that result in…

Q: Are the bonds in NH4+ ionic or covalent bonds? Explain your answer.

A: The ammonium ion is formed by protonation of ammonia molecule as follows: NH3 + H+ →NH4+⏟Ammonium…

Q: Which molecule has a single covalent bond? O a) co O b) N, O c) Cl, O d) Co,

A: From the struture of molecules we have predicted the type of bond present in it.

Q: What occurs in the formation of a covalent bond? What isthe difference between polar and nonpolar…

A: The intermolecular forces such as attraction and repulsion are responsible for holding the atoms…

Q: Define the concept of Polarity of Molecules ?

A: Dipole monent decide polarity of the molecule Dipole monent is zero, molecule is non polar Dipole…

Q: How do you recognize a covalent compound?

A: We have to recognize a covalent compound? as follows in step 2:

Q: Describe the features of Covalent bonds?

A: To find: The features of Covalent bonds

Q: Using an appropriate example explain the significance of resonance, with regards to molecular…

A: Using an appropriate example explain the significance of resonance, with regards to molecular…

Q: What is the difference between a single bond and a multiple bond?

Q: 5. (a) How is a covalent bond formed? (b) Use Lewis symbols to show the sharing of electrons between…

A: Lewis structure is the structure of the molecule of a compound that depicts the bonding between the…

Q: Illustrate the different types of chemical bonds?

A: A chemical bond is a force of attraction that arises between two or more atoms to form a molecule or…

Q: 1. How is the electronegativity of an element related to its bonding capacity? Elaborate the idea…

A: A bond formed by sharing or transfer of an electron between two same or different atoms is called…

Q: 1. What is meant by the following terms? a) Molecule b) Chemical bond 2. Explain the difference…

A: There are two types of bonds exist between molecules. Ionic bond Covalent bond

Q: 10. Give the steps to determine if a bond is considered nonpolar covalent.

Q: 1) Which molecule contains a polar covalent bond?

A: Since both the atoms are same in N2, hence they have the same electronegativity. As a result, the…

Q: Covalent bonds are called bonds when four electrons are shared Covalent bonds are called, bonds when…

A: Covalent bond is formed by sharing of electrons.

Q: How does VSEPR affect the shape of molecules?

A: VSEPR theory - Valence Shell Electron Pair Repulsion theory,

Q: 8+ 8- H-F This is an example of a bond.

Q: PAS8 ReBra

A: Ionic compounds are those in which ions are held by electrostatic force of attraction.

Q: Why do chemical bonds form? What basic forces are involved in bonding?

A: The two types of bonds are given below, Ionic bond Covalent bond

Concept explainers

Analytical Tools

Analytical tools or analysis tools help one to get into a conclusion or results from the data collected. Analytical tools can be applied for simple data sets and also in the case of big data analytics.

Question

all 3 questions

10. What are shared in covalent bonds? *
Cations
Protons
Electrons
Anions
11. What type of reaction does the equation describe? LICIO2 --> LICI + 02 *
Synthesis
Double Replacement
Single Replacement
Decomposition
12. Molybdenum has a molar mass of 95.94 g/mol. How many moles are in 150.0g
of Molybdenum? *
0.1563 mol
0.6396 mol
1.563 mol
6.396 mol
O O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1 Definations

VIEW

Step 2 Calculation

VIEW

Step 3 Conclusion

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If this reaction has a 37% yield under certain conditions, what mass of CH4 is required to produce 15 g of H2?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
What does it mean to say an equation is balanced? Why is it important for an equation to be balanced?
Consider the following diagram, where atom X is represented by a square and atom Y is represented by a circle. (a) Write the equation for the reaction represented by the diagram. (b) If each circle stands for a mole of Y and each square a mole of X, how many moles of X did one start with? How many moles of Y? (c) Using the same representation described in part (b), how many moles of product are formed? How many moles of X and Y are left unreacted?
What is true about the chemical properties of the product? a. The properties are more like chemical A. b. The properties are more like chemical B. c. The properties are an average of those of chemical A and chemical B. d. The properties are not necessarily like either chemical A or chemical B. e. The properties arc more like chemical A or more like chemical B, but more information is needed. Justify your choice, and for choices you did not pick, explain what is wrong with them.
It sodium peroxide is added to water, elemental oxygen gas is generated: :math>Na2O2(s)+H2O(l)NaOH(aq)+O2(g) ppose 3.25 g of sodium peroxide is added to a large excess of water. What mass of oxygen gas will be produced?
What amount (moles) of compound is present in 1.00 g of each of the compounds in Exercise 52?
For each of the following incomplete and unbalanced equations, indicate how many moles of the second reactant would be required to react completely with 0. 145 mole of the first reactant. msp;BaCl2(aq)+H2SO4(aq) msp;AgNO3(aq)+NaCl(aq) msp;Pb(NO3)2(aq)+Na2CO3(aq) msp;C3H8(g)+O2(g)
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
An air bag is deployed by utilizing the following re tion the nitrogen gas produced inflates the air bag): :math>2NaN3(s)2Na(s)+3N2(g) 10.5 g of NaN1 is decomposed, what theoretical mass of sodium should be produced? If only 2.84 g of sodium is actually collected, what is the percent yield?
What is the limiting reactant in a reaction that produces sodium chloride from 8 g of sodium and 8 g of diatomic chlorine?