G.73. both 1&2 with reason please!!!1. Rank the carbon-metal bond in the following organometallic reagents in order of decreasing polarity,starting with the most polarized. (hint: difference in electronegativity).CHICH LiA. II > I > IIIB. II> III > IIII>I> IIC.D. III>II>IReasoning: The answer is A.CH3CH₂MgBrI2. What is the product of the following reaction?Į-OH-LiA. IB. IIC. IIID. IVReasoning: Alkyl Lithium are nucleophilic in nature. Answer B.H₂OII-IIIII(CH3CH2)2CuLiIVIII

Organolithium compounds are compounds that contain an alkyl group attached to lithium metal.…

1. Rank the carbon-metal bond in the following organometallic reagents in order of decreasing polarity starting with the most polarized. (hint: difference in electronegativity). CHICH:Li A. II>I> III B. II>III>I C. III>I>II D. III>II>I Ceasoning: The answer is A. 2. What is the product of the following reaction? A. I B. II C. III D BE CH₂CH₂MgBr I Į -OH II H₂O III II (CH₂CH₂)2CuLi IV

1. Rank the carbon-metal bond in the following organometallic reagents in order of decreasing polarity starting with the most polarized. (hint: difference in electronegativity). CHICH:Li A. II>I> III B. II>III>I C. III>I>II D. III>II>I Ceasoning: The answer is A. 2. What is the product of the following reaction? A. I B. II C. III D BE CH₂CH₂MgBr I Į -OH II H₂O III II (CH₂CH₂)2CuLi IV

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

(5.5, 5.7 & 5.8) Classify the following reaction. Ba(NO3)2(aq) + K₂SO4(aq) --> O acid-base reaction O gas-forming reaction O decomposition reaction O precipitation reaction
Consider these compounds: A. Ba3(PO4)2 B. Ca3(PO4)2 C. PbCrO4 D. CaCrO4 Complete the following statements by entering the letter(s) corresponding to the correct compound(s). (If more than one compound fits the description, include all the relevant compounds by writing your answer as a string of characters without punctuation, e.g, ABC.) Without doing any calculations it is possible to determine that barium sulfite is more soluble than _________, and barium sulfite is less soluble than ______ It is not possible to determine whether barium sulfite is more or less soluble than _________ by simply comparing Ksp values
(2) jlibäi In the following image these two compound CH,CH, C=C H CH,CH, CH,CH, C=C CH,CH, (A) H H H. (8) A is Cis-compound and B is Trans- Compound A is Trans-compound and B is Cis- compound
An oxide of phosphorus with Mr = 283.88 contains 43.64% of phosphorus by mass. The MOLECULAR FORMULA is ____. Select one: a. P2O5 b. P4O6 c. P4O10 d. P2O3
What is the mass percent composition of platinum in the carboplatin, C6H12N2O4Pt? Relative atomic masses:H = 1.008; C = 12.011; N = 14.007O = 15.999; Pt = 195.08 a.52.40% b.50.38% c.54.05% d.52.55%
An alloy is made up of two metals: tin and lead. If the wt% of tin is 6.48 % calculate the mol% of lead. Atomic Mass: Sn: 118.710 g/mol Pb: 207.200 g/mol Round your answer to 2 decimal places.
4. Na2CO3(aq) + MgCL2(q)
Riccardo states that the process of iron reacting with sulfur to produce iron(II) sulfide according to 16Fe + 3S8 = 8Fe2S3 16.00g of iron will react will 3.00 g of sulfur in the reaction. Do agree or disagree with this statement. Please explain.
3. 4. Is the periodic table useful to you as a student? Justify your answer. If you were to create a simple product using metals, nonmetals, and metalloids, what would your product be like? Sketch the design and composition of your product. Then, briefly explain what properties of each material are utilized in each part of the product.
The steroid contains only C, H and O; combustion analysis of a 14.765 gram sample yields 43.257 g CO2 and 12.395 g H2O. What is the probable formula of the steroid.....?
10.4% C, 27.8% S, and 61.7% Cl Express your answer as a chemical formula.
4) Vitamin B3, also known as niacin, helps maintain the normal function of the skin, nerves, and digestive system. The disease pellagra results from a severe niacin deficiency. Niacin has the following formula: C6HSNO2. Often tablets contain vitamin B3 in the form of niacinamide, C6H6N2O, which is easier to absorb. a. A vitamin tablet contains 100 mg of niacinamide. What mass of niacin contains an equivalent number of moles as 100 mg of niacinamide? b. What is the Recommended Daily Intake (RDI) for niacin? C. Create a list of foods that contain niacin. d. What is pellagra? What are the consequences of ingesting too MUCH niacin?